Index of /her/groups/DAT/media/DAT Reports
![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | Yeomanry field-01.jpg | 2025-03-13 23:59 | 1.7M | |
![[ ]](/icons/layout.gif) | STACKPOLE MANOR HOUS..> | 2025-03-13 23:59 | 47K | |
![[ ]](/icons/layout.gif) | SOUTH HOOK SLIPWAY P..> | 2025-03-13 23:59 | 5.2M | |
![[ ]](/icons/layout.gif) | ST PATRICK's INTERIM..> | 2025-03-13 23:59 | 13M | |
![[ ]](/icons/layout.gif) | Second World War Cam..> | 2025-03-13 23:59 | 2.8M | |
![[ ]](/icons/layout.gif) | Report_No_2019-26_Pa..> | 2025-03-13 23:59 | 1.1M | |
![[ ]](/icons/layout.gif) | Report_No_2016-41_Ll..> | 2025-03-13 23:59 | 19M | |
![[ ]](/icons/layout.gif) | Report Number 2012-0..> | 2025-03-13 23:59 | 7.8M | |
![[ ]](/icons/layout.gif) | Report_No_2016-47_Ll..> | 2025-03-13 23:59 | 21M | |
![[ ]](/icons/layout.gif) | Report No. 2011-06 S..> | 2025-03-13 23:59 | 5.1M | |
![[ ]](/icons/layout.gif) | Report No 2015-66 - ..> | 2025-03-13 23:59 | 8.7M | |
![[ ]](/icons/layout.gif) | Report No 2015-53 - ..> | 2025-03-13 23:59 | 11M | |
![[ ]](/icons/layout.gif) | Report No 2015-44 Ca..> | 2025-03-13 23:59 | 5.3M | |
![[ ]](/icons/layout.gif) | Report No 2015-41 Pl..> | 2025-03-13 23:59 | 2.5M | |
![[ ]](/icons/layout.gif) | Report No 2015-43 Tr..> | 2025-03-13 23:59 | 6.2M | |
![[ ]](/icons/layout.gif) | Report No 2015-36 La..> | 2025-03-13 23:59 | 2.7M | |
![[ ]](/icons/layout.gif) | Report No 2015-24 - ..> | 2025-03-13 23:59 | 2.1M | |
![[ ]](/icons/layout.gif) | Report No 2015-21 - ..> | 2025-03-13 23:59 | 2.0M | |
![[ ]](/icons/layout.gif) | Report No 2015-22 - ..> | 2025-03-13 23:59 | 3.1M | |
![[ ]](/icons/layout.gif) | Report No 2015-20 La..> | 2025-03-13 23:59 | 5.3M | |
![[ ]](/icons/layout.gif) | Report No 2015-001 N..> | 2025-03-13 23:59 | 4.3M | |
![[ ]](/icons/layout.gif) | Report No 2013-45 Go..> | 2025-03-13 23:59 | 4.4M | |
![[ ]](/icons/layout.gif) | Report No 2013-64 Na..> | 2025-03-13 23:59 | 562K | |
![[ ]](/icons/layout.gif) | Report No 2012-54 Ca..> | 2025-03-13 23:59 | 4.1M | |
![[ ]](/icons/layout.gif) | Report No 2012-47 Li..> | 2025-03-13 23:59 | 7.0M | |
![[ ]](/icons/layout.gif) | Report no 2012-49 Th..> | 2025-03-13 23:59 | 9.4M | |
![[ ]](/icons/layout.gif) | Report No 2012-44 - ..> | 2025-03-13 23:59 | 11M | |
![[ ]](/icons/layout.gif) | Report No 2012-37 He..> | 2025-03-14 00:00 | 1.1M | |
![[ ]](/icons/layout.gif) | Report no 2012-4 Lla..> | 2025-03-14 00:00 | 6.3M | |
![[ ]](/icons/layout.gif) | Report No 2012-33 Cr..> | 2025-03-14 00:00 | 3.4M | |
![[ ]](/icons/layout.gif) | Report No 2012-28 Wa..> | 2025-03-14 00:00 | 8.0M | |
![[ ]](/icons/layout.gif) | Report No 2012-20 Th..> | 2025-03-14 00:00 | 3.5M | |
![[ ]](/icons/layout.gif) | Report No 2012-14 Ll..> | 2025-03-14 00:00 | 3.7M | |
![[ ]](/icons/layout.gif) | Report No 2012-11 Ro..> | 2025-03-14 00:00 | 11M | |
![[ ]](/icons/layout.gif) | Report No 2011-33 Ea..> | 2025-03-14 00:00 | 1.6M | |
![[ ]](/icons/layout.gif) | Report No 2011 21 L..> | 2025-03-14 00:00 | 2.9M | |
![[ ]](/icons/layout.gif) | Report 2012-29 Trewa..> | 2025-03-14 00:00 | 11M | |
![[ ]](/icons/layout.gif) | Report No 2012-27 Bo..> | 2025-03-14 00:00 | 27M | |
![[ ]](/icons/layout.gif) | Report 2012-09 St Ma..> | 2025-03-14 00:00 | 2.8M | |
![[ ]](/icons/layout.gif) | Report 1151 - Penygr..> | 2025-03-14 00:00 | 6.7M | |
![[ ]](/icons/layout.gif) | Remote Sensing and A..> | 2025-03-14 00:00 | 90K | |
![[ ]](/icons/layout.gif) | RCAHMW_Archives_Depo..> | 2025-03-14 00:00 | 285K | |
![[ ]](/icons/layout.gif) | PRN 109394 Camps & R..> | 2025-03-14 00:00 | 2.9M | |
![[ ]](/icons/layout.gif) | Nant-y-castell 15198..> | 2025-03-14 00:00 | 1.1M | |
![[ ]](/icons/layout.gif) | My Archaeological Ex..> | 2025-03-14 00:00 | 4.0M | |
![[ ]](/icons/layout.gif) | Medieval & Early-Pos..> | 2025-03-14 00:00 | 3.8M | |
![[ ]](/icons/layout.gif) | Monasteries Report 2..> | 2025-03-14 00:00 | 8.4M | |
![[ ]](/icons/layout.gif) | Land adjacent to Gol..> | 2025-03-14 00:00 | 1.2M | |
![[ ]](/icons/layout.gif) | LiDAR Instructions.pdf | 2025-03-14 00:00 | 3.7M | |
![[ ]](/icons/layout.gif) | Heritage Impact Stat..> | 2025-03-14 00:00 | 2.3M | |
![[ ]](/icons/layout.gif) | Holy Wells 2012. Add..> | 2025-03-14 00:00 | 1.7M | |
![[ ]](/icons/layout.gif) | FS15-071 Llanarthney..> | 2025-03-14 00:00 | 4.1M | |
![[ ]](/icons/layout.gif) | FS15-010 Final Repor..> | 2025-03-14 00:00 | 3.2M | |
![[ ]](/icons/layout.gif) | FS14-109 Church View..> | 2025-03-14 00:00 | 2.0M | |
![[ ]](/icons/layout.gif) | FS14-093 - Tower Poi..> | 2025-03-14 00:00 | 1.5M | |
![[ ]](/icons/layout.gif) | FS14-095 Church Lane..> | 2025-03-14 00:00 | 8.5M | |
![[ ]](/icons/layout.gif) | FS14-093 - Solva Geo..> | 2025-03-14 00:00 | 2.3M | |
![[ ]](/icons/layout.gif) | First World War 2015..> | 2025-03-14 00:00 | 1.9M | |
![[ ]](/icons/layout.gif) | First World War - In..> | 2025-03-14 00:00 | 5.7M | |
![[ ]](/icons/layout.gif) | Final ABC HLMP repor..> | 2025-03-14 00:00 | 1.6M | |
![[ ]](/icons/layout.gif) | Fan Foel specialists..> | 2025-03-14 00:00 | 1.2M | |
![[ ]](/icons/layout.gif) | Fish Traps 2013.pdf | 2025-03-14 00:00 | 11M | |
![[ ]](/icons/layout.gif) | ERN_111452_Molleston..> | 2025-03-14 00:00 | 6.8M | |
![[ ]](/icons/layout.gif) | ERN_111229_Cefn_Garn..> | 2025-03-14 00:00 | 6.9M | |
![[ ]](/icons/layout.gif) | ERN_109400_King_Stre..> | 2025-03-14 00:00 | 2.0M | |
![[ ]](/icons/layout.gif) | ERN_110470 Mynydd y ..> | 2025-03-14 00:00 | 9.8M | |
![[ ]](/icons/layout.gif) | ERN_109397_Chapel_Ba..> | 2025-03-14 00:00 | 2.5M | |
![[ ]](/icons/layout.gif) | ERN 116350 Recording..> | 2025-03-14 00:00 | 1.2M | |
![[ ]](/icons/layout.gif) | ERN 111361 Historic ..> | 2025-03-14 00:00 | 917K | |
![[ ]](/icons/layout.gif) | ERN_107509_Report No..> | 2025-03-14 00:00 | 7.2M | |
![[ ]](/icons/layout.gif) | ERN 111137 16 Colleg..> | 2025-03-14 00:00 | 5.6M | |
![[ ]](/icons/layout.gif) | ERN 110737 5 Maenor ..> | 2025-03-14 00:00 | 3.5M | |
![[ ]](/icons/layout.gif) | ERN 110480 Caves Sch..> | 2025-03-14 00:00 | 6.6M | |
![[ ]](/icons/layout.gif) | EPRN_125663_WISTON.pdf | 2025-03-14 00:00 | 4.1M | |
![[ ]](/icons/layout.gif) | EPRN_125663_TREGARON..> | 2025-03-14 00:00 | 5.0M | |
![[ ]](/icons/layout.gif) | EPRN_125663_TREFILAN..> | 2025-03-14 00:00 | 3.5M | |
![[ ]](/icons/layout.gif) | EPRN_125663_TENBY.pdf | 2025-03-14 00:00 | 4.4M | |
![[ ]](/icons/layout.gif) | EPRN_125663_TEMPLETO..> | 2025-03-14 00:00 | 5.8M | |
![[ ]](/icons/layout.gif) | EPRN_125663_ST_DAVID..> | 2025-03-14 00:00 | 5.8M | |
![[ ]](/icons/layout.gif) | EPRN_125663_PEMBROKE..> | 2025-03-14 00:00 | 6.1M | |
![[ ]](/icons/layout.gif) | EPRN_125663_ST_CLEAR..> | 2025-03-14 00:00 | 4.9M | |
![[ ]](/icons/layout.gif) | EPRN_125663_NEWCASTL..> | 2025-03-14 00:00 | 5.0M | |
![[ ]](/icons/layout.gif) | EPRN_125663_NEWPORT.pdf | 2025-03-14 00:00 | 6.5M | |
![[ ]](/icons/layout.gif) | EPRN_125663_NEW MOAT..> | 2025-03-14 00:00 | 5.7M | |
![[ ]](/icons/layout.gif) | EPRN_125663_NARBERTH..> | 2025-03-14 00:00 | 6.4M | |
![[ ]](/icons/layout.gif) | EPRN_125663_LLAWHADE..> | 2025-03-14 00:00 | 5.3M | |
![[ ]](/icons/layout.gif) | EPRN_125663_LLANGADO..> | 2025-03-14 00:00 | 3.5M | |
![[ ]](/icons/layout.gif) | EPRN_125663_LLANDOVE..> | 2025-03-14 00:00 | 4.8M | |
![[ ]](/icons/layout.gif) | EPRN_125663_LLANELLI..> | 2025-03-14 00:00 | 4.4M | |
![[ ]](/icons/layout.gif) | EPRN_125663_LLANDEIL..> | 2025-03-14 00:00 | 6.1M | |
![[ ]](/icons/layout.gif) | EPRN_125663_LAUGHARN..> | 2025-03-14 00:00 | 6.4M | |
![[ ]](/icons/layout.gif) | EPRN_125663_LAMPETER..> | 2025-03-14 00:00 | 5.7M | |
![[ ]](/icons/layout.gif) | EPRN_125663_HAVERFOR..> | 2025-03-14 00:00 | 7.5M | |
![[ ]](/icons/layout.gif) | EPRN_125663_KIDWELLY..> | 2025-03-14 00:00 | 8.2M | |
![[ ]](/icons/layout.gif) | EPRN_125663_DRYSLWYN..> | 2025-03-14 00:00 | 3.2M | |
![[ ]](/icons/layout.gif) | EPRN_125663_FISHGUAR..> | 2025-03-14 00:00 | 6.1M | |
![[ ]](/icons/layout.gif) | EPRN_125663_CILGERRA..> | 2025-03-14 00:00 | 3.9M | |
![[ ]](/icons/layout.gif) | EPRN_125663_DINEFWR_..> | 2025-03-14 00:00 | 4.6M | |
![[ ]](/icons/layout.gif) | EPRN_125663_CARDIGAN..> | 2025-03-14 00:00 | 5.4M | |
![[ ]](/icons/layout.gif) | EPRN_125663_ADPAR.pdf | 2025-03-14 00:00 | 5.8M | |
![[ ]](/icons/layout.gif) | EPRN_125663_ABERYSTW..> | 2025-03-14 00:00 | 5.5M | |
![[ ]](/icons/layout.gif) | E-32266 WelTAG Stage..> | 2025-03-14 00:00 | 1.0M | |
![[ ]](/icons/layout.gif) | EPRN_125663_ABERGWIL..> | 2025-03-14 00:00 | 3.6M | |
![[ ]](/icons/layout.gif) | Dale Airfield Histor..> | 2025-03-14 00:00 | 3.4M | |
![[ ]](/icons/layout.gif) | Dossier Shire Hall.pdf | 2025-03-14 00:00 | 3.2M | |
![[ ]](/icons/layout.gif) | Chimneys Link Herita..> | 2025-03-14 00:00 | 3.7M | |
![[ ]](/icons/layout.gif) | CARMARTHEN.pdf | 2025-03-14 00:00 | 329K | |
![[ ]](/icons/layout.gif) | Camps & Ranges S Pem..> | 2025-03-14 00:00 | 5.9M | |
![[ ]](/icons/layout.gif) | Cadw - CM271 - 2017-..> | 2025-03-14 00:00 | 185K | |
![[ ]](/icons/layout.gif) | Camps and Ranges in ..> | 2025-03-14 00:00 | 2.7M | |
![[ ]](/icons/layout.gif) | Brief Report On The ..> | 2025-03-14 00:00 | 6.9M | |
![[ ]](/icons/layout.gif) | Bishop's Park.pdf | 2025-03-14 00:00 | 3.7M | |
![[ ]](/icons/layout.gif) | Bedd Morris final re..> | 2025-03-14 00:00 | 3.1M | |
![[ ]](/icons/layout.gif) | Afon Gido 3806.pdf | 2025-03-14 00:00 | 771K | |
![[ ]](/icons/layout.gif) | Adroddiad terfynol A..> | 2025-03-14 00:00 | 1.8M | |
![[ ]](/icons/layout.gif) | add to core recs 106..> | 2025-03-14 00:00 | 159K | |
![[ ]](/icons/layout.gif) | ABC HLMP all Maps an..> | 2025-03-14 00:00 | 10M | |
![[ ]](/icons/layout.gif) | 99915 Johnston Hall ..> | 2025-03-14 00:00 | 2.0M | |
![[ ]](/icons/layout.gif) | 99814 Tyddyn Dolwerd..> | 2025-03-14 00:00 | 2.3M | |
![[ ]](/icons/layout.gif) | C20th Military Sites..> | 2025-03-14 00:00 | 26M | |
![[ ]](/icons/layout.gif) | 99813 Carnawllon Faw..> | 2025-03-14 00:00 | 4.5M | |
![[ ]](/icons/layout.gif) | 99812 Plot 13 Maes M..> | 2025-03-14 00:00 | 1.4M | |
![[ ]](/icons/layout.gif) | 99811 Inner Courtyar..> | 2025-03-14 00:00 | 4.7M | |
![[ ]](/icons/layout.gif) | 99809 Gelli Aur, Gla..> | 2025-03-14 00:00 | 2.6M | |
![[ ]](/icons/layout.gif) | 99810 Talbenny Hall ..> | 2025-03-14 00:00 | 11M | |
![[ ]](/icons/layout.gif) | 99808 The Old House ..> | 2025-03-14 00:00 | 2.1M | |
![[ ]](/icons/layout.gif) | 99808 'The Old House..> | 2025-03-14 00:00 | 2.1M | |
![[ ]](/icons/layout.gif) | 99781 Penrhos Golf ..> | 2025-03-14 00:00 | 3.7M | |
![[ ]](/icons/layout.gif) | 99782 Cromwell Road ..> | 2025-03-14 00:00 | 9.8M | |
![[ ]](/icons/layout.gif) | 99630 Beili Dyffryn ..> | 2025-03-14 00:00 | 6.7M | |
![[ ]](/icons/layout.gif) | 99626 Brynawel, Llan..> | 2025-03-14 00:00 | 3.8M | |
![[ ]](/icons/layout.gif) | 99577 Mrs Johnes' Fl..> | 2025-03-14 00:00 | 2.5M | |
![[ ]](/icons/layout.gif) | 99577 Mrs Johnes Flo..> | 2025-03-14 00:01 | 2.5M | |
![[ ]](/icons/layout.gif) | 99578 Land North of ..> | 2025-03-14 00:01 | 10M | |
![[ ]](/icons/layout.gif) | 99390 Llys Brychan ..> | 2025-03-14 00:01 | 3.9M | |
![[ ]](/icons/layout.gif) | 99522 Former Griffit..> | 2025-03-14 00:01 | 5.9M | |
![[ ]](/icons/layout.gif) | 99277 The Kell A40 R..> | 2025-03-14 00:01 | 2.5M | |
![[ ]](/icons/layout.gif) | 99149 Crugiau Cemmae..> | 2025-03-14 00:01 | 5.9M | |
![[ ]](/icons/layout.gif) | 99086 Excavations at..> | 2025-03-14 00:01 | 6.1M | |
![[ ]](/icons/layout.gif) | 98875 Gaer Geophysic..> | 2025-03-14 00:01 | 3.4M | |
![[ ]](/icons/layout.gif) | 99087 Arfordir Coast..> | 2025-03-14 00:01 | 15M | |
![[ ]](/icons/layout.gif) | 98692 Dwr Cymru CSO ..> | 2025-03-14 00:01 | 3.2M | |
![[ ]](/icons/layout.gif) | 98691 Myddfai Dwr Cy..> | 2025-03-14 00:01 | 2.8M | |
![[ ]](/icons/layout.gif) | 98690 Meadow View, L..> | 2025-03-14 00:01 | 3.1M | |
![[ ]](/icons/layout.gif) | 98688 Scheduling Enh..> | 2025-03-14 00:01 | 3.6M | |
![[ ]](/icons/layout.gif) | 98687 Haverfordwest ..> | 2025-03-14 00:01 | 1.5M | |
![[ ]](/icons/layout.gif) | 98689 North Beach Ab..> | 2025-03-14 00:01 | 10M | |
![[ ]](/icons/layout.gif) | 98686 Village Green,..> | 2025-03-14 00:01 | 2.1M | |
![[ ]](/icons/layout.gif) | 98685 Trychrug Cemet..> | 2025-03-14 00:01 | 3.4M | |
![[ ]](/icons/layout.gif) | 98684 Fan Round Barr..> | 2025-03-14 00:01 | 4.1M | |
![[ ]](/icons/layout.gif) | 98683 Explorations T..> | 2025-03-14 00:01 | 6.4M | |
![[ ]](/icons/layout.gif) | 98681 Haverfordwest,..> | 2025-03-14 00:01 | 709K | |
![[ ]](/icons/layout.gif) | 98682 Wernfawr Evalu..> | 2025-03-14 00:01 | 4.7M | |
![[ ]](/icons/layout.gif) | 98579 Excavations on..> | 2025-03-14 00:01 | 8.9M | |
![[ ]](/icons/layout.gif) | 98576 South Haven Pi..> | 2025-03-14 00:01 | 11M | |
![[ ]](/icons/layout.gif) | 98573 St. Inas Churc..> | 2025-03-14 00:01 | 2.1M | |
![[ ]](/icons/layout.gif) | 98574 South Quay DT ..> | 2025-03-14 00:01 | 12M | |
![[ ]](/icons/layout.gif) | 98573 St. Ina's Chur..> | 2025-03-14 00:01 | 2.1M | |
![[ ]](/icons/layout.gif) | 98548 Cwm Fforest 38..> | 2025-03-14 00:01 | 391K | |
![[ ]](/icons/layout.gif) | 98572 Golden Hill La..> | 2025-03-14 00:01 | 4.5M | |
![[ ]](/icons/layout.gif) | 98517 Ynys Tomenlle ..> | 2025-03-14 00:01 | 1.5M | |
![[ ]](/icons/layout.gif) | 98516 St Davids Chur..> | 2025-03-14 00:01 | 13M | |
![[ ]](/icons/layout.gif) | 98516 St David's Chu..> | 2025-03-14 00:01 | 13M | |
![[ ]](/icons/layout.gif) | 98515 Llansadurnen P..> | 2025-03-14 00:01 | 832K | |
![[ ]](/icons/layout.gif) | 98515 Llansadurnen c..> | 2025-03-14 00:01 | 1.2M | |
![[ ]](/icons/layout.gif) | 98414 YNYS HIR RSPB ..> | 2025-03-14 00:01 | 4.5M | |
![[ ]](/icons/layout.gif) | 98413 Pant y Butler ..> | 2025-03-14 00:01 | 3.5M | |
![[ ]](/icons/layout.gif) | 98412 Carmarthenshir..> | 2025-03-14 00:01 | 2.0M | |
![[ ]](/icons/layout.gif) | 98415 Cromwell Road,..> | 2025-03-14 00:01 | 5.8M | |
![[ ]](/icons/layout.gif) | 97675 Chevron Oil Re..> | 2025-03-14 00:01 | 3.0M | |
![[ ]](/icons/layout.gif) | 97675 15 Castle Str..> | 2025-03-14 00:01 | 4.4M | |
![[ ]](/icons/layout.gif) | 97373 Plot 1, The Ol..> | 2025-03-14 00:01 | 2.8M | |
![[ ]](/icons/layout.gif) | 97259 Chevron Oil Re..> | 2025-03-14 00:01 | 3.2M | |
![[ ]](/icons/layout.gif) | 97121 Meini Gwyn.pdf | 2025-03-14 00:01 | 3.7M | |
![[ ]](/icons/layout.gif) | 96851 Scheduling Enh..> | 2025-03-14 00:01 | 17M | |
![[ ]](/icons/layout.gif) | 98176 Pet Food Facto..> | 2025-03-14 00:01 | 24M | |
![[ ]](/icons/layout.gif) | 96849 Upper Park St ..> | 2025-03-14 00:01 | 4.3M | |
![[ ]](/icons/layout.gif) | 96851 Scheduling Enh..> | 2025-03-14 00:01 | 17M | |
![[ ]](/icons/layout.gif) | 96807 Land at Llwynh..> | 2025-03-14 00:01 | 18M | |
![[ ]](/icons/layout.gif) | 96705 Crugmore Farm ..> | 2025-03-14 00:01 | 1.4M | |
![[ ]](/icons/layout.gif) | 95176 Ty Picca Apple..> | 2025-03-14 00:01 | 2.2M | |
![[ ]](/icons/layout.gif) | 95175 Aberystwyth Wo..> | 2025-03-14 00:01 | 5.6M | |
![[ ]](/icons/layout.gif) | 95174 Roch Castle, D..> | 2025-03-14 00:01 | 11M | |
![[ ]](/icons/layout.gif) | 95172 Ceredigion Lan..> | 2025-03-14 00:01 | 1.1M | |
![[ ]](/icons/layout.gif) | 96704 Cadw Wetlands ..> | 2025-03-14 00:01 | 18M | |
![[ ]](/icons/layout.gif) | 94950 Old Rectory, M..> | 2025-03-14 00:01 | 5.7M | |
![[ ]](/icons/layout.gif) | 94948 Beilicelyn Sta..> | 2025-03-14 00:01 | 6.1M | |
![[ ]](/icons/layout.gif) | 94895 Scheduling Enh..> | 2025-03-14 00:01 | 1.2M | |
![[ ]](/icons/layout.gif) | 94896 St Brides Have..> | 2025-03-14 00:01 | 6.9M | |
![[ ]](/icons/layout.gif) | 94874 Garn Fawr surv..> | 2025-03-14 00:01 | 3.3M | |
![[ ]](/icons/layout.gif) | 94873 Dwr Cymru Llan..> | 2025-03-14 00:01 | 2.3M | |
![[ ]](/icons/layout.gif) | 94872 Dwr Cymru Llan..> | 2025-03-14 00:01 | 2.7M | |
![[ ]](/icons/layout.gif) | 94894 Brynberian Wat..> | 2025-03-14 00:01 | 17M | |
![[ ]](/icons/layout.gif) | 94869 Pen yr Ardd Wi..> | 2025-03-14 00:01 | 608K | |
![[ ]](/icons/layout.gif) | 94870 & 94871 Foley ..> | 2025-03-14 00:01 | 15M | |
![[ ]](/icons/layout.gif) | 94867 Church House, ..> | 2025-03-14 00:01 | 683K | |
![[ ]](/icons/layout.gif) | 94868 Llansadwrn, La..> | 2025-03-14 00:01 | 20M | |
![[ ]](/icons/layout.gif) | 94858 Land South of ..> | 2025-03-14 00:01 | 1.9M | |
![[ ]](/icons/layout.gif) | 94857 The Paddocks, ..> | 2025-03-14 00:01 | 797K | |
![[ ]](/icons/layout.gif) | 94856 Shalimar, Fres..> | 2025-03-14 00:01 | 916K | |
![[ ]](/icons/layout.gif) | 94866 Crugiau Cemmai..> | 2025-03-14 00:01 | 29M | |
![[ ]](/icons/layout.gif) | 94855_AC173_Shiner_W..> | 2025-03-14 00:01 | 15M | |
![[ ]](/icons/layout.gif) | 94855 Excavations at..> | 2025-03-14 00:01 | 4.9M | |
![[ ]](/icons/layout.gif) | 94854 DWR CYMRU Troe..> | 2025-03-14 00:01 | 5.1M | |
![[ ]](/icons/layout.gif) | 94853 Jubilee Hotel.pdf | 2025-03-14 00:01 | 2.8M | |
![[ ]](/icons/layout.gif) | 94749 Pricaston Geop..> | 2025-03-14 00:01 | 11M | |
![[ ]](/icons/layout.gif) | 94751 Remote Sensing..> | 2025-03-14 00:01 | 16M | |
![[ ]](/icons/layout.gif) | 94643 Brynheulog Lla..> | 2025-03-14 00:01 | 7.4M | |
![[ ]](/icons/layout.gif) | 94541 Jameston ASIDO..> | 2025-03-14 00:01 | 6.1M | |
![[ ]](/icons/layout.gif) | 94538 Dwr Cymru, Tro..> | 2025-03-14 00:01 | 7.3M | |
![[ ]](/icons/layout.gif) | 94747 Moel Y Llyn.pdf | 2025-03-14 00:01 | 28M | |
![[ ]](/icons/layout.gif) | 94535 North Heronry ..> | 2025-03-14 00:01 | 5.6M | |
![[ ]](/icons/layout.gif) | 94533 Excavation and..> | 2025-03-14 00:01 | 6.9M | |
![[ ]](/icons/layout.gif) | 94531 Cadw Wetlands-..> | 2025-03-14 00:01 | 14M | |
![[ ]](/icons/layout.gif) | 94530 Llanrhian Chur..> | 2025-03-14 00:01 | 5.1M | |
![[ ]](/icons/layout.gif) | 94527 Philbeach Farm..> | 2025-03-14 00:01 | 5.6M | |
![[ ]](/icons/layout.gif) | 94526 Land at Pontar..> | 2025-03-14 00:01 | 6.1M | |
![[ ]](/icons/layout.gif) | 94525 Penrhiw, Plot ..> | 2025-03-14 00:01 | 3.0M | |
![[ ]](/icons/layout.gif) | 94524 Berry Cottage,..> | 2025-03-14 00:01 | 855K | |
![[ ]](/icons/layout.gif) | 94524 Berry Cottage ..> | 2025-03-14 00:01 | 2.4M | |
![[ ]](/icons/layout.gif) | 94524 Berry Cottage ..> | 2025-03-14 00:01 | 411K | |
![[ ]](/icons/layout.gif) | 94536 Pant Y Butler.pdf | 2025-03-14 00:01 | 82M | |
![[ ]](/icons/layout.gif) | 94421, 94422, 94423 ..> | 2025-03-14 00:01 | 6.0M | |
![[ ]](/icons/layout.gif) | 94421,94422, 94423 O..> | 2025-03-14 00:02 | 45M | |
![[ ]](/icons/layout.gif) | 94420 Brynglas Geoph..> | 2025-03-14 00:02 | 2.1M | |
![[ ]](/icons/layout.gif) | 94418 Dinefwr Home F..> | 2025-03-14 00:02 | 8.6M | |
![[ ]](/icons/layout.gif) | 94421 Old Mill, Hore..> | 2025-03-14 00:02 | 45M | |
![[ ]](/icons/layout.gif) | 94417 Pump House, No..> | 2025-03-14 00:02 | 11M | |
![[ ]](/icons/layout.gif) | 94315 Danclawdd, Mae..> | 2025-03-14 00:02 | 1.7M | |
![[ ]](/icons/layout.gif) | 94316 Pembroke Castl..> | 2025-03-14 00:02 | 5.1M | |
![[ ]](/icons/layout.gif) | 94313 Ti Cara Watchi..> | 2025-03-14 00:02 | 1.0M | |
![[ ]](/icons/layout.gif) | 94104 Fron Villa Cry..> | 2025-03-14 00:02 | 3.4M | |
![[ ]](/icons/layout.gif) | 94103 Quay Hill, Ten..> | 2025-03-14 00:02 | 2.3M | |
![[ ]](/icons/layout.gif) | 94314 Pricaston Farm..> | 2025-03-14 00:02 | 63M | |
![[ ]](/icons/layout.gif) | 94000 Maesllan, Peny..> | 2025-03-14 00:02 | 12M | |
![[ ]](/icons/layout.gif) | 93999 Lyric Theatre ..> | 2025-03-14 00:02 | 16M | |
![[ ]](/icons/layout.gif) | 94101 Parc Cynog Win..> | 2025-03-14 00:02 | 99M | |
![[ ]](/icons/layout.gif) | 93846 The White Lion..> | 2025-03-14 00:02 | 11M | |
![[ ]](/icons/layout.gif) | 93845 Dwr Cymru, Twy..> | 2025-03-14 00:02 | 13M | |
![[ ]](/icons/layout.gif) | 93843 The Tythe Barn..> | 2025-03-14 00:02 | 4.2M | |
![[ ]](/icons/layout.gif) | 93842 Danygraig Meid..> | 2025-03-14 00:02 | 1.7M | |
![[ ]](/icons/layout.gif) | 93844 Danybanc.pdf | 2025-03-14 00:02 | 22M | |
![[ ]](/icons/layout.gif) | 91609 East Blockhous..> | 2025-03-14 00:02 | 7.5M | |
![[ ]](/icons/layout.gif) | 65080 Carmarthen Amp..> | 2025-03-14 00:02 | 225K | |
![[ ]](/icons/layout.gif) | 65073 Chanter's Orch..> | 2025-03-14 00:02 | 2.1M | |
![[ ]](/icons/layout.gif) | 65072 Land adj. Land..> | 2025-03-14 00:02 | 3.7M | |
![[ ]](/icons/layout.gif) | 65071 Llety Ceiro Ev..> | 2025-03-14 00:02 | 4.3M | |
![[ ]](/icons/layout.gif) | 65069 Land at Llaneg..> | 2025-03-14 00:02 | 1.8M | |
![[ ]](/icons/layout.gif) | 65068 Cae Glas Watch..> | 2025-03-14 00:02 | 12M | |
![[ ]](/icons/layout.gif) | 65073 Chanters Orcha..> | 2025-03-14 00:02 | 26M | |
![[ ]](/icons/layout.gif) | 65012 TG Bwlchyrhiw.pdf | 2025-03-14 00:02 | 13M | |
![[ ]](/icons/layout.gif) | 65012 Bwlchyrhiw HE2..> | 2025-03-14 00:02 | 4.1M | |
![[ ]](/icons/layout.gif) | 65005 Treddiog-fawr ..> | 2025-03-14 00:02 | 2.2M | |
![[ ]](/icons/layout.gif) | 64995 Highmead Farm ..> | 2025-03-14 00:02 | 17M | |
![[ ]](/icons/layout.gif) | 64994 TG Brawdy Farm..> | 2025-03-14 00:02 | 16M | |
![[ ]](/icons/layout.gif) | 64984 TG Cefn Farm, ..> | 2025-03-14 00:02 | 2.1M | |
![[ ]](/icons/layout.gif) | 64982 Llandre HE2 74..> | 2025-03-14 00:02 | 2.9M | |
![[ ]](/icons/layout.gif) | 64767 Dinas Llansawe..> | 2025-03-14 00:02 | 1.2M | |
![[ ]](/icons/layout.gif) | 64766 Dyfed Powys Po..> | 2025-03-14 00:02 | 6.0M | |
![[ ]](/icons/layout.gif) | 64986 TG Trefach Cal..> | 2025-03-14 00:02 | 16M | |
![[ ]](/icons/layout.gif) | 64764 New Moat AE 20..> | 2025-03-14 00:02 | 5.4M | |
![[ ]](/icons/layout.gif) | 64762 Brynberian wat..> | 2025-03-14 00:02 | 4.2M | |
![[ ]](/icons/layout.gif) | 64748 Longlane House..> | 2025-03-14 00:02 | 691K | |
![[ ]](/icons/layout.gif) | 64747 1A Rock Terrac..> | 2025-03-14 00:02 | 642K | |
![[ ]](/icons/layout.gif) | 64746 Abereiddi Slat..> | 2025-03-14 00:02 | 7.5M | |
![[ ]](/icons/layout.gif) | 64744 Maesgwynne Far..> | 2025-03-14 00:02 | 6.4M | |
![[ ]](/icons/layout.gif) | 64643 26 High St, Ll..> | 2025-03-14 00:02 | 2.2M | |
![[ ]](/icons/layout.gif) | 64379 Hayguard Lane ..> | 2025-03-14 00:02 | 4.5M | |
![[ ]](/icons/layout.gif) | 64378 Ty Yfory WB.pdf | 2025-03-14 00:02 | 3.9M | |
![[ ]](/icons/layout.gif) | 64382 Capel Bangor A..> | 2025-03-14 00:02 | 27M | |
![[ ]](/icons/layout.gif) | 64249 Land at Ponthe..> | 2025-03-14 00:02 | 6.1M | |
![[ ]](/icons/layout.gif) | 64249 Land at Ponthe..> | 2025-03-14 00:02 | 14M | |
![[ ]](/icons/layout.gif) | 64248 St Clears Floo..> | 2025-03-14 00:02 | 1.8M | |
![[ ]](/icons/layout.gif) | 64145 Roman Fort nea..> | 2025-03-14 00:02 | 1.6M | |
![[ ]](/icons/layout.gif) | 64007 Parc Yr Abbot ..> | 2025-03-14 00:02 | 4.1M | |
![[ ]](/icons/layout.gif) | 63968 Defended Enclo..> | 2025-03-14 00:02 | 4.2M | |
![[ ]](/icons/layout.gif) | 63967 Roman Non Mili..> | 2025-03-14 00:02 | 2.2M | |
![[ ]](/icons/layout.gif) | 63966 Scheduling Enh..> | 2025-03-14 00:02 | 4.0M | |
![[ ]](/icons/layout.gif) | 63966 Scheduling Enh..> | 2025-03-14 00:02 | 1.2M | |
![[ ]](/icons/layout.gif) | 63955 Waun Ddu Roman..> | 2025-03-14 00:02 | 8.5M | |
![[ ]](/icons/layout.gif) | 63954 Tir Llandre Fa..> | 2025-03-14 00:02 | 1.3M | |
![[ ]](/icons/layout.gif) | 63953 Plot adj. Arfr..> | 2025-03-14 00:02 | 895K | |
![[ ]](/icons/layout.gif) | 63952 Palace View, L..> | 2025-03-14 00:02 | 1.0M | |
![[ ]](/icons/layout.gif) | 63951 Land adj Golwg..> | 2025-03-14 00:02 | 5.9M | |
![[ ]](/icons/layout.gif) | 63951 Land adj Coleg..> | 2025-03-14 00:02 | 5.9M | |
![[ ]](/icons/layout.gif) | 63942 Pembrokeshire ..> | 2025-03-14 00:02 | 525K | |
![[ ]](/icons/layout.gif) | 63942 Carmarthenshir..> | 2025-03-14 00:02 | 1.5M | |
![[ ]](/icons/layout.gif) | 63887 Monksford Stre..> | 2025-03-14 00:02 | 1.6M | |
![[ ]](/icons/layout.gif) | 63886 Cefn Gwernffrw..> | 2025-03-14 00:02 | 1.4M | |
![[ ]](/icons/layout.gif) | 64250 Milford Haven ..> | 2025-03-14 00:02 | 95M | |
![[ ]](/icons/layout.gif) | 63785 Castell Goetre..> | 2025-03-14 00:02 | 2.6M | |
![[ ]](/icons/layout.gif) | 63777 Carmel Grassla..> | 2025-03-14 00:02 | 1.9M | |
![[ ]](/icons/layout.gif) | 63784 Blaenblodau Ha..> | 2025-03-14 00:02 | 5.6M | |
![[ ]](/icons/layout.gif) | 63716 Pistyll Wood 1..> | 2025-03-14 00:02 | 798K | |
![[ ]](/icons/layout.gif) | 63673 Stangs Farm HE..> | 2025-03-14 00:02 | 2.2M | |
![[ ]](/icons/layout.gif) | 63668 Swn-y-don Tir ..> | 2025-03-14 00:02 | 955K | |
![[ ]](/icons/layout.gif) | 63668 Swn-y-don Tir ..> | 2025-03-14 00:02 | 961K | |
![[ ]](/icons/layout.gif) | 63723 Manorafon Farm..> | 2025-03-14 00:02 | 12M | |
![[ ]](/icons/layout.gif) | 63666 TG Cwmcowddu 6..> | 2025-03-14 00:02 | 4.0M | |
![[ ]](/icons/layout.gif) | 63663 TG Maesrhiw HE..> | 2025-03-14 00:02 | 3.0M | |
![[ ]](/icons/layout.gif) | 63665 Nantarast HE2 ..> | 2025-03-14 00:02 | 5.2M | |
![[ ]](/icons/layout.gif) | 63661 TG Hook Quay H..> | 2025-03-14 00:02 | 2.2M | |
![[ ]](/icons/layout.gif) | 63658 TG Keeston Hil..> | 2025-03-14 00:02 | 2.5M | |
![[ ]](/icons/layout.gif) | 63614 TG Alltgoch HE..> | 2025-03-14 00:02 | 4.8M | |
![[ ]](/icons/layout.gif) | 63614 TG Alltgoch 63..> | 2025-03-14 00:02 | 4.8M | |
![[ ]](/icons/layout.gif) | 63610 Bodcoll Tir Go..> | 2025-03-14 00:02 | 7.2M | |
![[ ]](/icons/layout.gif) | 63622 TG Tre-fais-uc..> | 2025-03-14 00:02 | 27M | |
![[ ]](/icons/layout.gif) | 63603 TG Penpedwast ..> | 2025-03-14 00:02 | 14M | |
![[ ]](/icons/layout.gif) | 63514 St. Davids Cat..> | 2025-03-14 00:02 | 1.1M | |
![[ ]](/icons/layout.gif) | 63514 St. David's Ca..> | 2025-03-14 00:02 | 1.1M | |
![[ ]](/icons/layout.gif) | 63513 9 & 10 High St..> | 2025-03-14 00:02 | 785K | |
![[ ]](/icons/layout.gif) | 63512 St Clears WB.pdf | 2025-03-14 00:02 | 4.2M | |
![[ ]](/icons/layout.gif) | 63511 The Post Offic..> | 2025-03-14 00:02 | 4.9M | |
![[ ]](/icons/layout.gif) | 63407 Cropmark Enclo..> | 2025-03-14 00:02 | 4.1M | |
![[ ]](/icons/layout.gif) | 63405 Robinson Retai..> | 2025-03-14 00:02 | 8.6M | |
![[ ]](/icons/layout.gif) | 63303 28 Lammas Stre..> | 2025-03-14 00:02 | 1.6M | |
![[ ]](/icons/layout.gif) | 63304 Tenby Castle A..> | 2025-03-14 00:02 | 6.7M | |
![[ ]](/icons/layout.gif) | 63302 Hafod Mariamne..> | 2025-03-14 00:02 | 2.6M | |
![[ ]](/icons/layout.gif) | 63302 Hafod Mariamne..> | 2025-03-14 00:02 | 2.6M | |
![[ ]](/icons/layout.gif) | 63300 Pencerrig, Mat..> | 2025-03-14 00:02 | 1.2M | |
![[ ]](/icons/layout.gif) | 63299 Pilot Street a..> | 2025-03-14 00:02 | 2.2M | |
![[ ]](/icons/layout.gif) | 63301 Berry Hill Exc..> | 2025-03-14 00:02 | 14M | |
![[ ]](/icons/layout.gif) | 63297 Haverfordwest ..> | 2025-03-14 00:02 | 9.1M | |
![[ ]](/icons/layout.gif) | 63283 St Michaels, L..> | 2025-03-14 00:02 | 398K | |
![[ ]](/icons/layout.gif) | 63195 Longstone Farm..> | 2025-03-14 00:03 | 1.5M | |
![[ ]](/icons/layout.gif) | 63194 Maenclochog Co..> | 2025-03-14 00:03 | 1.5M | |
![[ ]](/icons/layout.gif) | 63260 Ynys Hir (WHE2..> | 2025-03-14 00:03 | 5.2M | |
![[ ]](/icons/layout.gif) | 63194 Maenclochog Co..> | 2025-03-14 00:03 | 1.1M | |
![[ ]](/icons/layout.gif) | 63193 Mountain Road ..> | 2025-03-14 00:03 | 2.5M | |
![[ ]](/icons/layout.gif) | 63192 Machynys West ..> | 2025-03-14 00:03 | 1.7M | |
![[ ]](/icons/layout.gif) | 63194 Maenclochog Co..> | 2025-03-14 00:03 | 6.1M | |
![[ ]](/icons/layout.gif) | 63187 Meadows Nursin..> | 2025-03-14 00:03 | 1.0M | |
![[ ]](/icons/layout.gif) | 63189_Cold_Bath_Hous..> | 2025-03-14 00:03 | 2.7M | |
![[ ]](/icons/layout.gif) | 63185 Harbour Wall, ..> | 2025-03-14 00:03 | 2.2M | |
![[ ]](/icons/layout.gif) | 63180 Newhouse Farm.pdf | 2025-03-14 00:03 | 3.7M | |
![[ ]](/icons/layout.gif) | 63077 North Dock Lla..> | 2025-03-14 00:03 | 4.3M | |
![[ ]](/icons/layout.gif) | 63076 The Old Worksh..> | 2025-03-14 00:03 | 1.6M | |
![[ ]](/icons/layout.gif) | 63023 St Dogmaels Ci..> | 2025-03-14 00:03 | 1.7M | |
![[ ]](/icons/layout.gif) | 63021 Aberaron Tidal..> | 2025-03-14 00:03 | 840K | |
![[ ]](/icons/layout.gif) | 63022 Machynys East ..> | 2025-03-14 00:03 | 5.3M | |
![[ ]](/icons/layout.gif) | 62990 Marros Mountai..> | 2025-03-14 00:03 | 489K | |
![[ ]](/icons/layout.gif) | 63020 Priory Motor M..> | 2025-03-14 00:03 | 4.3M | |
![[ ]](/icons/layout.gif) | 62956.pdf | 2025-03-14 00:03 | 216K | |
![[ ]](/icons/layout.gif) | 62936 Roman Fort Env..> | 2025-03-14 00:03 | 563K | |
![[ ]](/icons/layout.gif) | 62936 Geophysical Su..> | 2025-03-14 00:03 | 553K | |
![[ ]](/icons/layout.gif) | 62917 Bedd Morris st..> | 2025-03-14 00:03 | 8.2M | |
![[ ]](/icons/layout.gif) | 62915 Fairview Robes..> | 2025-03-14 00:03 | 3.7M | |
![[ ]](/icons/layout.gif) | 62916 Dane Hill Eval..> | 2025-03-14 00:03 | 13M | |
![[ ]](/icons/layout.gif) | 62914 Frondeg Terrac..> | 2025-03-14 00:03 | 14M | |
![[ ]](/icons/layout.gif) | 62911 Land at Whitla..> | 2025-03-14 00:03 | 2.2M | |
![[ ]](/icons/layout.gif) | 62910 Talbot Yard Tr..> | 2025-03-14 00:03 | 623K | |
![[ ]](/icons/layout.gif) | 62809 Glandy Cross F..> | 2025-03-14 00:03 | 712K | |
![[ ]](/icons/layout.gif) | 62774 The Dairy, But..> | 2025-03-14 00:03 | 5.9M | |
![[ ]](/icons/layout.gif) | 62773 The Old Granar..> | 2025-03-14 00:03 | 6.6M | |
![[ ]](/icons/layout.gif) | 62770 Cefncaeau, Lla..> | 2025-03-14 00:03 | 2.0M | |
![[ ]](/icons/layout.gif) | 62768 St James Churc..> | 2025-03-14 00:03 | 4.2M | |
![[ ]](/icons/layout.gif) | 62912 Dale Point Pro..> | 2025-03-14 00:03 | 24M | |
![[ ]](/icons/layout.gif) | 62767 CARMARTHENSHIR..> | 2025-03-14 00:03 | 28M | |
![[ ]](/icons/layout.gif) | 62767 CARMARTHENSHIR..> | 2025-03-14 00:03 | 30M | |
![[ ]](/icons/layout.gif) | 62767 CARMARTHENSHIR..> | 2025-03-14 00:03 | 20M | |
![[ ]](/icons/layout.gif) | 62767 CARMARTHENSHIR..> | 2025-03-14 00:03 | 51M | |
![[ ]](/icons/layout.gif) | 62767 CARMARTHENSHIR..> | 2025-03-14 00:03 | 27M | |
![[ ]](/icons/layout.gif) | 62767 CARMARTHENSHIR..> | 2025-03-14 00:03 | 27M | |
![[ ]](/icons/layout.gif) | 62767 CARMARTHENSHIR..> | 2025-03-14 00:03 | 30M | |
![[ ]](/icons/layout.gif) | 62767 CARMARTHENSHIR..> | 2025-03-14 00:03 | 29M | |
![[ ]](/icons/layout.gif) | 62767 CARMARTHENSHIR..> | 2025-03-14 00:03 | 1.8M | |
![[ ]](/icons/layout.gif) | 62767 CARMARTHENSHIR..> | 2025-03-14 00:03 | 1.8M | |
![[ ]](/icons/layout.gif) | 62764 The English ba..> | 2025-03-14 00:03 | 1.7M | |
![[ ]](/icons/layout.gif) | 62763 Frondeg Terrac..> | 2025-03-14 00:03 | 7.0M | |
![[ ]](/icons/layout.gif) | 62762 Quarry Cottage..> | 2025-03-14 00:03 | 3.6M | |
![[ ]](/icons/layout.gif) | 62767 CARMARTHENSHIR..> | 2025-03-14 00:03 | 35M | |
![[ ]](/icons/layout.gif) | 62761 Cardigan & Tre..> | 2025-03-14 00:03 | 34M | |
![[ ]](/icons/layout.gif) | 62761 Cardigan & Tre..> | 2025-03-14 00:03 | 2.7M | |
![[ ]](/icons/layout.gif) | 62761 Cardigan & Tre..> | 2025-03-14 00:03 | 38M | |
![[ ]](/icons/layout.gif) | 62760 Stones at Aber..> | 2025-03-14 00:03 | 4.7M | |
![[ ]](/icons/layout.gif) | 62758 Tywi Valley Fa..> | 2025-03-14 00:03 | 4.6M | |
![[ ]](/icons/layout.gif) | 62757 Milford Haven ..> | 2025-03-14 00:03 | 16M | |
![[ ]](/icons/layout.gif) | 62657 St Aidans Chur..> | 2025-03-14 00:03 | 166K | |
![[ ]](/icons/layout.gif) | 62657 St Aidan's Chu..> | 2025-03-14 00:03 | 166K | |
![[ ]](/icons/layout.gif) | 62656 Talley Road, L..> | 2025-03-14 00:03 | 5.0M | |
![[ ]](/icons/layout.gif) | 62759 East Wing Inne..> | 2025-03-14 00:03 | 25M | |
![[ ]](/icons/layout.gif) | 62604 Ty Rhyg Coed P..> | 2025-03-14 00:03 | 4.7M | |
![[ ]](/icons/layout.gif) | 62554 National Botan..> | 2025-03-14 00:03 | 2.6M | |
![[ ]](/icons/layout.gif) | 62655 Dinefwr East D..> | 2025-03-14 00:03 | 11M | |
![[ ]](/icons/layout.gif) | 62553 Llanegwad Exca..> | 2025-03-14 00:03 | 4.2M | |
![[ ]](/icons/layout.gif) | 62552 Tenby Gatehous..> | 2025-03-14 00:03 | 4.7M | |
![[ ]](/icons/layout.gif) | 62550 Morfa Berwig.pdf | 2025-03-14 00:03 | 1.8M | |
![[ ]](/icons/layout.gif) | 62549 Nicklaus Avenu..> | 2025-03-14 00:03 | 647K | |
![[ ]](/icons/layout.gif) | 62551 Awelon.pdf | 2025-03-14 00:03 | 6.1M | |
![[ ]](/icons/layout.gif) | 62548 Nantgaredig Ev..> | 2025-03-14 00:03 | 5.1M | |
![[ ]](/icons/layout.gif) | 62496 and 62497 St T..> | 2025-03-14 00:03 | 10M | |
![[ ]](/icons/layout.gif) | 62493 Land adj. Bro ..> | 2025-03-14 00:03 | 6.4M | |
![[ ]](/icons/layout.gif) | 62362 Angel Vaults W..> | 2025-03-14 00:03 | 5.9M | |
![[ ]](/icons/layout.gif) | 62361 Southwood Esta..> | 2025-03-14 00:03 | 4.8M | |
![[ ]](/icons/layout.gif) | 62350 Porthgain 2006..> | 2025-03-14 00:03 | 8.3M | |
![[ ]](/icons/layout.gif) | 62349 Prince Charles..> | 2025-03-14 00:03 | 12M | |
![[ ]](/icons/layout.gif) | 62237 Merrimans Gate..> | 2025-03-14 00:03 | 1.5M | |
![[ ]](/icons/layout.gif) | 62265 Pembroke Power..> | 2025-03-14 00:03 | 8.2M | |
![[ ]](/icons/layout.gif) | 62237 Merriman's Gat..> | 2025-03-14 00:03 | 1.5M | |
![[ ]](/icons/layout.gif) | 62214 BlaenLlwydiart..> | 2025-03-14 00:03 | 958K | |
![[ ]](/icons/layout.gif) | 62216 Coed Parc Tali..> | 2025-03-14 00:03 | 7.4M | |
![[ ]](/icons/layout.gif) | 62178 Beca Bakery Pl..> | 2025-03-14 00:03 | 2.3M | |
![[ ]](/icons/layout.gif) | 62211 Brynheulog Eva..> | 2025-03-14 00:03 | 2.7M | |
![[ ]](/icons/layout.gif) | 62159 Plot 2, Woodst..> | 2025-03-14 00:03 | 629K | |
![[ ]](/icons/layout.gif) | 62158_St_Patricks_Ch..> | 2025-03-14 00:03 | 4.3M | |
![[ ]](/icons/layout.gif) | 62160 Porth Y Rhaw M..> | 2025-03-14 00:03 | 7.7M | |
![[ ]](/icons/layout.gif) | 62155 Huntsmans Inn ..> | 2025-03-14 00:03 | 5.8M | |
![[ ]](/icons/layout.gif) | 62157 Land at Bryn H..> | 2025-03-14 00:03 | 7.2M | |
![[ ]](/icons/layout.gif) | 62154 Castleback Wat..> | 2025-03-14 00:03 | 2.0M | |
![[ ]](/icons/layout.gif) | 62121 Marros South (..> | 2025-03-14 00:03 | 699K | |
![[ ]](/icons/layout.gif) | 62155 Huntsman's Inn..> | 2025-03-14 00:03 | 5.8M | |
![[ ]](/icons/layout.gif) | 62119 Allt Hengerain..> | 2025-03-14 00:03 | 594K | |
![[ ]](/icons/layout.gif) | 62102 Henllan Estate..> | 2025-03-14 00:03 | 2.3M | |
![[ ]](/icons/layout.gif) | 62052 Sunnyside Farm..> | 2025-03-14 00:03 | 497K | |
![[ ]](/icons/layout.gif) | 62001 Brynglas Watch..> | 2025-03-14 00:03 | 481K | |
![[ ]](/icons/layout.gif) | 62000 Church Close, ..> | 2025-03-14 00:03 | 3.2M | |
![[ ]](/icons/layout.gif) | 62053 Crop Marked en..> | 2025-03-14 00:03 | 7.4M | |
![[ ]](/icons/layout.gif) | 62000 Church Close B..> | 2025-03-14 00:03 | 3.2M | |
![[ ]](/icons/layout.gif) | 61996 Buckley Brewer..> | 2025-03-14 00:03 | 150K | |
![[ ]](/icons/layout.gif) | 61994 Crop-marked en..> | 2025-03-14 00:03 | 241K | |
![[ ]](/icons/layout.gif) | 61993 12 The Parade,..> | 2025-03-14 00:03 | 1.5M | |
![[ ]](/icons/layout.gif) | 61990 Woodstock, Plo..> | 2025-03-14 00:04 | 3.0M | |
![[ ]](/icons/layout.gif) | 61998 A487 Castell C..> | 2025-03-14 00:04 | 15M | |
![[ ]](/icons/layout.gif) | 61989 Glasfryn Eval..> | 2025-03-14 00:04 | 4.0M | |
![[ ]](/icons/layout.gif) | 61988 Pemberton Llan..> | 2025-03-14 00:04 | 3.3M | |
![[ ]](/icons/layout.gif) | 57058 Lamphey Old Go..> | 2025-03-14 00:04 | 323K | |
![[ ]](/icons/layout.gif) | 57057 Llanfair-ar-Y-..> | 2025-03-14 00:04 | 5.0M | |
![[ ]](/icons/layout.gif) | 57055 Tir Cymen Inte..> | 2025-03-14 00:04 | 1.7M | |
![[ ]](/icons/layout.gif) | 57056 Carmarthen Foo..> | 2025-03-14 00:04 | 7.2M | |
![[ ]](/icons/layout.gif) | 57055 Tir Cymen - Th..> | 2025-03-14 00:04 | 1.6M | |
![[ ]](/icons/layout.gif) | 57053 Archaeology in..> | 2025-03-14 00:04 | 1.1M | |
![[ ]](/icons/layout.gif) | 57054 Upland Archaeo..> | 2025-03-14 00:04 | 3.6M | |
![[ ]](/icons/layout.gif) | 57052 Fighting and F..> | 2025-03-14 00:04 | 2.2M | |
![[ ]](/icons/layout.gif) | 57052 Excavations at..> | 2025-03-14 00:04 | 932K | |
![[ ]](/icons/layout.gif) | 57048 The South Pemb..> | 2025-03-14 00:04 | 1.1M | |
![[ ]](/icons/layout.gif) | 57048 South Pembs Ch..> | 2025-03-14 00:04 | 2.8M | |
![[ ]](/icons/layout.gif) | 57048 South Pembs Ch..> | 2025-03-14 00:04 | 3.0M | |
![[ ]](/icons/layout.gif) | 57048 South Pembs Ch..> | 2025-03-14 00:04 | 1.8M | |
![[ ]](/icons/layout.gif) | 57048 South Pembroke..> | 2025-03-14 00:04 | 1.0M | |
![[ ]](/icons/layout.gif) | 57048 South Pembs Ch..> | 2025-03-14 00:04 | 2.9M | |
![[ ]](/icons/layout.gif) | 57048 South Pembroke..> | 2025-03-14 00:04 | 3.1M | |
![[ ]](/icons/layout.gif) | 57047 Preseli Pembro..> | 2025-03-14 00:04 | 4.3M | |
![[ ]](/icons/layout.gif) | 57047 Preseli Pembro..> | 2025-03-14 00:04 | 3.0M | |
![[ ]](/icons/layout.gif) | 57047 Preseli Pembro..> | 2025-03-14 00:04 | 3.4M | |
![[ ]](/icons/layout.gif) | 57047 Preseli Pembro..> | 2025-03-14 00:04 | 3.2M | |
![[ ]](/icons/layout.gif) | 57047 Preseli Pembro..> | 2025-03-14 00:04 | 2.5M | |
![[ ]](/icons/layout.gif) | 57047 Preseli And Di..> | 2025-03-14 00:04 | 2.0M | |
![[ ]](/icons/layout.gif) | 57047 North Pembroke..> | 2025-03-14 00:04 | 2.0M | |
![[ ]](/icons/layout.gif) | 57046 Ceredigion Chu..> | 2025-03-14 00:04 | 1.8M | |
![[ ]](/icons/layout.gif) | 57046 Ceredigion Chu..> | 2025-03-14 00:04 | 1.5M | |
![[ ]](/icons/layout.gif) | 57046 Ceredigion Chu..> | 2025-03-14 00:04 | 2.0M | |
![[ ]](/icons/layout.gif) | 57046 Ceredigion Chu..> | 2025-03-14 00:04 | 1.6M | |
![[ ]](/icons/layout.gif) | 57046 Ceredigion Chu..> | 2025-03-14 00:04 | 1.7M | |
![[ ]](/icons/layout.gif) | 57046 Ceredigion Chu..> | 2025-03-14 00:04 | 1.6M | |
![[ ]](/icons/layout.gif) | 57045 Carmarthenshir..> | 2025-03-14 00:04 | 1.8M | |
![[ ]](/icons/layout.gif) | 57045 Carmarthenshir..> | 2025-03-14 00:04 | 2.4M | |
![[ ]](/icons/layout.gif) | 57045 Carmarthen Chu..> | 2025-03-14 00:04 | 1.3M | |
![[ ]](/icons/layout.gif) | 57045 Carmarthen Chu..> | 2025-03-14 00:04 | 1.8M | |
![[ ]](/icons/layout.gif) | 57045 Carmarthen Chu..> | 2025-03-14 00:04 | 1.3M | |
![[ ]](/icons/layout.gif) | 57045 Carmarthen Chu..> | 2025-03-14 00:04 | 1.4M | |
![[ ]](/icons/layout.gif) | 57045 Carmarthen Chu..> | 2025-03-14 00:04 | 1.5M | |
![[ ]](/icons/layout.gif) | 57045 a 57046 Welsh ..> | 2025-03-14 00:04 | 1.1M | |
![[ ]](/icons/layout.gif) | 57045 Carmarthen Chu..> | 2025-03-14 00:04 | 3.9M | |
![[ ]](/icons/layout.gif) | 57044 Database Direc..> | 2025-03-14 00:04 | 1.5M | |
![[ ]](/icons/layout.gif) | 57028 Qatar Gas II S..> | 2025-03-14 00:04 | 1.8M | |
![[ ]](/icons/layout.gif) | 57043 Excavations In..> | 2025-03-14 00:04 | 4.2M | |
![[ ]](/icons/layout.gif) | 57024 Bishops Garden..> | 2025-03-14 00:04 | 1.1M | |
![[ ]](/icons/layout.gif) | 56968 Archaeological..> | 2025-03-14 00:04 | 733K | |
![[ ]](/icons/layout.gif) | 56967 Camrose Castle..> | 2025-03-14 00:04 | 513K | |
![[ ]](/icons/layout.gif) | 56990 Ffynnonwen Exc..> | 2025-03-14 00:04 | 3.6M | |
![[ ]](/icons/layout.gif) | 56965 Report Of Arch..> | 2025-03-14 00:04 | 177K | |
![[ ]](/icons/layout.gif) | 56964 Croftufty Buil..> | 2025-03-14 00:04 | 1.1M | |
![[ ]](/icons/layout.gif) | 56963 Croftufty Exca..> | 2025-03-14 00:04 | 531K | |
![[ ]](/icons/layout.gif) | 56966 Lydstep Palace..> | 2025-03-14 00:04 | 7.6M | |
![[ ]](/icons/layout.gif) | 56962 Penry Point, H..> | 2025-03-14 00:04 | 1.1M | |
![[ ]](/icons/layout.gif) | 56958 Cefn Sidan Wre..> | 2025-03-14 00:04 | 717K | |
![[ ]](/icons/layout.gif) | 56957 Picton Risisng..> | 2025-03-14 00:04 | 902K | |
![[ ]](/icons/layout.gif) | 56955 West Angle Exc..> | 2025-03-14 00:04 | 859K | |
![[ ]](/icons/layout.gif) | 56955_WestAngleOutre..> | 2025-03-14 00:04 | 1.7M | |
![[ ]](/icons/layout.gif) | 56955 Pembrokeshires..> | 2025-03-14 00:04 | 1.0M | |
![[ ]](/icons/layout.gif) | 56954 Whitehall Farm..> | 2025-03-14 00:04 | 749K | |
![[ ]](/icons/layout.gif) | 56903 Pengegin Isaf ..> | 2025-03-14 00:04 | 3.7M | |
![[ ]](/icons/layout.gif) | 56955 West Angle Bay..> | 2025-03-14 00:04 | 10M | |
![[ ]](/icons/layout.gif) | 56901 Wiston Walled ..> | 2025-03-14 00:04 | 2.4M | |
![[ ]](/icons/layout.gif) | 56902 Netpool Watchi..> | 2025-03-14 00:04 | 1.9M | |
![[ ]](/icons/layout.gif) | 56899 38 Richmond Te..> | 2025-03-14 00:04 | 641K | |
![[ ]](/icons/layout.gif) | 56900 Sunnyhill.pdf | 2025-03-14 00:04 | 937K | |
![[ ]](/icons/layout.gif) | 56898 Shipping Hill.pdf | 2025-03-14 00:04 | 1.8M | |
![[ ]](/icons/layout.gif) | 56897 Monkton Bridge..> | 2025-03-14 00:04 | 1.9M | |
![[ ]](/icons/layout.gif) | 56796 St Sadwrn's Ch..> | 2025-03-14 00:04 | 9.9M | |
![[ ]](/icons/layout.gif) | 56795 Pembroke Castl..> | 2025-03-14 00:04 | 9.8M | |
![[ ]](/icons/layout.gif) | 56745 TG Tyllwyd.pdf | 2025-03-14 00:04 | 2.6M | |
![[ ]](/icons/layout.gif) | 56744 TG Fforest Far..> | 2025-03-14 00:04 | 965K | |
![[ ]](/icons/layout.gif) | 56755 TG Nantllwyd.pdf | 2025-03-14 00:04 | 11M | |
![[ ]](/icons/layout.gif) | 56736 TG Pen-y-banc ..> | 2025-03-14 00:04 | 2.0M | |
![[ ]](/icons/layout.gif) | 56728 TG Eforgrug HE..> | 2025-03-14 00:04 | 7.5M | |
![[ ]](/icons/layout.gif) | 56721 Parks & Garden..> | 2025-03-14 00:04 | 18M | |
![[ ]](/icons/layout.gif) | 56594 PEMBROKESHIRE ..> | 2025-03-14 00:04 | 30M | |
![[ ]](/icons/layout.gif) | 56594 PEMBROKESHIRE ..> | 2025-03-14 00:04 | 38M | |
![[ ]](/icons/layout.gif) | 56594 PEMBROKESHIRE ..> | 2025-03-14 00:04 | 24M | |
![[ ]](/icons/layout.gif) | 56594 PEMBROKESHIRE ..> | 2025-03-14 00:04 | 49M | |
![[ ]](/icons/layout.gif) | 56594 PEMBROKESHIRE ..> | 2025-03-14 00:04 | 46M | |
![[ ]](/icons/layout.gif) | 56594 PEMBROKESHIRE ..> | 2025-03-14 00:04 | 44M | |
![[ ]](/icons/layout.gif) | 56594 PEMBROKESHIRE ..> | 2025-03-14 00:04 | 36M | |
![[ ]](/icons/layout.gif) | 56594 PEMBROKESHIRE ..> | 2025-03-14 00:04 | 35M | |
![[ ]](/icons/layout.gif) | 56594 PEMBROKESHIRE ..> | 2025-03-14 00:04 | 41M | |
![[ ]](/icons/layout.gif) | 56594 PEMBROKESHIRE ..> | 2025-03-14 00:04 | 22M | |
![[ ]](/icons/layout.gif) | 56594 PEMBROKESHIRE ..> | 2025-03-14 00:04 | 22M | |
![[ ]](/icons/layout.gif) | 56592 Brownslade sur..> | 2025-03-14 00:04 | 1.7M | |
![[ ]](/icons/layout.gif) | 56594 PEMBROKESHIRE ..> | 2025-03-14 00:04 | 38M | |
![[ ]](/icons/layout.gif) | 56592 Brownslade sur..> | 2025-03-14 00:04 | 9.1M | |
![[ ]](/icons/layout.gif) | 56592 Brownslade Bar..> | 2025-03-14 00:04 | 199K | |
![[ ]](/icons/layout.gif) | 56592 Brownslade sur..> | 2025-03-14 00:04 | 9.1M | |
![[ ]](/icons/layout.gif) | 56592 Brownslade Bar..> | 2025-03-14 00:04 | 2.3M | |
![[ ]](/icons/layout.gif) | 56591 Gors Fawr Ston..> | 2025-03-14 00:04 | 726K | |
![[ ]](/icons/layout.gif) | 56592 Brownslade Bar..> | 2025-03-14 00:04 | 6.8M | |
![[ ]](/icons/layout.gif) | 56480 Cothi Fencing ..> | 2025-03-14 00:04 | 2.0M | |
![[ ]](/icons/layout.gif) | 56487 Beaconing Farm..> | 2025-03-14 00:04 | 4.3M | |
![[ ]](/icons/layout.gif) | 56478 Bryn Hir asses..> | 2025-03-14 00:04 | 3.0M | |
![[ ]](/icons/layout.gif) | 56476 Machynys East.pdf | 2025-03-14 00:04 | 1.4M | |
![[ ]](/icons/layout.gif) | 56479 Fountain Road,..> | 2025-03-14 00:04 | 15M | |
![[ ]](/icons/layout.gif) | 56474 Narberth Castl..> | 2025-03-14 00:04 | 5.4M | |
![[ ]](/icons/layout.gif) | 56473 EMS Project 20..> | 2025-03-14 00:04 | 375K | |
![[ ]](/icons/layout.gif) | 56420 St Michaels Ch..> | 2025-03-14 00:04 | 2.3M | |
![[ ]](/icons/layout.gif) | 56419 Foley House 20..> | 2025-03-14 00:04 | 1.2M | |
![[ ]](/icons/layout.gif) | 56420 St Michael's C..> | 2025-03-14 00:04 | 2.3M | |
![[ ]](/icons/layout.gif) | 56367 Glanrhyd Farm.pdf | 2025-03-14 00:04 | 2.3M | |
![[ ]](/icons/layout.gif) | 56366 Golden Hill - ..> | 2025-03-14 00:04 | 3.5M | |
![[ ]](/icons/layout.gif) | 56364 44, King Stree..> | 2025-03-14 00:04 | 2.1M | |
![[ ]](/icons/layout.gif) | 56365 Dinefwr North ..> | 2025-03-14 00:04 | 3.4M | |
![[ ]](/icons/layout.gif) | 56363 Facing the Sea..> | 2025-03-14 00:04 | 1.2M | |
![[ ]](/icons/layout.gif) | 56262 Newton House B..> | 2025-03-14 00:04 | 2.6M | |
![[ ]](/icons/layout.gif) | 56261 The Gann, St I..> | 2025-03-14 00:04 | 3.1M | |
![[ ]](/icons/layout.gif) | 56260 Machynys West.pdf | 2025-03-14 00:04 | 1.4M | |
![[ ]](/icons/layout.gif) | 56363 Facing the Sea..> | 2025-03-14 00:04 | 15M | |
![[ ]](/icons/layout.gif) | 56259 Carmarthen Qua..> | 2025-03-14 00:04 | 3.3M | |
![[ ]](/icons/layout.gif) | 56258 Waun Maun Stan..> | 2025-03-14 00:04 | 1.1M | |
![[ ]](/icons/layout.gif) | 55990 TG Plaspaun.pdf | 2025-03-14 00:04 | 2.8M | |
![[ ]](/icons/layout.gif) | 56074 Geophysics on ..> | 2025-03-14 00:04 | 4.0M | |
![[ ]](/icons/layout.gif) | 55987 TG Llwyniorwer..> | 2025-03-14 00:04 | 2.8M | |
![[ ]](/icons/layout.gif) | 55983 TG Rhyd Tir Is..> | 2025-03-14 00:04 | 1.2M | |
![[ ]](/icons/layout.gif) | 55985 Bwlch-crwys Ti..> | 2025-03-14 00:04 | 9.4M | |
![[ ]](/icons/layout.gif) | 55981 TG Llwyncelyn ..> | 2025-03-14 00:04 | 4.4M | |
![[ ]](/icons/layout.gif) | 55981 TG Dolebolion ..> | 2025-03-14 00:04 | 5.7M | |
![[ ]](/icons/compressed.gif) | 55922 PFRS Ceredigio..> | 2025-03-14 00:04 | 30M | |
![[ ]](/icons/layout.gif) | 55922 PFRS Ceredigio..> | 2025-03-14 00:04 | 34M | |
![[ ]](/icons/layout.gif) | 55921 Pembroke Commo..> | 2025-03-14 00:04 | 683K | |
![[ ]](/icons/layout.gif) | 55922 PFRS Ceredigio..> | 2025-03-14 00:04 | 19M | |
![[ ]](/icons/layout.gif) | 55920 Ty Isaf, Llanw..> | 2025-03-14 00:04 | 5.7M | |
![[ ]](/icons/layout.gif) | 55817 Dale Road .pdf | 2025-03-14 00:04 | 444K | |
![[ ]](/icons/layout.gif) | 55818 Withybush Exte..> | 2025-03-14 00:04 | 1.5M | |
![[ ]](/icons/layout.gif) | 55791 Tenby, Zion Ga..> | 2025-03-14 00:04 | 440K | |
![[ ]](/icons/layout.gif) | 55790 Tanyreglwys.pdf | 2025-03-14 00:04 | 7.1M | |
![[ ]](/icons/layout.gif) | 55789 Pembrokeshire ..> | 2025-03-14 00:04 | 3.8M | |
![[ ]](/icons/layout.gif) | 55788 Delfryn wb 200..> | 2025-03-14 00:04 | 689K | |
![[ ]](/icons/layout.gif) | 55697 Eglwyswrw wate..> | 2025-03-14 00:04 | 528K | |
![[ ]](/icons/layout.gif) | 55696 St. Florence w..> | 2025-03-14 00:04 | 308K | |
![[ ]](/icons/layout.gif) | 55695 Skomer Island ..> | 2025-03-14 00:04 | 323K | |
![[ ]](/icons/layout.gif) | 55695 Skomer Island ..> | 2025-03-14 00:04 | 323K | |
![[ ]](/icons/layout.gif) | 55694 The Romans In ..> | 2025-03-14 00:04 | 2.1M | |
![[ ]](/icons/layout.gif) | 55694 The Romans In ..> | 2025-03-14 00:04 | 3.1M | |
![[ ]](/icons/layout.gif) | 55693 Quaker Meeting..> | 2025-03-14 00:04 | 5.3M | |
![[ ]](/icons/layout.gif) | 55693 Quaker Friends..> | 2025-03-14 00:04 | 3.2M | |
![[ ]](/icons/layout.gif) | 55591 Troedyrhiw Exc..> | 2025-03-14 00:05 | 2.5M | |
![[ ]](/icons/layout.gif) | 55440 Tanglost.pdf | 2025-03-14 00:05 | 370K | |
![[ ]](/icons/layout.gif) | 55592 PCNP Dale Airf..> | 2025-03-14 00:05 | 7.3M | |
![[ ]](/icons/layout.gif) | 55338 Trefigin Quarr..> | 2025-03-14 00:05 | 390K | |
![[ ]](/icons/layout.gif) | 55439 Fenton Home Fa..> | 2025-03-14 00:05 | 2.1M | |
![[ ]](/icons/layout.gif) | 55337 Derwen fawr wb..> | 2025-03-14 00:05 | 302K | |
![[ ]](/icons/layout.gif) | 55336 Furnace Bank.pdf | 2025-03-14 00:05 | 2.1M | |
![[ ]](/icons/layout.gif) | 55333 The Armoury.pdf | 2025-03-14 00:05 | 2.0M | |
![[ ]](/icons/layout.gif) | 55285 TG Pwllcalch.pdf | 2025-03-14 00:05 | 2.5M | |
![[ ]](/icons/layout.gif) | 55281 TG Hafod Fawr ..> | 2025-03-14 00:05 | 687K | |
![[ ]](/icons/layout.gif) | 55277 TG Pentre Meur..> | 2025-03-14 00:05 | 523K | |
![[ ]](/icons/layout.gif) | 55209 Abergwili Old ..> | 2025-03-14 00:05 | 493K | |
![[ ]](/icons/layout.gif) | 55208 Carmarthen foo..> | 2025-03-14 00:05 | 2.0M | |
![[ ]](/icons/layout.gif) | 55334 St Clears - Re..> | 2025-03-14 00:05 | 22M | |
![[ ]](/icons/layout.gif) | 55177 Allt Ddu Build..> | 2025-03-14 00:05 | 1.3M | |
![[ ]](/icons/layout.gif) | 55176 St Florence V..> | 2025-03-14 00:05 | 559K | |
![[ ]](/icons/layout.gif) | 55175 14 & 15 Church..> | 2025-03-14 00:05 | 2.5M | |
![[ ]](/icons/layout.gif) | 54935 Beca Bakery No..> | 2025-03-14 00:05 | 400K | |
![[ ]](/icons/layout.gif) | 54934 Llandeilo Roma..> | 2025-03-14 00:05 | 9.1M | |
![[ ]](/icons/layout.gif) | 55174 Delta Lakes.pdf | 2025-03-14 00:05 | 18M | |
![[ ]](/icons/layout.gif) | 54922 Llangynfelyn T..> | 2025-03-14 00:05 | 697K | |
![[ ]](/icons/layout.gif) | 54934 Llandeilo Roma..> | 2025-03-14 00:05 | 11M | |
![[ ]](/icons/layout.gif) | 54921 68 Main Street..> | 2025-03-14 00:05 | 1.7M | |
![[ ]](/icons/layout.gif) | 54920 Castleview Res..> | 2025-03-14 00:05 | 1.4M | |
![[ ]](/icons/layout.gif) | 54892 Long Mains, Mo..> | 2025-03-14 00:05 | 769K | |
![[ ]](/icons/layout.gif) | 54891 Old Priory All..> | 2025-03-14 00:05 | 398K | |
![[ ]](/icons/layout.gif) | 54888 Priory Farm.pdf | 2025-03-14 00:05 | 1.3M | |
![[ ]](/icons/layout.gif) | 54886 Wiston OH rep..> | 2025-03-14 00:05 | 607K | |
![[ ]](/icons/layout.gif) | 54887 Skomer Island ..> | 2025-03-14 00:05 | 2.6M | |
![[ ]](/icons/layout.gif) | 54883 St Lawrence's ..> | 2025-03-14 00:05 | 245K | |
![[ ]](/icons/layout.gif) | 54883 St Lawrences C..> | 2025-03-14 00:05 | 449K | |
![[ ]](/icons/layout.gif) | 54734 Rock Cottage.pdf | 2025-03-14 00:05 | 329K | |
![[ ]](/icons/layout.gif) | 54735 Glebe House.pdf | 2025-03-14 00:05 | 1.2M | |
![[ ]](/icons/layout.gif) | 54733 South Pembs Ho..> | 2025-03-14 00:05 | 680K | |
![[ ]](/icons/layout.gif) | 54732 Berllan Fach.pdf | 2025-03-14 00:05 | 196K | |
![[ ]](/icons/layout.gif) | 54628 Keeston Hall C..> | 2025-03-14 00:05 | 380K | |
![[ ]](/icons/layout.gif) | 54729 Llanelli Gate.pdf | 2025-03-14 00:05 | 1.5M | |
![[ ]](/icons/layout.gif) | 54626 Trefigin Quarr..> | 2025-03-14 00:05 | 683K | |
![[ ]](/icons/layout.gif) | 54520 Survey Of Alpi..> | 2025-03-14 00:05 | 1.7M | |
![[ ]](/icons/layout.gif) | 54506 Narberth Castl..> | 2025-03-14 00:05 | 1.7M | |
![[ ]](/icons/layout.gif) | 54505 TG Llettyngors..> | 2025-03-14 00:05 | 4.1M | |
![[ ]](/icons/layout.gif) | 54503 TG Llygad-enwy..> | 2025-03-14 00:05 | 4.7M | |
![[ ]](/icons/layout.gif) | 54478 Ashfeild Row -..> | 2025-03-14 00:05 | 684K | |
![[ ]](/icons/layout.gif) | 54479 Trawscoed & Ll..> | 2025-03-14 00:05 | 5.4M | |
![[ ]](/icons/layout.gif) | 54472 Dinefwr Castle..> | 2025-03-14 00:05 | 635K | |
![[ ]](/icons/layout.gif) | 54471 St.Florence Ch..> | 2025-03-14 00:05 | 1.1M | |
![[ ]](/icons/layout.gif) | 54471 St. Florence C..> | 2025-03-14 00:05 | 813K | |
![[ ]](/icons/layout.gif) | 54464 Hafod - Propos..> | 2025-03-14 00:05 | 4.4M | |
![[ ]](/icons/layout.gif) | 54462.pdf | 2025-03-14 00:05 | 61K | |
![[ ]](/icons/layout.gif) | 54461.pdf | 2025-03-14 00:05 | 385K | |
![[ ]](/icons/layout.gif) | 54473 Menter Preseli..> | 2025-03-14 00:05 | 13M | |
![[ ]](/icons/layout.gif) | 54460 The Windmill, ..> | 2025-03-14 00:05 | 508K | |
![[ ]](/icons/layout.gif) | 54458 The Sisters Ho..> | 2025-03-14 00:05 | 1.8M | |
![[ ]](/icons/layout.gif) | 54457 The Old lifebo..> | 2025-03-14 00:05 | 492K | |
![[ ]](/icons/layout.gif) | 54458 The Sister's H..> | 2025-03-14 00:05 | 1.8M | |
![[ ]](/icons/layout.gif) | 54455 The Dovecote, ..> | 2025-03-14 00:05 | 693K | |
![[ ]](/icons/layout.gif) | 54456 Castell Coch N..> | 2025-03-14 00:05 | 1.5M | |
![[ ]](/icons/layout.gif) | 54449 A477 Trunk Roa..> | 2025-03-14 00:05 | 2.8M | |
![[ ]](/icons/layout.gif) | 54448 Lockley Lodge.pdf | 2025-03-14 00:05 | 11M | |
![[ ]](/icons/layout.gif) | 54428 Fan Foel Asses..> | 2025-03-14 00:05 | 455K | |
![[ ]](/icons/layout.gif) | 54426 An Arch. Deskt..> | 2025-03-14 00:05 | 460K | |
![[ ]](/icons/layout.gif) | 54425 Llangynfelyn ..> | 2025-03-14 00:05 | 1.0M | |
![[ ]](/icons/layout.gif) | 54424 The Crypt, Hav..> | 2025-03-14 00:05 | 1.2M | |
![[ ]](/icons/layout.gif) | 54423 Showground sit..> | 2025-03-14 00:05 | 921K | |
![[ ]](/icons/layout.gif) | 54422 Beggars Reach.pdf | 2025-03-14 00:05 | 570K | |
![[ ]](/icons/layout.gif) | 54270 Dewi Cottage.pdf | 2025-03-14 00:05 | 388K | |
![[ ]](/icons/layout.gif) | 54430 Hafod - Survey..> | 2025-03-14 00:05 | 24M | |
![[ ]](/icons/layout.gif) | 54269 CEREDIGION DEF..> | 2025-03-14 00:05 | 713K | |
![[ ]](/icons/layout.gif) | 54269 CEREDIGION DEF..> | 2025-03-14 00:05 | 1.4M | |
![[ ]](/icons/layout.gif) | 54269 CERED DEFENDED..> | 2025-03-14 00:05 | 23M | |
![[ ]](/icons/layout.gif) | 54269 CERED DEFENDED..> | 2025-03-14 00:05 | 46M | |
![[ ]](/icons/layout.gif) | 54269 CERED DEFENDED..> | 2025-03-14 00:05 | 40M | |
![[ ]](/icons/layout.gif) | 54269 CERED DEFENDED..> | 2025-03-14 00:05 | 17M | |
![[ ]](/icons/layout.gif) | 54269 CERED DEFENDED..> | 2025-03-14 00:05 | 20M | |
![[ ]](/icons/layout.gif) | 54269 CERED DEFENDED..> | 2025-03-14 00:05 | 21M | |
![[ ]](/icons/layout.gif) | 54269 CERED DEFENDED..> | 2025-03-14 00:05 | 14M | |
![[ ]](/icons/layout.gif) | 54269 CERED DEFENDED..> | 2025-03-14 00:05 | 12M | |
![[ ]](/icons/layout.gif) | 54269 CERED DEFENDED..> | 2025-03-14 00:05 | 17M | |
![[ ]](/icons/layout.gif) | 54269 CERED DEFENDED..> | 2025-03-14 00:05 | 19M | |
![[ ]](/icons/layout.gif) | 54269 CERED DEFENDED..> | 2025-03-14 00:05 | 14M | |
![[ ]](/icons/layout.gif) | 54269 CERED DEFENDED..> | 2025-03-14 00:05 | 18M | |
![[ ]](/icons/layout.gif) | 54269 A SURVEY OF DE..> | 2025-03-14 00:05 | 1.6M | |
![[ ]](/icons/layout.gif) | 54267 The Old Bake H..> | 2025-03-14 00:05 | 407K | |
![[ ]](/icons/layout.gif) | 54263 TG Llwyniorwer..> | 2025-03-14 00:05 | 792K | |
![[ ]](/icons/layout.gif) | 54262 TG Gernant.pdf | 2025-03-14 00:05 | 3.0M | |
![[ ]](/icons/layout.gif) | 54258 TG Rhyd Tir Is..> | 2025-03-14 00:05 | 2.5M | |
![[ ]](/icons/layout.gif) | 54257 TG Bigni.pdf | 2025-03-14 00:05 | 3.0M | |
![[ ]](/icons/layout.gif) | 54269 CERED DEFENDED..> | 2025-03-14 00:05 | 40M | |
![[ ]](/icons/layout.gif) | 54255 TG Gorsto Farm..> | 2025-03-14 00:05 | 3.7M | |
![[ ]](/icons/layout.gif) | 54247 TG Henllys.pdf | 2025-03-14 00:05 | 2.3M | |
![[ ]](/icons/layout.gif) | 54246 TG Penlanfawr.pdf | 2025-03-14 00:05 | 2.4M | |
![[ ]](/icons/layout.gif) | 54237 TG Glyn Annedd..> | 2025-03-14 00:05 | 2.6M | |
![[ ]](/icons/layout.gif) | 54229 TG Ynys Fawr.pdf | 2025-03-14 00:05 | 2.4M | |
![[ ]](/icons/layout.gif) | 54241 TG Hen Fynachl..> | 2025-03-14 00:05 | 12M | |
![[ ]](/icons/layout.gif) | 54227 TG Gilfach-goc..> | 2025-03-14 00:05 | 4.0M | |
![[ ]](/icons/layout.gif) | 54212 TG Pencwm 5498..> | 2025-03-14 00:05 | 729K | |
![[ ]](/icons/layout.gif) | 54225 TG Westmead.pdf | 2025-03-14 00:05 | 2.0M | |
![[ ]](/icons/layout.gif) | 54206 TG Derwen.pdf | 2025-03-14 00:05 | 97K | |
![[ ]](/icons/layout.gif) | 54210 TG Abermeurig ..> | 2025-03-14 00:05 | 657K | |
![[ ]](/icons/layout.gif) | 54183 TG Cilgynydd .pdf | 2025-03-14 00:05 | 808K | |
![[ ]](/icons/layout.gif) | 54197 TG Bach Sylw.pdf | 2025-03-14 00:05 | 3.9M | |
![[ ]](/icons/layout.gif) | 54182 Trerhys Call O..> | 2025-03-14 00:05 | 501K | |
![[ ]](/icons/layout.gif) | 54178 Pwll Caerog .pdf | 2025-03-14 00:05 | 901K | |
![[ ]](/icons/layout.gif) | 54169 Delta lakes.pdf | 2025-03-14 00:05 | 1.4M | |
![[ ]](/icons/layout.gif) | 54168 Beechwood.pdf | 2025-03-14 00:05 | 523K | |
![[ ]](/icons/layout.gif) | 54066 Y Beudy, Mathr..> | 2025-03-14 00:05 | 784K | |
![[ ]](/icons/layout.gif) | 54167 Five Acre Site..> | 2025-03-14 00:05 | 1.4M | |
![[ ]](/icons/layout.gif) | 54065 Peninsular.pdf | 2025-03-14 00:05 | 240K | |
![[ ]](/icons/layout.gif) | 54064 Dragon LNG Fla..> | 2025-03-14 00:05 | 672K | |
![[ ]](/icons/layout.gif) | 54037 Public footpat..> | 2025-03-14 00:05 | 857K | |
![[ ]](/icons/layout.gif) | 54063 Moor Farm Buil..> | 2025-03-14 00:05 | 1.6M | |
![[ ]](/icons/layout.gif) | 54036 Early Med Insc..> | 2025-03-14 00:05 | 199K | |
![[ ]](/icons/layout.gif) | 54034 Carn Ingli Vis..> | 2025-03-14 00:05 | 649K | |
![[ ]](/icons/layout.gif) | 54024 Whitland to He..> | 2025-03-14 00:05 | 2.0M | |
![[ ]](/icons/layout.gif) | 54023 Longoar Bay.pdf | 2025-03-14 00:05 | 2.2M | |
![[ ]](/icons/layout.gif) | 53870 Hasguard Churc..> | 2025-03-14 00:05 | 373K | |
![[ ]](/icons/layout.gif) | 53871 Ffordd Cwm Gwe..> | 2025-03-14 00:05 | 2.5M | |
![[ ]](/icons/layout.gif) | 53869 Porthmynawyd W..> | 2025-03-14 00:05 | 471K | |
![[ ]](/icons/layout.gif) | 53868 Clegyr Boia.pdf | 2025-03-14 00:05 | 2.2M | |
![[ ]](/icons/layout.gif) | 53755 Glanrafon Isaf..> | 2025-03-14 00:05 | 1.0M | |
![[ ]](/icons/layout.gif) | 53743 TG Tymawr .pdf | 2025-03-14 00:05 | 936K | |
![[ ]](/icons/layout.gif) | 53747 TG Ciliau Ucha..> | 2025-03-14 00:05 | 751K | |
![[ ]](/icons/layout.gif) | 53737 TG Coed Bwlart..> | 2025-03-14 00:05 | 294K | |
![[ ]](/icons/layout.gif) | 53727 Lower Mounton ..> | 2025-03-14 00:05 | 658K | |
![[ ]](/icons/layout.gif) | 53722 TG Middle Hill..> | 2025-03-14 00:05 | 2.0M | |
![[ ]](/icons/layout.gif) | 53717 TG Pwllffein.pdf | 2025-03-14 00:05 | 2.9M | |
![[ ]](/icons/layout.gif) | 53705 TG Brixton Far..> | 2025-03-14 00:05 | 515K | |
![[ ]](/icons/layout.gif) | 53699 TG Carn Nwchwr..> | 2025-03-14 00:05 | 669K | |
![[ ]](/icons/layout.gif) | 53699 TG Carn Nwchwn..> | 2025-03-14 00:05 | 669K | |
![[ ]](/icons/layout.gif) | 53696 TG Eisteddfa F..> | 2025-03-14 00:05 | 1.6M | |
![[ ]](/icons/layout.gif) | 53694 TG Mynydd Meli..> | 2025-03-14 00:05 | 650K | |
![[ ]](/icons/layout.gif) | 53683 Hafod Yr Wyn c..> | 2025-03-14 00:05 | 759K | |
![[ ]](/icons/layout.gif) | 53677 TG Tyn y Fron ..> | 2025-03-14 00:05 | 428K | |
![[ ]](/icons/layout.gif) | 53668 Cefn Meurig.pdf | 2025-03-14 00:05 | 723K | |
![[ ]](/icons/layout.gif) | 53665 TG Penrhiw pdf..> | 2025-03-14 00:05 | 634K | |
![[ ]](/icons/layout.gif) | 53665 Penrhiw HE2.pdf | 2025-03-14 00:05 | 634K | |
![[ ]](/icons/layout.gif) | 53660 TG Drim.pdf | 2025-03-14 00:05 | 919K | |
![[ ]](/icons/layout.gif) | 53654 Dinefwr Park s..> | 2025-03-14 00:05 | 1.0M | |
![[ ]](/icons/layout.gif) | 53655 Ragworm Farm, ..> | 2025-03-14 00:05 | 1.7M | |
![[ ]](/icons/layout.gif) | 53653 Milford Power ..> | 2025-03-14 00:05 | 820K | |
![[ ]](/icons/layout.gif) | 53227 TG CwmNantYrEr..> | 2025-03-14 00:05 | 819K | |
![[ ]](/icons/layout.gif) | 53223 TG Glyncaled .pdf | 2025-03-14 00:05 | 298K | |
![[ ]](/icons/layout.gif) | 53031 Flimstone Farm..> | 2025-03-14 00:05 | 2.4M | |
![[ ]](/icons/layout.gif) | 53030 Porthgain Slat..> | 2025-03-14 00:05 | 3.1M | |
![[ ]](/icons/layout.gif) | 52843 Cardigan Town ..> | 2025-03-14 00:05 | 702K | |
![[ ]](/icons/layout.gif) | 53024 Pengelli Fore..> | 2025-03-14 00:05 | 3.8M | |
![[ ]](/icons/layout.gif) | 52841 Mine Watching ..> | 2025-03-14 00:05 | 2.0M | |
![[ ]](/icons/layout.gif) | 52787 Esso Refinery ..> | 2025-03-14 00:05 | 6.0M | |
![[ ]](/icons/layout.gif) | 52686 Pembrokeshire ..> | 2025-03-14 00:05 | 4.1M | |
![[ ]](/icons/layout.gif) | 52509 Pen Anglas.pdf | 2025-03-14 00:05 | 3.7M | |
![[ ]](/icons/layout.gif) | 52438 Old Grammar Sc..> | 2025-03-14 00:05 | 1.1M | |
![[ ]](/icons/layout.gif) | 52317 Rectangular en..> | 2025-03-14 00:05 | 3.4M | |
![[ ]](/icons/layout.gif) | 52314 TG Alltyfyrddi..> | 2025-03-14 00:05 | 743K | |
![[ ]](/icons/layout.gif) | 52300 TG Capel Tydis..> | 2025-03-14 00:05 | 380K | |
![[ ]](/icons/layout.gif) | 52291 Glynhir .pdf | 2025-03-14 00:05 | 792K | |
![[ ]](/icons/layout.gif) | 52286 Pant y Coed Ca..> | 2025-03-14 00:05 | 207K | |
![[ ]](/icons/layout.gif) | 52280 TG Esgairddar ..> | 2025-03-14 00:05 | 1.1M | |
![[ ]](/icons/layout.gif) | 52274 Corston Farm.pdf | 2025-03-14 00:05 | 582K | |
![[ ]](/icons/layout.gif) | 52272 Freestone Hall..> | 2025-03-14 00:05 | 694K | |
![[ ]](/icons/layout.gif) | 52686 PCNP Intertida..> | 2025-03-14 00:05 | 19M | |
![[ ]](/icons/layout.gif) | 52266 TG Trehill .pdf | 2025-03-14 00:05 | 739K | |
![[ ]](/icons/layout.gif) | 52266 Trehill Call O..> | 2025-03-14 00:05 | 4.5M | |
![[ ]](/icons/layout.gif) | 52264 TG Upton Farm.pdf | 2025-03-14 00:05 | 803K | |
![[ ]](/icons/layout.gif) | 52260 TG Tregwynt fa..> | 2025-03-14 00:05 | 462K | |
![[ ]](/icons/layout.gif) | 52254 TG Troed-y-Rhi..> | 2025-03-14 00:05 | 1.0M | |
![[ ]](/icons/layout.gif) | 52253 Glanystwyth.pdf | 2025-03-14 00:05 | 334K | |
![[ ]](/icons/layout.gif) | 52236 Waunfawr .pdf | 2025-03-14 00:05 | 306K | |
![[ ]](/icons/layout.gif) | 52231 TG Tymawr.pdf | 2025-03-14 00:05 | 691K | |
![[ ]](/icons/layout.gif) | 52223 TG Pumpkin She..> | 2025-03-14 00:05 | 136K | |
![[ ]](/icons/layout.gif) | 52221 TG Newhouse.pdf | 2025-03-14 00:05 | 429K | |
![[ ]](/icons/layout.gif) | 52220 TG Llwynceilio..> | 2025-03-14 00:05 | 1.4M | |
![[ ]](/icons/unknown.gif) | 52220 Llwynceiliog.p..> | 2025-03-14 00:05 | 14K | |
![[ ]](/icons/layout.gif) | 52219 TG Trefach.pdf | 2025-03-14 00:05 | 926K | |
![[ ]](/icons/layout.gif) | 52114 Foley House Wa..> | 2025-03-14 00:05 | 851K | |
![[ ]](/icons/layout.gif) | 52113 Llanbadarn Rep..> | 2025-03-14 00:05 | 444K | |
![[ ]](/icons/layout.gif) | 52112 Foley House de..> | 2025-03-14 00:05 | 1.6M | |
![[ ]](/icons/layout.gif) | 52108 Prehistoric De..> | 2025-03-14 00:05 | 1.6M | |
![[ ]](/icons/layout.gif) | 52108 Prehistoric De..> | 2025-03-14 00:05 | 2.8M | |
![[ ]](/icons/layout.gif) | 52219 TG Trefach Cal..> | 2025-03-14 00:05 | 14M | |
![[ ]](/icons/layout.gif) | 51964 Roman Military..> | 2025-03-14 00:05 | 1.8M | |
![[ ]](/icons/layout.gif) | 51964 Cadw RFV (no ..> | 2025-03-14 00:05 | 6.4M | |
![[ ]](/icons/layout.gif) | 51964 Roman Military..> | 2025-03-14 00:05 | 26M | |
![[ ]](/icons/layout.gif) | 51964 Cadw RFV (no ..> | 2025-03-14 00:05 | 1.0M | |
![[ ]](/icons/layout.gif) | 51964 Cadw RFV (no ..> | 2025-03-14 00:06 | 57M | |
![[ ]](/icons/layout.gif) | 51955 Roman Road at ..> | 2025-03-14 00:06 | 1.3M | |
![[ ]](/icons/layout.gif) | 51693 A477 St Clears..> | 2025-03-14 00:06 | 2.3M | |
![[ ]](/icons/layout.gif) | 51691 Pengelli Fores..> | 2025-03-14 00:06 | 1.4M | |
![[ ]](/icons/layout.gif) | 51585 TG Penback.pdf | 2025-03-14 00:06 | 1.5M | |
![[ ]](/icons/layout.gif) | 51530 Carmarthen Res..> | 2025-03-14 00:06 | 822K | |
![[ ]](/icons/layout.gif) | 51964 Cadw RFV (all..> | 2025-03-14 00:06 | 59M | |
![[ ]](/icons/layout.gif) | 51399 Patent Slipway..> | 2025-03-14 00:06 | 2.7M | |
![[ ]](/icons/layout.gif) | 51295 Blaen Bowi Win..> | 2025-03-14 00:06 | 1.5M | |
![[ ]](/icons/layout.gif) | 51226 Boltonhill Qua..> | 2025-03-14 00:06 | 171K | |
![[ ]](/icons/layout.gif) | 51298 & 57056 Carma..> | 2025-03-14 00:06 | 7.2M | |
![[ ]](/icons/layout.gif) | 51123 A487 Felindre ..> | 2025-03-14 00:06 | 3.6M | |
![[ ]](/icons/layout.gif) | 50946 Carmarthen_His..> | 2025-03-14 00:06 | 5.0M | |
![[ ]](/icons/layout.gif) | 50943 and 55922 Preh..> | 2025-03-14 00:06 | 21M | |
![[ ]](/icons/layout.gif) | 50862 Aberporth Airf..> | 2025-03-14 00:06 | 4.0M | |
![[ ]](/icons/layout.gif) | 50861 A477 Nash Bang..> | 2025-03-14 00:06 | 6.3M | |
![[ ]](/icons/layout.gif) | 50794 Prehistoric un..> | 2025-03-14 00:06 | 3.1M | |
![[ ]](/icons/layout.gif) | 50792 New Quay Slipw..> | 2025-03-14 00:06 | 2.7M | |
![[ ]](/icons/layout.gif) | 50649 St. Marys Chur..> | 2025-03-14 00:06 | 7.0M | |
![[ ]](/icons/layout.gif) | 50649 St. Mary's Chu..> | 2025-03-14 00:06 | 7.0M | |
![[ ]](/icons/layout.gif) | 50648 The Old Rector..> | 2025-03-14 00:06 | 792K | |
![[ ]](/icons/layout.gif) | 50946 Carmarthen his..> | 2025-03-14 00:06 | 72M | |
![[ ]](/icons/layout.gif) | 50646 Dolaucothi Gol..> | 2025-03-14 00:06 | 1.3M | |
![[ ]](/icons/layout.gif) | 50593 1 Spring Garde..> | 2025-03-14 00:06 | 790K | |
![[ ]](/icons/layout.gif) | 50625 Pwllauduon.pdf | 2025-03-14 00:06 | 1.5M | |
![[ ]](/icons/layout.gif) | 50590 Ponterwyd to B..> | 2025-03-14 00:06 | 1.0M | |
![[ ]](/icons/layout.gif) | 50592 Nevern Settlem..> | 2025-03-14 00:06 | 1.0M | |
![[ ]](/icons/layout.gif) | 50563 TG Garness Mil..> | 2025-03-14 00:06 | 694K | |
![[ ]](/icons/layout.gif) | 50569 Carmarthenshir..> | 2025-03-14 00:06 | 1.0M | |
![[ ]](/icons/layout.gif) | 50549 Crug Y Deri ca..> | 2025-03-14 00:06 | 323K | |
![[ ]](/icons/layout.gif) | 50561 TG Dinas .pdf | 2025-03-14 00:06 | 1.6M | |
![[ ]](/icons/layout.gif) | 50536 Y Fron .pdf | 2025-03-14 00:06 | 635K | |
![[ ]](/icons/layout.gif) | 50530 TG Pengau .pdf | 2025-03-14 00:06 | 776K | |
![[ ]](/icons/layout.gif) | 50521 TG Monachty-ba..> | 2025-03-14 00:06 | 337K | |
![[ ]](/icons/layout.gif) | 50516 TG Alltlwyd Fa..> | 2025-03-14 00:06 | 2.5M | |
![[ ]](/icons/layout.gif) | 50502 Ty newydd Call..> | 2025-03-14 00:06 | 1.0M | |
![[ ]](/icons/layout.gif) | 50499 TG Waun-gron U..> | 2025-03-14 00:06 | 454K | |
![[ ]](/icons/layout.gif) | 50493 Tir Eglwys Cal..> | 2025-03-14 00:06 | 2.9M | |
![[ ]](/icons/layout.gif) | 50493 TG Tyreglwys F..> | 2025-03-14 00:06 | 3.3M | |
![[ ]](/icons/layout.gif) | 50488 TG Trehyrne.pdf | 2025-03-14 00:06 | 800K | |
![[ ]](/icons/layout.gif) | 50488 TG Trehyrne Fi..> | 2025-03-14 00:06 | 1.0M | |
![[ ]](/icons/layout.gif) | 50476 TG Pengaer Cal..> | 2025-03-14 00:06 | 222K | |
![[ ]](/icons/layout.gif) | 50468 The Old Rector..> | 2025-03-14 00:06 | 792K | |
![[ ]](/icons/layout.gif) | 50477 TG Penrallt.pdf | 2025-03-14 00:06 | 3.3M | |
![[ ]](/icons/layout.gif) | 50459 Footpath at St..> | 2025-03-14 00:06 | 304K | |
![[ ]](/icons/layout.gif) | 50446 Dale, Pembroke..> | 2025-03-14 00:06 | 970K | |
![[ ]](/icons/layout.gif) | 50447 A487(t) Glandy..> | 2025-03-14 00:06 | 2.8M | |
![[ ]](/icons/layout.gif) | 50132 Llangeler Heri..> | 2025-03-14 00:06 | 4.4M | |
![[ ]](/icons/layout.gif) | 50079 Castlemartin A..> | 2025-03-14 00:06 | 7.3M | |
![[ ]](/icons/layout.gif) | 50047 Llandre Commun..> | 2025-03-14 00:06 | 2.7M | |
![[ ]](/icons/layout.gif) | 50046 Llangadog Heri..> | 2025-03-14 00:06 | 11M | |
![[ ]](/icons/layout.gif) | 50080 Lower Teifi Va..> | 2025-03-14 00:06 | 33M | |
![[ ]](/icons/layout.gif) | 50046 Llangadog Heri..> | 2025-03-14 00:06 | 11M | |
![[ ]](/icons/layout.gif) | 50045 Llandeilo Fawr..> | 2025-03-14 00:06 | 5.1M | |
![[ ]](/icons/layout.gif) | 50045 Arolwg Hanes L..> | 2025-03-14 00:06 | 3.9M | |
![[ ]](/icons/layout.gif) | 50027 Burry Port Dis..> | 2025-03-14 00:06 | 4.8M | |
![[ ]](/icons/layout.gif) | 50026 Priory Farm Mo..> | 2025-03-14 00:06 | 2.0M | |
![[ ]](/icons/layout.gif) | 50000 Evaluation And..> | 2025-03-14 00:06 | 2.2M | |
![[ ]](/icons/layout.gif) | 49979 Great Canansto..> | 2025-03-14 00:06 | 390K | |
![[ ]](/icons/layout.gif) | 49978 Cwmgloyne MPP1..> | 2025-03-14 00:06 | 1.2M | |
![[ ]](/icons/layout.gif) | 49977 Dolaucothi Woo..> | 2025-03-14 00:06 | 3.1M | |
![[ ]](/icons/layout.gif) | 50000 Archae. evalSa..> | 2025-03-14 00:06 | 7.8M | |
![[ ]](/icons/layout.gif) | 49919 TG Morfa-Uchaf..> | 2025-03-14 00:06 | 360K | |
![[ ]](/icons/layout.gif) | 49921 TG Gwarcwm Isa..> | 2025-03-14 00:06 | 2.0M | |
![[ ]](/icons/layout.gif) | 49913 TG Bronmwyn.pdf | 2025-03-14 00:06 | 890K | |
![[ ]](/icons/layout.gif) | 49916 TG Ffwrnes Blw..> | 2025-03-14 00:06 | 1.1M | |
![[ ]](/icons/layout.gif) | 49906 TG Pwll yr Hei..> | 2025-03-14 00:06 | 430K | |
![[ ]](/icons/layout.gif) | 49903 TG Neuadd yr Y..> | 2025-03-14 00:06 | 804K | |
![[ ]](/icons/layout.gif) | 49913 Bronmwyn HE2 W..> | 2025-03-14 00:06 | 2.4M | |
![[ ]](/icons/layout.gif) | 49899 TG Tirpant.pdf | 2025-03-14 00:06 | 628K | |
![[ ]](/icons/layout.gif) | 49901 TG Brynllys Fa..> | 2025-03-14 00:06 | 2.0M | |
![[ ]](/icons/layout.gif) | 49889 TG Maescadog .pdf | 2025-03-14 00:06 | 617K | |
![[ ]](/icons/layout.gif) | 49888 TG Ryelands 42..> | 2025-03-14 00:06 | 678K | |
![[ ]](/icons/layout.gif) | 49858 TG Frondeg.pdf | 2025-03-14 00:06 | 2.0M | |
![[ ]](/icons/layout.gif) | 49867 TG Wenallt HE2..> | 2025-03-14 00:06 | 4.0M | |
![[ ]](/icons/layout.gif) | 49849 TG Mountain Fa..> | 2025-03-14 00:06 | 879K | |
![[ ]](/icons/layout.gif) | 49846 TG Brynbanc .pdf | 2025-03-14 00:06 | 373K | |
![[ ]](/icons/layout.gif) | 49845 TG Prouts Park..> | 2025-03-14 00:06 | 570K | |
![[ ]](/icons/layout.gif) | 49843 TG Hendre Farm..> | 2025-03-14 00:06 | 472K | |
![[ ]](/icons/layout.gif) | 49837 TG Woodreef Ca..> | 2025-03-14 00:06 | 677K | |
![[ ]](/icons/layout.gif) | 49807 TG Ffynnonbrod..> | 2025-03-14 00:06 | 3.1M | |
![[ ]](/icons/layout.gif) | 49807 Ffynnon-brodyr..> | 2025-03-14 00:06 | 3.3M | |
![[ ]](/icons/layout.gif) | 49738 A Clom Cottage..> | 2025-03-14 00:06 | 3.4M | |
![[ ]](/icons/layout.gif) | 49738 A 'Clom' Cotta..> | 2025-03-14 00:06 | 3.4M | |
![[ ]](/icons/layout.gif) | 49736 Dinefwr Castle..> | 2025-03-14 00:06 | 257K | |
![[ ]](/icons/layout.gif) | 49657 Torcoed Quarry..> | 2025-03-14 00:06 | 1.5M | |
![[ ]](/icons/layout.gif) | 49737 Hen Gaer Hillf..> | 2025-03-14 00:06 | 4.3M | |
![[ ]](/icons/layout.gif) | 49624 Welsh water tr..> | 2025-03-14 00:06 | 599K | |
![[ ]](/icons/layout.gif) | 49655 Ty Mawr Porthg..> | 2025-03-14 00:06 | 3.0M | |
![[ ]](/icons/layout.gif) | 49622 Kidwelly Pound..> | 2025-03-14 00:06 | 483K | |
![[ ]](/icons/layout.gif) | 49606 Carmarthen - P..> | 2025-03-14 00:06 | 1.4M | |
![[ ]](/icons/layout.gif) | 49595 Integrated Lan..> | 2025-03-14 00:06 | 1.4M | |
![[ ]](/icons/layout.gif) | 49593 Pemb Town Wall..> | 2025-03-14 00:06 | 664K | |
![[ ]](/icons/layout.gif) | 49579 TG Tyriet.pdf | 2025-03-14 00:06 | 287K | |
![[ ]](/icons/layout.gif) | 49550 TG Cefnbenydd ..> | 2025-03-14 00:06 | 252K | |
![[ ]](/icons/layout.gif) | 49572 TG Cefncoed Ma..> | 2025-03-14 00:06 | 927K | |
![[ ]](/icons/layout.gif) | 49539 TG Ty-hela.pdf | 2025-03-14 00:06 | 317K | |
![[ ]](/icons/layout.gif) | 49534 TG Llanfair-fa..> | 2025-03-14 00:06 | 297K | |
![[ ]](/icons/layout.gif) | 49520 TG Treginnis U..> | 2025-03-14 00:06 | 870K | |
![[ ]](/icons/layout.gif) | 49498 TG Cornhwrdd F..> | 2025-03-14 00:06 | 485K | |
![[ ]](/icons/layout.gif) | 49483 TG New Shippin..> | 2025-03-14 00:06 | 1.9M | |
![[ ]](/icons/layout.gif) | 49176 The Shell Hous..> | 2025-03-14 00:06 | 1.5M | |
![[ ]](/icons/layout.gif) | 49175 St Peters Chur..> | 2025-03-14 00:06 | 799K | |
![[ ]](/icons/layout.gif) | 49175 St Peter's Chu..> | 2025-03-14 00:06 | 799K | |
![[ ]](/icons/layout.gif) | 49172_Hayguard_Lane_..> | 2025-03-14 00:06 | 1.0M | |
![[ ]](/icons/layout.gif) | 49172 Hayguard Lane.pdf | 2025-03-14 00:06 | 1.8M | |
![[ ]](/icons/layout.gif) | 49172 Arch in Wales ..> | 2025-03-14 00:06 | 553K | |
![[ ]](/icons/layout.gif) | 49170 St Davids Chur..> | 2025-03-14 00:06 | 1.0M | |
![[ ]](/icons/layout.gif) | 49170 St David's, Pr..> | 2025-03-14 00:06 | 1.0M | |
![[ ]](/icons/layout.gif) | 49169 Excavation of ..> | 2025-03-14 00:06 | 1.4M | |
![[ ]](/icons/layout.gif) | 49086 TG Windmill Pa..> | 2025-03-14 00:06 | 1.2M | |
![[ ]](/icons/layout.gif) | 49081 TG Upper Neest..> | 2025-03-14 00:06 | 765K | |
![[ ]](/icons/layout.gif) | 49076 TG Morvil HE2.pdf | 2025-03-14 00:06 | 1.1M | |
![[ ]](/icons/layout.gif) | 49073 TG Castle Vill..> | 2025-03-14 00:06 | 2.4M | |
![[ ]](/icons/layout.gif) | 49166 1 and 2 Green ..> | 2025-03-14 00:06 | 10M | |
![[ ]](/icons/layout.gif) | 48886 TG Ysgubor-wen..> | 2025-03-14 00:06 | 1.0M | |
![[ ]](/icons/layout.gif) | 48882 TG Pensarn.pdf | 2025-03-14 00:06 | 1.8M | |
![[ ]](/icons/layout.gif) | 48881 TG Kingston HE..> | 2025-03-14 00:06 | 1.8M | |
![[ ]](/icons/layout.gif) | 48596 Fan Foel speci..> | 2025-03-14 00:06 | 1.2M | |
![[ ]](/icons/layout.gif) | 48596 Fan Foel speci..> | 2025-03-14 00:06 | 1.2M | |
![[ ]](/icons/layout.gif) | 48596 Fan Foel Excav..> | 2025-03-14 00:06 | 1.1M | |
![[ ]](/icons/layout.gif) | 48516 TG Trenewydd F..> | 2025-03-14 00:06 | 922K | |
![[ ]](/icons/layout.gif) | 48519 Llanfynydd Com..> | 2025-03-14 00:06 | 1.4M | |
![[ ]](/icons/layout.gif) | 48515 TG West Orielt..> | 2025-03-14 00:06 | 1.4M | |
![[ ]](/icons/layout.gif) | 48508 TG Wernmacwydd..> | 2025-03-14 00:06 | 3.4M | |
![[ ]](/icons/layout.gif) | 48506 TG Berllan Dyw..> | 2025-03-14 00:06 | 1.1M | |
![[ ]](/icons/layout.gif) | 48491 TG Nantfforcho..> | 2025-03-14 00:06 | 578K | |
![[ ]](/icons/layout.gif) | 48485 TG Cwmgelli-fa..> | 2025-03-14 00:06 | 922K | |
![[ ]](/icons/layout.gif) | 48475 TG Carew Newto..> | 2025-03-14 00:06 | 1.1M | |
![[ ]](/icons/layout.gif) | 48469 TG Hengoed HE2..> | 2025-03-14 00:06 | 1.8M | |
![[ ]](/icons/layout.gif) | 48467 TG Troedyrhiw.pdf | 2025-03-14 00:06 | 1.0M | |
![[ ]](/icons/layout.gif) | 48466 TG Gilwen Farm..> | 2025-03-14 00:06 | 2.8M | |
![[ ]](/icons/layout.gif) | 48465 TG Ystradwalte..> | 2025-03-14 00:06 | 2.5M | |
![[ ]](/icons/layout.gif) | 48464 TG Llwyn-y-bra..> | 2025-03-14 00:06 | 694K | |
![[ ]](/icons/layout.gif) | 48458 TG Glanmynys.pdf | 2025-03-14 00:06 | 1.0M | |
![[ ]](/icons/layout.gif) | 48461 TG Underhill H..> | 2025-03-14 00:06 | 3.2M | |
![[ ]](/icons/layout.gif) | 48453 Maes Cottage T..> | 2025-03-14 00:06 | 751K | |
![[ ]](/icons/layout.gif) | 48447 TG Felin-y-coe..> | 2025-03-14 00:06 | 1.2M | |
![[ ]](/icons/layout.gif) | 48444 Heolddu Call O..> | 2025-03-14 00:06 | 1.6M | |
![[ ]](/icons/layout.gif) | 48453 maes cottage 3..> | 2025-03-14 00:06 | 1.7M | |
![[ ]](/icons/layout.gif) | 48442 TG Lower Lodge..> | 2025-03-14 00:06 | 3.1M | |
![[ ]](/icons/layout.gif) | 48427 TG Pensarn.pdf | 2025-03-14 00:06 | 816K | |
![[ ]](/icons/layout.gif) | 48419 TG Maenarthur ..> | 2025-03-14 00:06 | 1.4M | |
![[ ]](/icons/layout.gif) | 48316 Minerals Recla..> | 2025-03-14 00:06 | 2.3M | |
![[ ]](/icons/layout.gif) | 48285 Gorslas Commun..> | 2025-03-14 00:06 | 1.3M | |
![[ ]](/icons/layout.gif) | 48285 Gorslas Commun..> | 2025-03-14 00:06 | 3.9M | |
![[ ]](/icons/layout.gif) | 48238 Trunk Road Imp..> | 2025-03-14 00:06 | 1.9M | |
![[ ]](/icons/layout.gif) | 48284 Pont Twrch.pdf | 2025-03-14 00:06 | 2.5M | |
![[ ]](/icons/layout.gif) | 48183 Saint Davids C..> | 2025-03-14 00:06 | 612K | |
![[ ]](/icons/layout.gif) | 48183 Saint David's ..> | 2025-03-14 00:06 | 612K | |
![[ ]](/icons/layout.gif) | 48237 Rosehill, Aber..> | 2025-03-14 00:06 | 2.9M | |
![[ ]](/icons/layout.gif) | 48156 Site Adjacent ..> | 2025-03-14 00:06 | 1.6M | |
![[ ]](/icons/layout.gif) | 48147 DRS In Southwe..> | 2025-03-14 00:06 | 5.7M | |
![[ ]](/icons/layout.gif) | 48147 DRS 2003-2004 ..> | 2025-03-14 00:06 | 8.6M | |
![[ ]](/icons/layout.gif) | 48116 Intertidal and..> | 2025-03-14 00:06 | 4.1M | |
![[ ]](/icons/layout.gif) | 48116 Archaeological..> | 2025-03-14 00:06 | 3.0M | |
![[ ]](/icons/layout.gif) | 48095_PFRS_Pembs.pdf | 2025-03-14 00:06 | 10M | |
![[ ]](/icons/layout.gif) | 48095 Prehistoric & ..> | 2025-03-14 00:06 | 16M | |
![[ ]](/icons/layout.gif) | 48083 Carmarthen Cas..> | 2025-03-14 00:06 | 12M | |
![[ ]](/icons/layout.gif) | 48082 55 Priory Stre..> | 2025-03-14 00:06 | 3.3M | |
![[ ]](/icons/layout.gif) | 48026 Pen Parc CSO S..> | 2025-03-14 00:06 | 1.1M | |
![[ ]](/icons/layout.gif) | 48002 Penlan Wood.pdf | 2025-03-14 00:06 | 1.1M | |
![[ ]](/icons/layout.gif) | 47998 A Burial From ..> | 2025-03-14 00:06 | 1.8M | |
![[ ]](/icons/layout.gif) | 47884 TG Llwynfedw C..> | 2025-03-14 00:06 | 1.4M | |
![[ ]](/icons/layout.gif) | 47883 TG Erwbarfe HE..> | 2025-03-14 00:06 | 759K | |
![[ ]](/icons/layout.gif) | 47883 Assessment of ..> | 2025-03-14 00:06 | 3.1M | |
![[ ]](/icons/layout.gif) | 47883 Assessment of ..> | 2025-03-14 00:06 | 7.5M | |
![[ ]](/icons/layout.gif) | 47999 Brownslade 200..> | 2025-03-14 00:06 | 17M | |
![[ ]](/icons/layout.gif) | 47880 TG Erwbarfe Ca..> | 2025-03-14 00:06 | 752K | |
![[ ]](/icons/layout.gif) | 47882 TG Penlan Farm..> | 2025-03-14 00:06 | 1.5M | |
![[ ]](/icons/layout.gif) | 47874 TG Penwernhir ..> | 2025-03-14 00:06 | 1.3M | |
![[ ]](/icons/layout.gif) | 47843 TG Plas Cefn G..> | 2025-03-14 00:06 | 823K | |
![[ ]](/icons/layout.gif) | 47858 TG Pwllauduon.pdf | 2025-03-14 00:06 | 2.4M | |
![[ ]](/icons/layout.gif) | 47835 Roman Fort at ..> | 2025-03-14 00:06 | 861K | |
![[ ]](/icons/layout.gif) | 47837 TG Pantiorlech..> | 2025-03-14 00:06 | 1.8M | |
![[ ]](/icons/layout.gif) | 47834 Fairy Bank, Be..> | 2025-03-14 00:06 | 139K | |
![[ ]](/icons/layout.gif) | 47833 Assessment of ..> | 2025-03-14 00:06 | 3.1M | |
![[ ]](/icons/layout.gif) | 47782 Aberstrincell ..> | 2025-03-14 00:06 | 2.8M | |
![[ ]](/icons/layout.gif) | 47833 Assessment of ..> | 2025-03-14 00:06 | 7.5M | |
![[ ]](/icons/layout.gif) | 47614 Starling Park,..> | 2025-03-14 00:06 | 1.1M | |
![[ ]](/icons/layout.gif) | 47580 Bynea Heritage..> | 2025-03-14 00:06 | 5.4M | |
![[ ]](/icons/layout.gif) | 47627 Cardigan Town ..> | 2025-03-14 00:06 | 12M | |
![[ ]](/icons/layout.gif) | 47575 Arolwg Cymuned..> | 2025-03-14 00:06 | 3.2M | |
![[ ]](/icons/layout.gif) | 47478 Land Adjacent ..> | 2025-03-14 00:06 | 616K | |
![[ ]](/icons/layout.gif) | 47562 Arolwg Cymuned..> | 2025-03-14 00:06 | 2.2M | |
![[ ]](/icons/layout.gif) | 47468 Llanilar Commu..> | 2025-03-14 00:06 | 1.8M | |
![[ ]](/icons/layout.gif) | 47467 Lledrod Commun..> | 2025-03-14 00:06 | 2.7M | |
![[ ]](/icons/layout.gif) | 47454 Starling Park,..> | 2025-03-14 00:06 | 2.7M | |
![[ ]](/icons/layout.gif) | 47434 Prehistoric Fu..> | 2025-03-14 00:06 | 1.4M | |
![[ ]](/icons/layout.gif) | 47393 Llanwnda Churc..> | 2025-03-14 00:06 | 1.3M | |
![[ ]](/icons/layout.gif) | 47392 Ystrad Fflur C..> | 2025-03-14 00:06 | 4.5M | |
![[ ]](/icons/layout.gif) | 47390 Ystrad Meurig ..> | 2025-03-14 00:06 | 2.3M | |
![[ ]](/icons/layout.gif) | 47391 Museum of the ..> | 2025-03-14 00:06 | 8.0M | |
![[ ]](/icons/layout.gif) | 47346 Glanyrynys TG.pdf | 2025-03-14 00:06 | 337K | |
![[ ]](/icons/layout.gif) | 47348 TG Blaen Halen..> | 2025-03-14 00:06 | 2.5M | |
![[ ]](/icons/layout.gif) | 47330 TG Call Out Ta..> | 2025-03-14 00:06 | 620K | |
![[ ]](/icons/layout.gif) | 47336 TG Buarth yr O..> | 2025-03-14 00:06 | 1.3M | |
![[ ]](/icons/layout.gif) | 47323 Llethr.pdf | 2025-03-14 00:06 | 661K | |
![[ ]](/icons/layout.gif) | 47322 TG Coed Perthi..> | 2025-03-14 00:06 | 1.6M | |
![[ ]](/icons/layout.gif) | 47315 TG Penrallt Ca..> | 2025-03-14 00:06 | 1.2M | |
![[ ]](/icons/layout.gif) | 47316 TG Caemadog.pdf | 2025-03-14 00:06 | 2.9M | |
![[ ]](/icons/layout.gif) | 47288 Ysbyty Ystwyth..> | 2025-03-14 00:06 | 4.2M | |
![[ ]](/icons/layout.gif) | 47309 Priory Farm, M..> | 2025-03-14 00:06 | 5.9M | |
![[ ]](/icons/layout.gif) | 47286 The Gothic Arc..> | 2025-03-14 00:06 | 1.8M | |
![[ ]](/icons/layout.gif) | 47274 Manorbier to T..> | 2025-03-14 00:06 | 1.7M | |
![[ ]](/icons/layout.gif) | 47273 Whitland Abbey..> | 2025-03-14 00:06 | 523K | |
![[ ]](/icons/layout.gif) | 47271 Report On The ..> | 2025-03-14 00:06 | 870K | |
![[ ]](/icons/layout.gif) | 47266 Excavations at..> | 2025-03-14 00:06 | 1.7M | |
![[ ]](/icons/layout.gif) | 47266 Excavations At..> | 2025-03-14 00:06 | 3.1M | |
![[ ]](/icons/layout.gif) | 47266 Excavations At..> | 2025-03-14 00:06 | 5.5M | |
![[ ]](/icons/layout.gif) | 47266 Carmarthen Gre..> | 2025-03-14 00:06 | 830K | |
![[ ]](/icons/layout.gif) | 47266 Carmarthen Gre..> | 2025-03-14 00:06 | 1.8M | |
![[ ]](/icons/layout.gif) | 47265 Excavations at..> | 2025-03-14 00:06 | 632K | |
![[ ]](/icons/layout.gif) | 47261 New Moat To Rh..> | 2025-03-14 00:06 | 238K | |
![[ ]](/icons/layout.gif) | 47259 Report On The ..> | 2025-03-14 00:06 | 540K | |
![[ ]](/icons/layout.gif) | 47258 Scraping And R..> | 2025-03-14 00:06 | 544K | |
![[ ]](/icons/layout.gif) | 47266 Carmarthen Gre..> | 2025-03-14 00:06 | 6.3M | |
![[ ]](/icons/layout.gif) | 47255 HLC PenCaer. ..> | 2025-03-14 00:06 | 9.7M | |
![[ ]](/icons/layout.gif) | 47238 Amman Valley H..> | 2025-03-14 00:06 | 13M | |
![[ ]](/icons/layout.gif) | 47222 TG Pengwern-Is..> | 2025-03-14 00:06 | 2.4M | |
![[ ]](/icons/layout.gif) | 47230 Historic Asset..> | 2025-03-14 00:06 | 7.2M | |
![[ ]](/icons/layout.gif) | 47200 TG Gwarnoethle..> | 2025-03-14 00:06 | 3.9M | |
![[ ]](/icons/layout.gif) | 47190 TG Parc Henri.pdf | 2025-03-14 00:06 | 1.1M | |
![[ ]](/icons/layout.gif) | 47189 TG Abersannan ..> | 2025-03-14 00:06 | 1.5M | |
![[ ]](/icons/layout.gif) | 47188 TG Troed Y Bry..> | 2025-03-14 00:06 | 2.8M | |
![[ ]](/icons/layout.gif) | 47184 TG Tynywaun.pdf | 2025-03-14 00:06 | 3.5M | |
![[ ]](/icons/layout.gif) | 47179 Blaenrheidol C..> | 2025-03-14 00:06 | 4.6M | |
![[ ]](/icons/layout.gif) | 47163 Pontarfynach C..> | 2025-03-14 00:06 | 5.0M | |
![[ ]](/icons/layout.gif) | 47 Castle Street, Lo..> | 2025-03-14 00:06 | 8.4M | |
![[ ]](/icons/layout.gif) | 46961 Arch in Wales ..> | 2025-03-14 00:06 | 1.8M | |
![[ ]](/icons/layout.gif) | 46876 Bontgoch Stora..> | 2025-03-14 00:06 | 1.0M | |
![[ ]](/icons/layout.gif) | 46736 Llanddeusant C..> | 2025-03-14 00:06 | 3.0M | |
![[ ]](/icons/layout.gif) | 46735 Dinefwr Castle..> | 2025-03-14 00:06 | 573K | |
![[ ]](/icons/layout.gif) | 46584 The Coronation..> | 2025-03-14 00:06 | 450K | |
![[ ]](/icons/layout.gif) | 46549 Bro Beca Herit..> | 2025-03-14 00:06 | 1.4M | |
![[ ]](/icons/layout.gif) | 46961 Exc. Newton Ll..> | 2025-03-14 00:06 | 35M | |
![[ ]](/icons/layout.gif) | 46442 29 Park Hall, ..> | 2025-03-14 00:06 | 1.3M | |
![[ ]](/icons/layout.gif) | 46411 Capel Antioch,..> | 2025-03-14 00:06 | 357K | |
![[ ]](/icons/layout.gif) | 46410 Shed At Wiston..> | 2025-03-14 00:06 | 1.3M | |
![[ ]](/icons/layout.gif) | 46502 A40(T) St Clea..> | 2025-03-14 00:06 | 30M | |
![[ ]](/icons/layout.gif) | 46409 Llanfair Grang..> | 2025-03-14 00:06 | 172K | |
![[ ]](/icons/layout.gif) | 46408 St.Michaels Ch..> | 2025-03-14 00:06 | 168K | |
![[ ]](/icons/layout.gif) | 46408 St.Michael's C..> | 2025-03-14 00:06 | 168K | |
![[ ]](/icons/layout.gif) | 46407 Amman Valley S..> | 2025-03-14 00:06 | 325K | |
![[ ]](/icons/layout.gif) | 46045 St.Mary Magdal..> | 2025-03-14 00:06 | 1.9M | |
![[ ]](/icons/layout.gif) | 46044 The Drill Hall..> | 2025-03-14 00:06 | 2.6M | |
![[ ]](/icons/layout.gif) | 46391 Arch. Building..> | 2025-03-14 00:06 | 7.9M | |
![[ ]](/icons/layout.gif) | 45943 Deserted Rural..> | 2025-03-14 00:07 | 4.9M | |
![[ ]](/icons/layout.gif) | 45943 Deserted Rural..> | 2025-03-14 00:07 | 6.4M | |
![[ ]](/icons/layout.gif) | 45930 TG Brynbanc HE..> | 2025-03-14 00:07 | 1.9M | |
![[ ]](/icons/layout.gif) | 45934 TG Blaenmaenog..> | 2025-03-14 00:07 | 6.2M | |
![[ ]](/icons/layout.gif) | 45910 TG Llanfair .pdf | 2025-03-14 00:07 | 87K | |
![[ ]](/icons/layout.gif) | 45905 TG Castell Mar..> | 2025-03-14 00:07 | 347K | |
![[ ]](/icons/layout.gif) | 45868 TG Cwm Maen.pdf | 2025-03-14 00:07 | 2.3M | |
![[ ]](/icons/layout.gif) | 45865 TG South Headb..> | 2025-03-14 00:07 | 2.3M | |
![[ ]](/icons/layout.gif) | 45861TG Newhouse Far..> | 2025-03-14 00:07 | 3.6M | |
![[ ]](/icons/layout.gif) | 45864 TG Knowles Far..> | 2025-03-14 00:07 | 5.3M | |
![[ ]](/icons/layout.gif) | 45860 TG Slebech Par..> | 2025-03-14 00:07 | 1.5M | |
![[ ]](/icons/layout.gif) | 45857 TG Fenton Home..> | 2025-03-14 00:07 | 2.6M | |
![[ ]](/icons/layout.gif) | 45854 TG Panteg.pdf | 2025-03-14 00:07 | 3.1M | |
![[ ]](/icons/layout.gif) | 45851 TG Langdon Mil..> | 2025-03-14 00:07 | 2.0M | |
![[ ]](/icons/layout.gif) | 45849 TG Dolau Isaf.pdf | 2025-03-14 00:07 | 1.2M | |
![[ ]](/icons/layout.gif) | 45845 TG Hackett Far..> | 2025-03-14 00:07 | 3.6M | |
![[ ]](/icons/layout.gif) | 45841 TG Trewarren F..> | 2025-03-14 00:07 | 3.9M | |
![[ ]](/icons/layout.gif) | 45685 TG Brynfa Farm..> | 2025-03-14 00:07 | 1.6M | |
![[ ]](/icons/layout.gif) | 45683 TG Maesybeddau..> | 2025-03-14 00:07 | 1.1M | |
![[ ]](/icons/layout.gif) | 45670 TG Venterin.pdf | 2025-03-14 00:07 | 2.5M | |
![[ ]](/icons/layout.gif) | 45667 TG Marloes Cou..> | 2025-03-14 00:07 | 2.7M | |
![[ ]](/icons/layout.gif) | 45662 TG Cefn Maes M..> | 2025-03-14 00:07 | 650K | |
![[ ]](/icons/layout.gif) | 45666 TG Penlan-Ucha..> | 2025-03-14 00:07 | 2.4M | |
![[ ]](/icons/layout.gif) | 45661 TG Cwm March.pdf | 2025-03-14 00:07 | 2.8M | |
![[ ]](/icons/layout.gif) | 45646 TG Llwyncrwn.pdf | 2025-03-14 00:07 | 1.8M | |
![[ ]](/icons/layout.gif) | 45641 TG Tirlan.pdf | 2025-03-14 00:07 | 2.1M | |
![[ ]](/icons/layout.gif) | 45640 TG Cwmtywyll.pdf | 2025-03-14 00:07 | 1.7M | |
![[ ]](/icons/layout.gif) | 45635 TG Pantycoubal..> | 2025-03-14 00:07 | 1.2M | |
![[ ]](/icons/layout.gif) | 45633 TG Llwynpur.pdf | 2025-03-14 00:07 | 2.4M | |
![[ ]](/icons/layout.gif) | 45660 TG Trefriw.pdf | 2025-03-14 00:07 | 15M | |
![[ ]](/icons/layout.gif) | 45631 TG Cilsant.pdf | 2025-03-14 00:07 | 807K | |
![[ ]](/icons/layout.gif) | 45630 TG Llwynrebol.pdf | 2025-03-14 00:07 | 1.0M | |
![[ ]](/icons/layout.gif) | 45615 TG Abergwenlai..> | 2025-03-14 00:07 | 2.6M | |
![[ ]](/icons/layout.gif) | 45605 TG Pantglas.pdf | 2025-03-14 00:07 | 1.5M | |
![[ ]](/icons/layout.gif) | 45602 TG Berthlwyd C..> | 2025-03-14 00:07 | 133K | |
![[ ]](/icons/layout.gif) | 45603 TG Treiago.pdf | 2025-03-14 00:07 | 2.5M | |
![[ ]](/icons/layout.gif) | 45600 TG Graig Farm.pdf | 2025-03-14 00:07 | 2.1M | |
![[ ]](/icons/layout.gif) | 45594 TG Pantglas.pdf | 2025-03-14 00:07 | 1.8M | |
![[ ]](/icons/layout.gif) | 45592 TG Rhos-y-Bedw..> | 2025-03-14 00:07 | 1.6M | |
![[ ]](/icons/layout.gif) | 45563 Excavations at..> | 2025-03-14 00:07 | 229K | |
![[ ]](/icons/layout.gif) | 45243 Petroplus LNG ..> | 2025-03-14 00:07 | 928K | |
![[ ]](/icons/layout.gif) | 45433 Mountain Chape..> | 2025-03-14 00:07 | 2.1M | |
![[ ]](/icons/layout.gif) | 45112 Manordeifi Old..> | 2025-03-14 00:07 | 186K | |
![[ ]](/icons/layout.gif) | 45242 Penygarn Road,..> | 2025-03-14 00:07 | 2.0M | |
![[ ]](/icons/layout.gif) | 45111 Archaeological..> | 2025-03-14 00:07 | 5.5M | |
![[ ]](/icons/layout.gif) | 45107 4 - 5 King Str..> | 2025-03-14 00:07 | 94K | |
![[ ]](/icons/layout.gif) | 45100 Richmond Park,..> | 2025-03-14 00:07 | 1.8M | |
![[ ]](/icons/layout.gif) | 45099 Richmond Park,..> | 2025-03-14 00:07 | 910K | |
![[ ]](/icons/layout.gif) | 45096 Spilman Street..> | 2025-03-14 00:07 | 487K | |
![[ ]](/icons/layout.gif) | 45111 Archae. Resour..> | 2025-03-14 00:07 | 11M | |
![[ ]](/icons/layout.gif) | 45093 Llanllwch Mill..> | 2025-03-14 00:07 | 477K | |
![[ ]](/icons/layout.gif) | 44943 Clos Llwyn, Wh..> | 2025-03-14 00:07 | 1.2M | |
![[ ]](/icons/layout.gif) | 45078 Pennar Point, ..> | 2025-03-14 00:07 | 5.6M | |
![[ ]](/icons/layout.gif) | 44889 Ammanford Cast..> | 2025-03-14 00:07 | 2.8M | |
![[ ]](/icons/layout.gif) | 44942 Brownslade Bar..> | 2025-03-14 00:07 | 6.4M | |
![[ ]](/icons/layout.gif) | 44883 Dolaucothi Gol..> | 2025-03-14 00:07 | 11M | |
![[ ]](/icons/layout.gif) | 44877 Tir Gofal Cerr..> | 2025-03-14 00:07 | 2.7M | |
![[ ]](/icons/layout.gif) | 44856 Industrial Lan..> | 2025-03-14 00:07 | 1.9M | |
![[ ]](/icons/layout.gif) | 44883 Dolaucothi Gol..> | 2025-03-14 00:07 | 19M | |
![[ ]](/icons/layout.gif) | 44754 The Charcoal-f..> | 2025-03-14 00:07 | 6.5M | |
![[ ]](/icons/layout.gif) | 44754 Charcoal-Fuell..> | 2025-03-14 00:07 | 6.1M | |
![[ ]](/icons/layout.gif) | 44754 Charcoal-Fuell..> | 2025-03-14 00:07 | 7.9M | |
![[ ]](/icons/layout.gif) | 44753_Early_Med_eccl..> | 2025-03-14 00:07 | 6.9M | |
![[ ]](/icons/layout.gif) | 44753 Early Medieval..> | 2025-03-14 00:07 | 3.1M | |
![[ ]](/icons/layout.gif) | 44753 Early Medieval..> | 2025-03-14 00:07 | 1.8M | |
![[ ]](/icons/layout.gif) | 44753 Early Medieval..> | 2025-03-14 00:07 | 3.4M | |
![[ ]](/icons/layout.gif) | 44753 Early Medieval..> | 2025-03-14 00:07 | 7.7M | |
![[ ]](/icons/layout.gif) | 44753 Early Medieval..> | 2025-03-14 00:07 | 4.7M | |
![[ ]](/icons/layout.gif) | 44753 Early Medieval..> | 2025-03-14 00:07 | 5.6M | |
![[ ]](/icons/layout.gif) | 44753 Early Medieval..> | 2025-03-14 00:07 | 6.6M | |
![[ ]](/icons/layout.gif) | 44753 Early Medieval..> | 2025-03-14 00:07 | 6.6M | |
![[ ]](/icons/layout.gif) | 44753 Early Medieval..> | 2025-03-14 00:07 | 4.4M | |
![[ ]](/icons/layout.gif) | 44753 Early Medieval..> | 2025-03-14 00:07 | 23M | |
![[ ]](/icons/layout.gif) | 44753 Early Medieval..> | 2025-03-14 00:07 | 4.7M | |
![[ ]](/icons/layout.gif) | 44753 Early Medieval..> | 2025-03-14 00:07 | 4.7M | |
![[ ]](/icons/layout.gif) | 44753 Early Medieval..> | 2025-03-14 00:07 | 4.3M | |
![[ ]](/icons/layout.gif) | 44753 Early Medieval..> | 2025-03-14 00:07 | 1.2M | |
![[ ]](/icons/layout.gif) | 44753 Early Medieval..> | 2025-03-14 00:07 | 2.4M | |
![[ ]](/icons/layout.gif) | 44753 Early Medieval..> | 2025-03-14 00:07 | 4.4M | |
![[ ]](/icons/layout.gif) | 44753 Early Medieval..> | 2025-03-14 00:07 | 1.7M | |
![[ ]](/icons/layout.gif) | 44753 Early Medieval..> | 2025-03-14 00:07 | 785K | |
![[ ]](/icons/layout.gif) | 44698 Proposed Ragwo..> | 2025-03-14 00:07 | 734K | |
![[ ]](/icons/layout.gif) | 44753 Early Medieval..> | 2025-03-14 00:07 | 4.0M | |
![[ ]](/icons/layout.gif) | 44487 St Thomas A Be..> | 2025-03-14 00:07 | 339K | |
![[ ]](/icons/layout.gif) | 44517 Metal Mines Pr..> | 2025-03-14 00:07 | 5.5M | |
![[ ]](/icons/layout.gif) | 44487 St Thomas A Be..> | 2025-03-14 00:07 | 339K | |
![[ ]](/icons/layout.gif) | 44486 Museum of the ..> | 2025-03-14 00:07 | 525K | |
![[ ]](/icons/layout.gif) | 44440 Llandeloy Chur..> | 2025-03-14 00:07 | 476K | |
![[ ]](/icons/layout.gif) | 44388 Bynea Sewage T..> | 2025-03-14 00:07 | 797K | |
![[ ]](/icons/layout.gif) | 44366 South Turret D..> | 2025-03-14 00:07 | 1.8M | |
![[ ]](/icons/layout.gif) | 44315 Haverfordwest ..> | 2025-03-14 00:07 | 639K | |
![[ ]](/icons/layout.gif) | 44389 Milford Haven ..> | 2025-03-14 00:07 | 6.3M | |
![[ ]](/icons/layout.gif) | 44304 Pembroke Flood..> | 2025-03-14 00:07 | 2.0M | |
![[ ]](/icons/layout.gif) | 44299 Blaen Bowi Win..> | 2025-03-14 00:07 | 768K | |
![[ ]](/icons/layout.gif) | 44300 Roman Road Wes..> | 2025-03-14 00:07 | 3.9M | |
![[ ]](/icons/layout.gif) | 44298 Croesffordd, L..> | 2025-03-14 00:07 | 817K | |
![[ ]](/icons/layout.gif) | 44297 Forge Washery,..> | 2025-03-14 00:07 | 1.3M | |
![[ ]](/icons/layout.gif) | 44288 TG Cwmrhyddan ..> | 2025-03-14 00:07 | 1.1M | |
![[ ]](/icons/layout.gif) | 44278 TG Cwm Hwylog.pdf | 2025-03-14 00:07 | 2.0M | |
![[ ]](/icons/layout.gif) | 44263 TG Sunnyhill F..> | 2025-03-14 00:07 | 4.4M | |
![[ ]](/icons/layout.gif) | 44259 TG Dolgarreg.pdf | 2025-03-14 00:07 | 3.8M | |
![[ ]](/icons/layout.gif) | 44257 TG Nantycastel..> | 2025-03-14 00:07 | 1.6M | |
![[ ]](/icons/layout.gif) | 44254 TG Dyffryn Isa..> | 2025-03-14 00:07 | 52K | |
![[ ]](/icons/layout.gif) | 44254 TG Dyffryn Isa..> | 2025-03-14 00:07 | 564K | |
![[ ]](/icons/layout.gif) | 44250 TG Grondre Fac..> | 2025-03-14 00:07 | 1.2M | |
![[ ]](/icons/layout.gif) | 44252 TG Droslyn Far..> | 2025-03-14 00:07 | 2.1M | |
![[ ]](/icons/layout.gif) | 44246 TG Windy Hill.pdf | 2025-03-14 00:07 | 1.0M | |
![[ ]](/icons/layout.gif) | 44238 TG Dol Rhanog ..> | 2025-03-14 00:07 | 2.4M | |
![[ ]](/icons/layout.gif) | 44237 TG Great Nash ..> | 2025-03-14 00:07 | 3.1M | |
![[ ]](/icons/layout.gif) | 44236 TG Drefach Far..> | 2025-03-14 00:07 | 2.0M | |
![[ ]](/icons/layout.gif) | 44230 TG Wallog.pdf | 2025-03-14 00:07 | 1.0M | |
![[ ]](/icons/layout.gif) | 44223 TG Hazelwell H..> | 2025-03-14 00:07 | 1.7M | |
![[ ]](/icons/layout.gif) | 44229 Tynant Farm.pdf | 2025-03-14 00:07 | 3.9M | |
![[ ]](/icons/layout.gif) | 44222 TG Gelliddewi ..> | 2025-03-14 00:07 | 2.4M | |
![[ ]](/icons/layout.gif) | 44213 TG Penlan.pdf | 2025-03-14 00:07 | 1.7M | |
![[ ]](/icons/layout.gif) | 44211 TG Pentwyn Mwy..> | 2025-03-14 00:07 | 1.1M | |
![[ ]](/icons/layout.gif) | 44208 TG Cwrtygollen..> | 2025-03-14 00:07 | 1.6M | |
![[ ]](/icons/layout.gif) | 44204 TG Allt Nant y..> | 2025-03-14 00:07 | 2.2M | |
![[ ]](/icons/layout.gif) | 44179 TG North Down ..> | 2025-03-14 00:07 | 2.3M | |
![[ ]](/icons/layout.gif) | 44176 TG Cilrath Fac..> | 2025-03-14 00:07 | 2.3M | |
![[ ]](/icons/layout.gif) | 44175 Parc Twad Call..> | 2025-03-14 00:07 | 1.4M | |
![[ ]](/icons/layout.gif) | 44174 Pantargamddwr ..> | 2025-03-14 00:07 | 219K | |
![[ ]](/icons/layout.gif) | 44166 TG Talwrn Coch..> | 2025-03-14 00:07 | 770K | |
![[ ]](/icons/layout.gif) | 44172 TG Geufron HE2..> | 2025-03-14 00:07 | 3.3M | |
![[ ]](/icons/layout.gif) | 44159 TG Rosecastle ..> | 2025-03-14 00:07 | 2.4M | |
![[ ]](/icons/layout.gif) | 44165 TG Cefn-Gweiro..> | 2025-03-14 00:07 | 5.6M | |
![[ ]](/icons/layout.gif) | 44131 TG Tynygraig.pdf | 2025-03-14 00:07 | 2.8M | |
![[ ]](/icons/layout.gif) | 44138 TG Nantyrodyn..> | 2025-03-14 00:07 | 5.0M | |
![[ ]](/icons/layout.gif) | 44130 TG Glangors.pdf | 2025-03-14 00:07 | 1.6M | |
![[ ]](/icons/layout.gif) | 44128 TG Morfa Ganol..> | 2025-03-14 00:07 | 1.3M | |
![[ ]](/icons/layout.gif) | 44125 TG Pantrofyn.pdf | 2025-03-14 00:07 | 2.2M | |
![[ ]](/icons/layout.gif) | 44125 TG Pantyrofyn.pdf | 2025-03-14 00:07 | 3.1M | |
![[ ]](/icons/layout.gif) | 44121 TG Rhiwgraidd.pdf | 2025-03-14 00:07 | 757K | |
![[ ]](/icons/layout.gif) | 44123 TG Alltfawr.pdf | 2025-03-14 00:07 | 4.2M | |
![[ ]](/icons/layout.gif) | 44111 TG Bee Hall Fa..> | 2025-03-14 00:07 | 2.0M | |
![[ ]](/icons/layout.gif) | 44108 TG Gurnos.pdf | 2025-03-14 00:07 | 2.8M | |
![[ ]](/icons/layout.gif) | 44109 TG Gilfach.pdf | 2025-03-14 00:07 | 3.0M | |
![[ ]](/icons/layout.gif) | 44107 TG Mandinam.pdf | 2025-03-14 00:07 | 2.3M | |
![[ ]](/icons/layout.gif) | 44102 TG Hafod.pdf | 2025-03-14 00:07 | 2.7M | |
![[ ]](/icons/layout.gif) | 44100 TG Blaenau Far..> | 2025-03-14 00:07 | 1.9M | |
![[ ]](/icons/layout.gif) | 44098 TG Pantau.pdf | 2025-03-14 00:07 | 2.1M | |
![[ ]](/icons/layout.gif) | 43926 Burials at Nar..> | 2025-03-14 00:07 | 864K | |
![[ ]](/icons/layout.gif) | 43925 Lydstep Palace..> | 2025-03-14 00:07 | 4.9M | |
![[ ]](/icons/layout.gif) | 43826 Wesley Chapel,..> | 2025-03-14 00:07 | 474K | |
![[ ]](/icons/layout.gif) | 43824 Carmarthen Cas..> | 2025-03-14 00:07 | 3.2M | |
![[ ]](/icons/layout.gif) | 43823 Carmarthen Cas..> | 2025-03-14 00:07 | 262K | |
![[ ]](/icons/layout.gif) | 43822 Carmarthen Cas..> | 2025-03-14 00:07 | 965K | |
![[ ]](/icons/layout.gif) | 43821 Carmarthen Cas..> | 2025-03-14 00:07 | 1.4M | |
![[ ]](/icons/layout.gif) | 43611 The Mount, Car..> | 2025-03-14 00:07 | 778K | |
![[ ]](/icons/layout.gif) | 43600 Prehistoric Fu..> | 2025-03-14 00:07 | 2.4M | |
![[ ]](/icons/layout.gif) | 43924 Milford Haven ..> | 2025-03-14 00:07 | 24M | |
![[ ]](/icons/compressed.gif) | 43600 PFRS EAST CARM..> | 2025-03-14 00:07 | 11M | |
![[ ]](/icons/layout.gif) | 43590 Hafod Stable C..> | 2025-03-14 00:07 | 1.9M | |
![[ ]](/icons/layout.gif) | 43582 6 And 7 Picton..> | 2025-03-14 00:07 | 841K | |
![[ ]](/icons/layout.gif) | 43521 Llangranog Sew..> | 2025-03-14 00:07 | 2.7M | |
![[ ]](/icons/layout.gif) | 43600 PFRS EAST CARM..> | 2025-03-14 00:07 | 9.6M | |
![[ ]](/icons/layout.gif) | 43520 Land Adjacent ..> | 2025-03-14 00:07 | 762K | |
![[ ]](/icons/layout.gif) | 43291 A477 Nash - Ba..> | 2025-03-14 00:07 | 907K | |
![[ ]](/icons/layout.gif) | 43342 Castle Pill, M..> | 2025-03-14 00:07 | 3.0M | |
![[ ]](/icons/layout.gif) | 43289 Broadmoor Sewe..> | 2025-03-14 00:07 | 1.5M | |
![[ ]](/icons/layout.gif) | 43290 Pentrellwyn Se..> | 2025-03-14 00:07 | 1.6M | |
![[ ]](/icons/layout.gif) | 43257 The Redevelomp..> | 2025-03-14 00:07 | 716K | |
![[ ]](/icons/layout.gif) | 43254 Carmarthen Cas..> | 2025-03-14 00:07 | 1.5M | |
![[ ]](/icons/layout.gif) | 43253 A structural A..> | 2025-03-14 00:07 | 1.2M | |
![[ ]](/icons/layout.gif) | 43252 Report On The ..> | 2025-03-14 00:07 | 1.2M | |
![[ ]](/icons/layout.gif) | 43253 A structural A..> | 2025-03-14 00:07 | 2.8M | |
![[ ]](/icons/layout.gif) | 43251 Ty Mawr, Porth..> | 2025-03-14 00:07 | 748K | |
![[ ]](/icons/layout.gif) | 43250 Wiston Castle ..> | 2025-03-14 00:07 | 2.7M | |
![[ ]](/icons/layout.gif) | 43145 Ty-Canol, Newp..> | 2025-03-14 00:07 | 4.1M | |
![[ ]](/icons/layout.gif) | 43143 Camddwr Wind E..> | 2025-03-14 00:07 | 10M | |
![[ ]](/icons/layout.gif) | 43101 A477(T)Sagesto..> | 2025-03-14 00:07 | 6.4M | |
![[ ]](/icons/layout.gif) | 42960 St Ismaels Chu..> | 2025-03-14 00:07 | 1.0M | |
![[ ]](/icons/layout.gif) | 42960 St Ismael's Ch..> | 2025-03-14 00:07 | 1.0M | |
![[ ]](/icons/layout.gif) | 42956 Pembrey Region..> | 2025-03-14 00:07 | 1.7M | |
![[ ]](/icons/layout.gif) | 42750 Arch. Excavati..> | 2025-03-14 00:07 | 1.6M | |
![[ ]](/icons/layout.gif) | 42750 Arch. Excavati..> | 2025-03-14 00:07 | 1.6M | |
![[ ]](/icons/layout.gif) | 42687 Clarach Bay, L..> | 2025-03-14 00:07 | 1.3M | |
![[ ]](/icons/layout.gif) | 42685 Capel Iwan Cru..> | 2025-03-14 00:07 | 716K | |
![[ ]](/icons/layout.gif) | 42706 Pontyates To B..> | 2025-03-14 00:07 | 5.1M | |
![[ ]](/icons/layout.gif) | 42679 Dawn Pac Ltd, ..> | 2025-03-14 00:07 | 1.2M | |
![[ ]](/icons/layout.gif) | 42641 Carmarthen Cas..> | 2025-03-14 00:07 | 1.8M | |
![[ ]](/icons/layout.gif) | 42638 Mynydd y Ffynn..> | 2025-03-14 00:07 | 2.1M | |
![[ ]](/icons/layout.gif) | 42641 Carmarthen Cas..> | 2025-03-14 00:07 | 14M | |
![[ ]](/icons/layout.gif) | 42599 Park Hall Arch..> | 2025-03-14 00:07 | 2.1M | |
![[ ]](/icons/layout.gif) | 42599 Park Hall Arch..> | 2025-03-14 00:07 | 1.8M | |
![[ ]](/icons/layout.gif) | 42560 Cambrian Mills..> | 2025-03-14 00:07 | 3.6M | |
![[ ]](/icons/layout.gif) | 42600 HLC Preseli St..> | 2025-03-14 00:07 | 14M | |
![[ ]](/icons/layout.gif) | 42560 Cambrian Mills..> | 2025-03-14 00:07 | 2.8M | |
![[ ]](/icons/layout.gif) | 42560 Cambrian Mills..> | 2025-03-14 00:07 | 1.1M | |
![[ ]](/icons/layout.gif) | 42560 Cambrian Mills..> | 2025-03-14 00:07 | 2.2M | |
![[ ]](/icons/layout.gif) | 42560 Cambrian Mills..> | 2025-03-14 00:07 | 1.3M | |
![[ ]](/icons/layout.gif) | 42559 Industrial Lan..> | 2025-03-14 00:07 | 467K | |
![[ ]](/icons/layout.gif) | 42534 Talley-Manorde..> | 2025-03-14 00:07 | 3.0M | |
![[ ]](/icons/layout.gif) | 42533 St Ishmaels Ch..> | 2025-03-14 00:07 | 1.3M | |
![[ ]](/icons/layout.gif) | 42533 St Ishmael's C..> | 2025-03-14 00:07 | 1.3M | |
![[ ]](/icons/layout.gif) | 42465 Land at Capel ..> | 2025-03-14 00:07 | 745K | |
![[ ]](/icons/layout.gif) | 42464 Sewer Scheme B..> | 2025-03-14 00:07 | 1.5M | |
![[ ]](/icons/layout.gif) | 42378 Treffgarne Ben..> | 2025-03-14 00:07 | 2.5M | |
![[ ]](/icons/layout.gif) | 42305 St Elidyrs Chu..> | 2025-03-14 00:07 | 408K | |
![[ ]](/icons/layout.gif) | 42305 St Elidyr's Ch..> | 2025-03-14 00:07 | 408K | |
![[ ]](/icons/layout.gif) | 42233 Carmarthen Cas..> | 2025-03-14 00:07 | 857K | |
![[ ]](/icons/layout.gif) | 42503 PFRS WEST CARM..> | 2025-03-14 00:07 | 11M | |
![[ ]](/icons/layout.gif) | 42233 Carmarthen Cas..> | 2025-03-14 00:07 | 968K | |
![[ ]](/icons/layout.gif) | 41843 TG Cae Iago.pdf | 2025-03-14 00:07 | 1.6M | |
![[ ]](/icons/layout.gif) | 42231 Report On The ..> | 2025-03-14 00:07 | 4.0M | |
![[ ]](/icons/layout.gif) | 41843 TG Cae Iago Ca..> | 2025-03-14 00:07 | 315K | |
![[ ]](/icons/layout.gif) | 41821 TG Garn Farm.pdf | 2025-03-14 00:07 | 1.1M | |
![[ ]](/icons/layout.gif) | 41817 TG Berlouwin.pdf | 2025-03-14 00:07 | 1.7M | |
![[ ]](/icons/layout.gif) | 41812 TG Waun Fawr.pdf | 2025-03-14 00:07 | 3.4M | |
![[ ]](/icons/layout.gif) | 41807 TG Dolaucothi.pdf | 2025-03-14 00:07 | 4.7M | |
![[ ]](/icons/layout.gif) | 41802 TG Glasallt Fa..> | 2025-03-14 00:07 | 719K | |
![[ ]](/icons/layout.gif) | 41808 TG Gwarglwydet..> | 2025-03-14 00:07 | 7.0M | |
![[ ]](/icons/layout.gif) | 41760 TG Pwllaur Eur..> | 2025-03-14 00:07 | 2.8M | |
![[ ]](/icons/layout.gif) | 41760 TG Pwllau'r Eu..> | 2025-03-14 00:07 | 2.8M | |
![[ ]](/icons/layout.gif) | 41759 Bryn Y Cadno.pdf | 2025-03-14 00:07 | 1.5M | |
![[ ]](/icons/layout.gif) | 41730 TG Fron Farm.pdf | 2025-03-14 00:07 | 2.3M | |
![[ ]](/icons/layout.gif) | 41743 TG Nanthenfoel..> | 2025-03-14 00:07 | 3.2M | |
![[ ]](/icons/layout.gif) | 41729 TG Babiog.pdf | 2025-03-14 00:07 | 844K | |
![[ ]](/icons/layout.gif) | 41719 TG Ynysforgan.pdf | 2025-03-14 00:07 | 712K | |
![[ ]](/icons/layout.gif) | 41722 TG Parc Cynog ..> | 2025-03-14 00:07 | 2.5M | |
![[ ]](/icons/layout.gif) | 41712 TG Lletty Ifan..> | 2025-03-14 00:07 | 1.6M | |
![[ ]](/icons/layout.gif) | 41710 TG Llwyncolfa ..> | 2025-03-14 00:07 | 3.8M | |
![[ ]](/icons/layout.gif) | 41708 TG Castle Hill..> | 2025-03-14 00:07 | 2.9M | |
![[ ]](/icons/layout.gif) | 41706 TG Brithdir.pdf | 2025-03-14 00:07 | 1.5M | |
![[ ]](/icons/layout.gif) | 41702 TG Treprior Fa..> | 2025-03-14 00:07 | 950K | |
![[ ]](/icons/layout.gif) | 41703 TG Gwernant Ho..> | 2025-03-14 00:07 | 3.2M | |
![[ ]](/icons/layout.gif) | 41691 TG Brynele Cal..> | 2025-03-14 00:07 | 185K | |
![[ ]](/icons/layout.gif) | 41691 TG Brynele Hom..> | 2025-03-14 00:07 | 2.2M | |
![[ ]](/icons/layout.gif) | 41690 TG Glanrheidol..> | 2025-03-14 00:07 | 1.4M | |
![[ ]](/icons/layout.gif) | 41673 TG Pantyffynno..> | 2025-03-14 00:07 | 1.1M | |
![[ ]](/icons/layout.gif) | 41670 TG Bachygwyddi..> | 2025-03-14 00:07 | 1.4M | |
![[ ]](/icons/layout.gif) | 41662 TG Syddyn-Meli..> | 2025-03-14 00:07 | 316K | |
![[ ]](/icons/layout.gif) | 41664 TG Crud Yr Awe..> | 2025-03-14 00:07 | 896K | |
![[ ]](/icons/layout.gif) | 41642 TG Bowett Farm..> | 2025-03-14 00:07 | 3.4M | |
![[ ]](/icons/layout.gif) | 41641 Tir Gofal Farm..> | 2025-03-14 00:07 | 2.0M | |
![[ ]](/icons/layout.gif) | 41639 TG Capeston.pdf | 2025-03-14 00:07 | 3.6M | |
![[ ]](/icons/layout.gif) | 41636 TG Cleggars Fa..> | 2025-03-14 00:07 | 636K | |
![[ ]](/icons/layout.gif) | 41638 TG Carnachenwe..> | 2025-03-14 00:07 | 3.6M | |
![[ ]](/icons/layout.gif) | 41625 TG Upper Cowsl..> | 2025-03-14 00:07 | 1.5M | |
![[ ]](/icons/layout.gif) | 41629 TG Fferm Tresi..> | 2025-03-14 00:07 | 1.8M | |
![[ ]](/icons/layout.gif) | 41607 TG Rogershook.pdf | 2025-03-14 00:07 | 1.0M | |
![[ ]](/icons/layout.gif) | 41609 TG Pentwd Ucha..> | 2025-03-14 00:07 | 1.7M | |
![[ ]](/icons/layout.gif) | 41605 TG Rosehill Fa..> | 2025-03-14 00:07 | 590K | |
![[ ]](/icons/layout.gif) | 41599 TG Horse Park.pdf | 2025-03-14 00:07 | 557K | |
![[ ]](/icons/layout.gif) | 41598 TG Kilanow.pdf | 2025-03-14 00:07 | 967K | |
![[ ]](/icons/layout.gif) | 41594 TG Llangwathen..> | 2025-03-14 00:07 | 2.4M | |
![[ ]](/icons/layout.gif) | 41587 TG Moor Farm.pdf | 2025-03-14 00:07 | 2.1M | |
![[ ]](/icons/layout.gif) | 41585 TG Penback.pdf | 2025-03-14 00:07 | 1.5M | |
![[ ]](/icons/layout.gif) | 41581 TG Ffynnone 41..> | 2025-03-14 00:07 | 573K | |
![[ ]](/icons/layout.gif) | 41531 Ffynnon-dderw ..> | 2025-03-14 00:07 | 137K | |
![[ ]](/icons/layout.gif) | 41541 TG Tre Gynan I..> | 2025-03-14 00:07 | 2.2M | |
![[ ]](/icons/layout.gif) | 41530 TG Tyn Y Fron.pdf | 2025-03-14 00:07 | 1.2M | |
![[ ]](/icons/layout.gif) | 41484 TG Cnwc Call O..> | 2025-03-14 00:07 | 699K | |
![[ ]](/icons/layout.gif) | 41483 TG Pwllcymbyd.pdf | 2025-03-14 00:07 | 1.5M | |
![[ ]](/icons/layout.gif) | 41482 TG Bryndais.pdf | 2025-03-14 00:07 | 1.4M | |
![[ ]](/icons/layout.gif) | 41474 Penlan Wood He..> | 2025-03-14 00:07 | 1.1M | |
![[ ]](/icons/layout.gif) | 41473 New Floodlight..> | 2025-03-14 00:07 | 670K | |
![[ ]](/icons/layout.gif) | 41413 TG Parce Call ..> | 2025-03-14 00:07 | 972K | |
![[ ]](/icons/layout.gif) | 41368 St Peters Chur..> | 2025-03-14 00:07 | 4.2M | |
![[ ]](/icons/layout.gif) | 41368 St Peter's Chu..> | 2025-03-14 00:07 | 4.2M | |
![[ ]](/icons/layout.gif) | 41367 Cwm Berwyn & T..> | 2025-03-14 00:07 | 1.2M | |
![[ ]](/icons/layout.gif) | 41364 Arch Eval. Lle..> | 2025-03-14 00:07 | 729K | |
![[ ]](/icons/layout.gif) | 41361 Pen-y-Maen Pro..> | 2025-03-14 00:07 | 1.6M | |
![[ ]](/icons/layout.gif) | 41365 Llanelli Marsh..> | 2025-03-14 00:07 | 4.1M | |
![[ ]](/icons/layout.gif) | 41035 Archaeological..> | 2025-03-14 00:07 | 1.3M | |
![[ ]](/icons/layout.gif) | 40914 Lampeter CSO L..> | 2025-03-14 00:07 | 273K | |
![[ ]](/icons/layout.gif) | 40913 Fieldwork At G..> | 2025-03-14 00:07 | 750K | |
![[ ]](/icons/layout.gif) | 41072 An Arch. Inves..> | 2025-03-14 00:07 | 4.9M | |
![[ ]](/icons/layout.gif) | 40912 Parc Cynog Win..> | 2025-03-14 00:07 | 164K | |
![[ ]](/icons/layout.gif) | 40762 Pontyates to B..> | 2025-03-14 00:07 | 4.1M | |
![[ ]](/icons/layout.gif) | 40762 Pontiets To Ba..> | 2025-03-14 00:07 | 3.9M | |
![[ ]](/icons/layout.gif) | 40600 St Johns Churc..> | 2025-03-14 00:07 | 593K | |
![[ ]](/icons/layout.gif) | 40600 St John's Chur..> | 2025-03-14 00:07 | 593K | |
![[ ]](/icons/layout.gif) | 40475 TG Derlwyn.pdf | 2025-03-14 00:07 | 1.3M | |
![[ ]](/icons/layout.gif) | 40467 TG Blaengorlec..> | 2025-03-14 00:07 | 1.7M | |
![[ ]](/icons/layout.gif) | 40456 TG Trecadwgan ..> | 2025-03-14 00:07 | 1.6M | |
![[ ]](/icons/layout.gif) | 40454 TG Dolgoch Far..> | 2025-03-14 00:07 | 1.2M | |
![[ ]](/icons/layout.gif) | 40447 TG Llwynywormw..> | 2025-03-14 00:07 | 2.2M | |
![[ ]](/icons/layout.gif) | 40499 Talley Histori..> | 2025-03-14 00:07 | 9.9M | |
![[ ]](/icons/layout.gif) | 40446 TG Nantyfen Fa..> | 2025-03-14 00:07 | 1.8M | |
![[ ]](/icons/layout.gif) | 40442 TG Llystyn.pdf | 2025-03-14 00:07 | 1.0M | |
![[ ]](/icons/layout.gif) | 40442 TG LLystyn cal..> | 2025-03-14 00:07 | 886K | |
![[ ]](/icons/layout.gif) | 40436 TG Pengelli.pdf | 2025-03-14 00:07 | 1.9M | |
![[ ]](/icons/layout.gif) | 40435 TG Plas-Y-Bryn..> | 2025-03-14 00:07 | 2.4M | |
![[ ]](/icons/layout.gif) | 40431 TG Moelgolomen..> | 2025-03-14 00:07 | 1.1M | |
![[ ]](/icons/layout.gif) | 40421 TG Pontfaen Fa..> | 2025-03-14 00:07 | 3.0M | |
![[ ]](/icons/layout.gif) | 40414 TG Crug y Whil..> | 2025-03-14 00:07 | 2.0M | |
![[ ]](/icons/layout.gif) | 40413 TG Pen Y Graig..> | 2025-03-14 00:07 | 1.5M | |
![[ ]](/icons/layout.gif) | 40407 TG Lanlas.pdf | 2025-03-14 00:07 | 1.3M | |
![[ ]](/icons/layout.gif) | 40400 TG Glynhenlla..> | 2025-03-14 00:07 | 1.9M | |
![[ ]](/icons/layout.gif) | 40398 Cattle Mart Si..> | 2025-03-14 00:07 | 4.9M | |
![[ ]](/icons/layout.gif) | 40379 Llanfihangel R..> | 2025-03-14 00:07 | 5.1M | |
![[ ]](/icons/layout.gif) | 40374 New 90mm Water..> | 2025-03-14 00:07 | 413K | |
![[ ]](/icons/layout.gif) | 40373 Carms HLC Vol ..> | 2025-03-14 00:08 | 13M | |
![[ ]](/icons/layout.gif) | 40362 A40 Fishguard ..> | 2025-03-14 00:08 | 3.3M | |
![[ ]](/icons/layout.gif) | 40266 Stage 4 Watchi..> | 2025-03-14 00:08 | 1.7M | |
![[ ]](/icons/layout.gif) | 40373 Carms HLC Blac..> | 2025-03-14 00:08 | 19M | |
![[ ]](/icons/layout.gif) | 40164 Pen-Y-Maen Pro..> | 2025-03-14 00:08 | 431K | |
![[ ]](/icons/layout.gif) | 40265 Industrial Lan..> | 2025-03-14 00:08 | 2.8M | |
![[ ]](/icons/layout.gif) | 39946 Glynea Collier..> | 2025-03-14 00:08 | 2.7M | |
![[ ]](/icons/layout.gif) | 40000 Talley-Maenord..> | 2025-03-14 00:08 | 3.8M | |
![[ ]](/icons/layout.gif) | 39945 Torcoed Quarry..> | 2025-03-14 00:08 | 411K | |
![[ ]](/icons/layout.gif) | 39944 Water Main Ren..> | 2025-03-14 00:08 | 645K | |
![[ ]](/icons/layout.gif) | 39866 TG Norton Farm..> | 2025-03-14 00:08 | 3.2M | |
![[ ]](/icons/layout.gif) | 39868 TG Ciliau Gano..> | 2025-03-14 00:08 | 4.3M | |
![[ ]](/icons/layout.gif) | 39864 TG Lower Hopsh..> | 2025-03-14 00:08 | 1.4M | |
![[ ]](/icons/layout.gif) | 39860 TG Caldey.pdf | 2025-03-14 00:08 | 2.8M | |
![[ ]](/icons/layout.gif) | 39859 TG Penddol Far..> | 2025-03-14 00:08 | 1.9M | |
![[ ]](/icons/layout.gif) | 39858 TG Gorsddu Far..> | 2025-03-14 00:08 | 904K | |
![[ ]](/icons/layout.gif) | 39854 TG Ynysgreigio..> | 2025-03-14 00:08 | 1.4M | |
![[ ]](/icons/layout.gif) | 39849 TG Whitmoor Fa..> | 2025-03-14 00:08 | 480K | |
![[ ]](/icons/layout.gif) | 39850 TG National Bo..> | 2025-03-14 00:08 | 5.7M | |
![[ ]](/icons/layout.gif) | 39844 TG Picton Cast..> | 2025-03-14 00:08 | 509K | |
![[ ]](/icons/layout.gif) | 39842 TG Glancynin.pdf | 2025-03-14 00:08 | 1.6M | |
![[ ]](/icons/layout.gif) | 39848 TG Carters Gre..> | 2025-03-14 00:08 | 6.5M | |
![[ ]](/icons/layout.gif) | 39841 TG Tir Cwrt.pdf | 2025-03-14 00:08 | 376K | |
![[ ]](/icons/layout.gif) | 39841 TG Cwrt Call O..> | 2025-03-14 00:08 | 1.3K | |
![[ ]](/icons/layout.gif) | 39486 TG Blossom Far..> | 2025-03-14 00:08 | 1.4M | |
![[ ]](/icons/layout.gif) | 39477 TG Cilgell Uch..> | 2025-03-14 00:08 | 1.7M | |
![[ ]](/icons/layout.gif) | 39470 TG Felindre, M..> | 2025-03-14 00:08 | 467K | |
![[ ]](/icons/layout.gif) | 39476 TG Penyrallt H..> | 2025-03-14 00:08 | 1.9M | |
![[ ]](/icons/layout.gif) | 39469 TG Pantyfen.pdf | 2025-03-14 00:08 | 2.3M | |
![[ ]](/icons/layout.gif) | 39469 T.G. Farm Visi..> | 2025-03-14 00:08 | 1.3M | |
![[ ]](/icons/layout.gif) | 39468 TG Edwinsford ..> | 2025-03-14 00:08 | 2.5M | |
![[ ]](/icons/layout.gif) | 39463 TG Lecha.pdf | 2025-03-14 00:08 | 2.3M | |
![[ ]](/icons/layout.gif) | 39460 TG Merryboroug..> | 2025-03-14 00:08 | 498K | |
![[ ]](/icons/layout.gif) | 39457 TG Broniwan.pdf | 2025-03-14 00:08 | 945K | |
![[ ]](/icons/layout.gif) | 39448 TG Home Farm.pdf | 2025-03-14 00:08 | 204K | |
![[ ]](/icons/layout.gif) | 39437 TG Danllan.pdf | 2025-03-14 00:08 | 1.1M | |
![[ ]](/icons/layout.gif) | 39432 TG Esgairgraig..> | 2025-03-14 00:08 | 1.7M | |
![[ ]](/icons/layout.gif) | 39436 TG Clyngwyn.pdf | 2025-03-14 00:08 | 3.2M | |
![[ ]](/icons/layout.gif) | 39429 TG Fachongle G..> | 2025-03-14 00:08 | 1.3M | |
![[ ]](/icons/layout.gif) | 39428 TG Trefayog.pdf | 2025-03-14 00:08 | 1.2M | |
![[ ]](/icons/layout.gif) | 39422 TG Boulston Ma..> | 2025-03-14 00:08 | 1.5M | |
![[ ]](/icons/layout.gif) | 39421 TG Brownslate ..> | 2025-03-14 00:08 | 1.5M | |
![[ ]](/icons/layout.gif) | 39420 TG Bryn Farm.pdf | 2025-03-14 00:08 | 651K | |
![[ ]](/icons/layout.gif) | 39418 Tir Gofal Farm..> | 2025-03-14 00:08 | 917K | |
![[ ]](/icons/layout.gif) | 39418 TG Brynteg.pdf | 2025-03-14 00:08 | 869K | |
![[ ]](/icons/layout.gif) | 39419 Ystrad Lead Mi..> | 2025-03-14 00:08 | 4.7M | |
![[ ]](/icons/layout.gif) | 39406_AnUplandGlossa..> | 2025-03-14 00:08 | 1.6M | |
![[ ]](/icons/layout.gif) | 39331 TG Gilfach Y B..> | 2025-03-14 00:08 | 1.1M | |
![[ ]](/icons/layout.gif) | 39406 Review Of Upla..> | 2025-03-14 00:08 | 3.5M | |
![[ ]](/icons/layout.gif) | 39320 TG Craig Y Bor..> | 2025-03-14 00:08 | 597K | |
![[ ]](/icons/layout.gif) | 39325 TG Llanio Fawr..> | 2025-03-14 00:08 | 1.1M | |
![[ ]](/icons/layout.gif) | 39315 TG Maesllyn.pdf | 2025-03-14 00:08 | 1.0M | |
![[ ]](/icons/layout.gif) | 39300 TG Salthouse.pdf | 2025-03-14 00:08 | 1.8M | |
![[ ]](/icons/layout.gif) | 39283 TG Causeway Fa..> | 2025-03-14 00:08 | 1.3M | |
![[ ]](/icons/layout.gif) | 39168 Land At High S..> | 2025-03-14 00:08 | 2.7M | |
![[ ]](/icons/layout.gif) | 39151 TG Benglog.pdf | 2025-03-14 00:08 | 623K | |
![[ ]](/icons/layout.gif) | 39178 St Dogmeals Hi..> | 2025-03-14 00:08 | 7.5M | |
![[ ]](/icons/layout.gif) | 39133 TG Norchard Fa..> | 2025-03-14 00:08 | 1.2M | |
![[ ]](/icons/layout.gif) | 39134 Amman Valley S..> | 2025-03-14 00:08 | 4.2M | |
![[ ]](/icons/layout.gif) | 39116 Lidl Foodstore..> | 2025-03-14 00:08 | 2.0M | |
![[ ]](/icons/layout.gif) | 39114 Pembroke Power..> | 2025-03-14 00:08 | 1.5M | |
![[ ]](/icons/layout.gif) | 39100 TG Bwlch Cefn ..> | 2025-03-14 00:08 | 869K | |
![[ ]](/icons/layout.gif) | 39110 TG Mwche Farm.pdf | 2025-03-14 00:08 | 1.5M | |
![[ ]](/icons/layout.gif) | 39091 TG Big House.pdf | 2025-03-14 00:08 | 1.1M | |
![[ ]](/icons/layout.gif) | 39041 TG Blaenwaun G..> | 2025-03-14 00:08 | 862K | |
![[ ]](/icons/layout.gif) | 39019 Llansawel-Tall..> | 2025-03-14 00:08 | 2.2M | |
![[ ]](/icons/layout.gif) | 39018 Cwm-Ifor-Maeno..> | 2025-03-14 00:08 | 1.1M | |
![[ ]](/icons/layout.gif) | 39020 TG Llanllyr.pdf | 2025-03-14 00:08 | 5.6M | |
![[ ]](/icons/layout.gif) | 39006 Blaen Bowi, Ce..> | 2025-03-14 00:08 | 1.4M | |
![[ ]](/icons/layout.gif) | 38909 TG Scamford Fa..> | 2025-03-14 00:08 | 676K | |
![[ ]](/icons/layout.gif) | 38907 TG South Studd..> | 2025-03-14 00:08 | 1.1M | |
![[ ]](/icons/layout.gif) | 38906 TG Kilgetty Fa..> | 2025-03-14 00:08 | 4.7M | |
![[ ]](/icons/layout.gif) | 38882 Historical Set..> | 2025-03-14 00:08 | 3.3M | |
![[ ]](/icons/layout.gif) | 38755 Saundersfoot S..> | 2025-03-14 00:08 | 4.8M | |
![[ ]](/icons/layout.gif) | 38756 Milford Haven ..> | 2025-03-14 00:08 | 5.1M | |
![[ ]](/icons/layout.gif) | 38753 Porthclew Sett..> | 2025-03-14 00:08 | 469K | |
![[ ]](/icons/layout.gif) | 38754 Little Haven S..> | 2025-03-14 00:08 | 1.2M | |
![[ ]](/icons/layout.gif) | 38752 Caldy Island S..> | 2025-03-14 00:08 | 3.3M | |
![[ ]](/icons/layout.gif) | 38750 Solva Settleme..> | 2025-03-14 00:08 | 1.6M | |
![[ ]](/icons/layout.gif) | 38751 Porthgain Sett..> | 2025-03-14 00:08 | 6.1M | |
![[ ]](/icons/layout.gif) | 38749 Manorbier Sett..> | 2025-03-14 00:08 | 1.6M | |
![[ ]](/icons/layout.gif) | 38748 Trefin Settlem..> | 2025-03-14 00:08 | 1.9M | |
![[ ]](/icons/layout.gif) | 38747 Angle Settleme..> | 2025-03-14 00:08 | 1.7M | |
![[ ]](/icons/layout.gif) | 38345 Llansawel-Tall..> | 2025-03-14 00:08 | 2.3M | |
![[ ]](/icons/layout.gif) | 38285 Friars Park, ..> | 2025-03-14 00:08 | 240K | |
![[ ]](/icons/layout.gif) | 38285 Friar's Park,..> | 2025-03-14 00:08 | 240K | |
![[ ]](/icons/layout.gif) | 38344 CwmIfor - Maen..> | 2025-03-14 00:08 | 3.1M | |
![[ ]](/icons/layout.gif) | 37960 Great Castle H..> | 2025-03-14 00:08 | 492K | |
![[ ]](/icons/layout.gif) | 37960 Great Castle H..> | 2025-03-14 00:08 | 3.8M | |
![[ ]](/icons/layout.gif) | 37752 Mynydd Mallaen..> | 2025-03-14 00:08 | 835K | |
![[ ]](/icons/layout.gif) | 37756_DesertedRuralS..> | 2025-03-14 00:08 | 5.1M | |
![[ ]](/icons/layout.gif) | 37703 TG Blaenblodau..> | 2025-03-14 00:08 | 4.2M | |
![[ ]](/icons/layout.gif) | 37702 TG Cwmbach Far..> | 2025-03-14 00:08 | 2.1M | |
![[ ]](/icons/layout.gif) | 37673 Priory Street,..> | 2025-03-14 00:08 | 634K | |
![[ ]](/icons/layout.gif) | 37703 TG Blaenblodau..> | 2025-03-14 00:08 | 4.8M | |
![[ ]](/icons/layout.gif) | 37601 TG Bryn (Penyg..> | 2025-03-14 00:08 | 2.1M | |
![[ ]](/icons/layout.gif) | 37595 TG Ffosfach Uc..> | 2025-03-14 00:08 | 2.2M | |
![[ ]](/icons/layout.gif) | 37422 Machynys Golf ..> | 2025-03-14 00:08 | 1.4M | |
![[ ]](/icons/layout.gif) | 37421 Land adjacent..> | 2025-03-14 00:08 | 378K | |
![[ ]](/icons/layout.gif) | 37421 Land adjacent..> | 2025-03-14 00:08 | 378K | |
![[ ]](/icons/layout.gif) | 37420 North Carms-Ce..> | 2025-03-14 00:08 | 1.6M | |
![[ ]](/icons/layout.gif) | 37419 Fishguard Last..> | 2025-03-14 00:08 | 2.9M | |
![[ ]](/icons/layout.gif) | 37412 Boltonhill Qua..> | 2025-03-14 00:08 | 843K | |
![[ ]](/icons/layout.gif) | 37409 Glan Aur, Efai..> | 2025-03-14 00:08 | 423K | |
![[ ]](/icons/layout.gif) | 37408 Lampeter CSO S..> | 2025-03-14 00:08 | 724K | |
![[ ]](/icons/layout.gif) | 37405 Proposed Last ..> | 2025-03-14 00:08 | 1.4M | |
![[ ]](/icons/layout.gif) | 37400 Afon Bedw, Pen..> | 2025-03-14 00:08 | 740K | |
![[ ]](/icons/layout.gif) | 37400 Afon Bedw, Pen..> | 2025-03-14 00:08 | 1.4M | |
![[ ]](/icons/layout.gif) | 37395 Wogaston, Rhos..> | 2025-03-14 00:08 | 1.6M | |
![[ ]](/icons/layout.gif) | 37150 AP Mapping and..> | 2025-03-14 00:08 | 803K | |
![[ ]](/icons/layout.gif) | 37418 Land at Machyn..> | 2025-03-14 00:08 | 37M | |
![[ ]](/icons/layout.gif) | 37128 Angle Dovecote..> | 2025-03-14 00:08 | 1.6M | |
![[ ]](/icons/layout.gif) | 37115 Pill Priory 19..> | 2025-03-14 00:08 | 868K | |
![[ ]](/icons/layout.gif) | 37102 The Mynydd Y F..> | 2025-03-14 00:08 | 3.8M | |
![[ ]](/icons/layout.gif) | 37100 Milford Haven ..> | 2025-03-14 00:08 | 11M | |
![[ ]](/icons/layout.gif) | 37149 Upland Ceredig..> | 2025-03-14 00:08 | 31M | |
![[ ]](/icons/layout.gif) | 37050 Hafod Mansion ..> | 2025-03-14 00:08 | 1.5M | |
![[ ]](/icons/layout.gif) | 37011 Whitland Abbey..> | 2025-03-14 00:08 | 463K | |
![[ ]](/icons/layout.gif) | 37050 Hafod Mansion ..> | 2025-03-14 00:08 | 13M | |
![[ ]](/icons/layout.gif) | 36950 The Mynydd Y F..> | 2025-03-14 00:08 | 9.0M | |
![[ ]](/icons/layout.gif) | 36920 Burry Port Har..> | 2025-03-14 00:08 | 5.3M | |
![[ ]](/icons/layout.gif) | 36920 Burry Port Har..> | 2025-03-14 00:08 | 2.4M | |
![[ ]](/icons/layout.gif) | 36888 No.1 Quay Stre..> | 2025-03-14 00:08 | 564K | |
![[ ]](/icons/layout.gif) | 36918 Hafod Archaeol..> | 2025-03-14 00:08 | 8.1M | |
![[ ]](/icons/layout.gif) | 36537 Pentre Ifan An..> | 2025-03-14 00:08 | 6.1M | |
![[ ]](/icons/layout.gif) | 36537 Pentre Ifan An..> | 2025-03-14 00:08 | 6.1M | |
![[ ]](/icons/layout.gif) | 36537 & 36246 Pentre..> | 2025-03-14 00:08 | 6.1M | |
![[ ]](/icons/layout.gif) | 36082 Castle Lakes H..> | 2025-03-14 00:08 | 156K | |
![[ ]](/icons/layout.gif) | 36333 TG Trefenty.pdf | 2025-03-14 00:08 | 1.3M | |
![[ ]](/icons/layout.gif) | 35948 A Preliminary ..> | 2025-03-14 00:08 | 1.8M | |
![[ ]](/icons/layout.gif) | 35915 Mynydd Y Ffynn..> | 2025-03-14 00:08 | 3.2M | |
![[ ]](/icons/layout.gif) | 35966 Mediaeval or L..> | 2025-03-14 00:08 | 9.2M | |
![[ ]](/icons/layout.gif) | 35904 Hafod Road Sys..> | 2025-03-14 00:08 | 8.5M | |
![[ ]](/icons/layout.gif) | 35903 Hafod An Archa..> | 2025-03-14 00:08 | 10M | |
![[ ]](/icons/layout.gif) | 35903 Hafod An Archa..> | 2025-03-14 00:08 | 10M | |
![[ ]](/icons/layout.gif) | 35896 Tror Delwyn Up..> | 2025-03-14 00:08 | 5.2M | |
![[ ]](/icons/layout.gif) | 35895 Bow Street - L..> | 2025-03-14 00:08 | 579K | |
![[ ]](/icons/layout.gif) | 35864 Whitland Abbey..> | 2025-03-14 00:08 | 1.3M | |
![[ ]](/icons/layout.gif) | 35852 Hafod - Cavern..> | 2025-03-14 00:08 | 2.7M | |
![[ ]](/icons/layout.gif) | 35851 A Pilot Assess..> | 2025-03-14 00:08 | 809K | |
![[ ]](/icons/layout.gif) | 35839 Coastal Survey..> | 2025-03-14 00:08 | 4.8M | |
![[ ]](/icons/layout.gif) | 35838 North Carms an..> | 2025-03-14 00:08 | 297K | |
![[ ]](/icons/layout.gif) | 35779 Air Photo Mapp..> | 2025-03-14 00:08 | 150K | |
![[ ]](/icons/layout.gif) | 35708 Battle Headqua..> | 2025-03-14 00:08 | 1.2M | |
![[ ]](/icons/layout.gif) | 35850 Hafof - Cae Gw..> | 2025-03-14 00:08 | 9.8M | |
![[ ]](/icons/layout.gif) | 35707 St Cristiolus'..> | 2025-03-14 00:08 | 4.0M | |
![[ ]](/icons/layout.gif) | 35707 St Cristiolus ..> | 2025-03-14 00:08 | 4.0M | |
![[ ]](/icons/layout.gif) | 35706 The Box, Adpar..> | 2025-03-14 00:08 | 678K | |
![[ ]](/icons/layout.gif) | 35604 The Limekiln, ..> | 2025-03-14 00:08 | 170K | |
![[ ]](/icons/layout.gif) | 35604 Stepaside Heri..> | 2025-03-14 00:08 | 2.2M | |
![[ ]](/icons/layout.gif) | 35605 Mediaeval Or L..> | 2025-03-14 00:08 | 4.8M | |
![[ ]](/icons/layout.gif) | 35510 Coed Maes Yr H..> | 2025-03-14 00:08 | 263K | |
![[ ]](/icons/layout.gif) | 35410 Porthgain - A ..> | 2025-03-14 00:08 | 10M | |
![[ ]](/icons/layout.gif) | 35465 An Archaeologi..> | 2025-03-14 00:08 | 13M | |
![[ ]](/icons/layout.gif) | 3539 St. Florence Ch..> | 2025-03-14 00:08 | 813K | |
![[ ]](/icons/layout.gif) | 35379 Stanleys Tramr..> | 2025-03-14 00:08 | 303K | |
![[ ]](/icons/layout.gif) | 35379 Stanleys Tramr..> | 2025-03-14 00:08 | 215K | |
![[ ]](/icons/layout.gif) | 35379 Stanley's Tram..> | 2025-03-14 00:08 | 215K | |
![[ ]](/icons/layout.gif) | 35377 Burnt Mounds o..> | 2025-03-14 00:08 | 2.6M | |
![[ ]](/icons/layout.gif) | 35410 Porthgain - A ..> | 2025-03-14 00:08 | 10M | |
![[ ]](/icons/layout.gif) | 35311 Coastal Survey..> | 2025-03-14 00:08 | 1.2M | |
![[ ]](/icons/layout.gif) | 35308 Roman Road Aer..> | 2025-03-14 00:08 | 119K | |
![[ ]](/icons/layout.gif) | 35310 Archaeological..> | 2025-03-14 00:08 | 2.3M | |
![[ ]](/icons/layout.gif) | 35307 A40(T) Robesto..> | 2025-03-14 00:08 | 395K | |
![[ ]](/icons/layout.gif) | 35247 Mynydd Y Ffynn..> | 2025-03-14 00:08 | 3.5M | |
![[ ]](/icons/layout.gif) | 35238 Extension To F..> | 2025-03-14 00:08 | 527K | |
![[ ]](/icons/layout.gif) | 35242 The Sea Empres..> | 2025-03-14 00:08 | 3.5M | |
![[ ]](/icons/layout.gif) | 35237 St Peter's Car..> | 2025-03-14 00:08 | 154K | |
![[ ]](/icons/layout.gif) | 35235 Carms Greyfria..> | 2025-03-14 00:08 | 182K | |
![[ ]](/icons/layout.gif) | 35235 Carmarthen Gre..> | 2025-03-14 00:08 | 4.2M | |
![[ ]](/icons/layout.gif) | 35235 Carmarthen Gre..> | 2025-03-14 00:08 | 2.7M | |
![[ ]](/icons/layout.gif) | 34954 A477 Trunk Roa..> | 2025-03-14 00:08 | 1.0M | |
![[ ]](/icons/layout.gif) | 34854 The Mynydd Y F..> | 2025-03-14 00:08 | 2.2M | |
![[ ]](/icons/layout.gif) | 34717 The Afon Teifi..> | 2025-03-14 00:08 | 396K | |
![[ ]](/icons/layout.gif) | 35003 Coastal Survey..> | 2025-03-14 00:08 | 10M | |
![[ ]](/icons/layout.gif) | 34653 Lower Priory S..> | 2025-03-14 00:08 | 318K | |
![[ ]](/icons/layout.gif) | 34440 The Mynydd Y F..> | 2025-03-14 00:08 | 1.1M | |
![[ ]](/icons/layout.gif) | 34423 Travellers Res..> | 2025-03-14 00:08 | 310K | |
![[ ]](/icons/layout.gif) | 34654 Pilot Arch. & ..> | 2025-03-14 00:08 | 5.9M | |
![[ ]](/icons/layout.gif) | 34423 Traveller's Re..> | 2025-03-14 00:08 | 310K | |
![[ ]](/icons/layout.gif) | 34423 Proposed Grade..> | 2025-03-14 00:08 | 317K | |
![[ ]](/icons/layout.gif) | 34423 Proposed Grade..> | 2025-03-14 00:08 | 648K | |
![[ ]](/icons/layout.gif) | 34422 Dinefwr Castle..> | 2025-03-14 00:08 | 1.0M | |
![[ ]](/icons/layout.gif) | 33902 Roman Road Wes..> | 2025-03-14 00:08 | 689K | |
![[ ]](/icons/layout.gif) | 33715 Report On The ..> | 2025-03-14 00:08 | 4.7M | |
![[ ]](/icons/layout.gif) | 33713 1 Pont Y Cleif..> | 2025-03-14 00:08 | 906K | |
![[ ]](/icons/layout.gif) | 33488 Pill Priory, M..> | 2025-03-14 00:08 | 1.2M | |
![[ ]](/icons/layout.gif) | 33800 Gwaun Valley W..> | 2025-03-14 00:08 | 11M | |
![[ ]](/icons/layout.gif) | 33381 Newport Lower ..> | 2025-03-14 00:08 | 384K | |
![[ ]](/icons/layout.gif) | 33381 Newport Lower ..> | 2025-03-14 00:08 | 384K | |
![[ ]](/icons/layout.gif) | 33215 Caldey Island ..> | 2025-03-14 00:08 | 443K | |
![[ ]](/icons/layout.gif) | 33210 Report On The ..> | 2025-03-14 00:08 | 320K | |
![[ ]](/icons/layout.gif) | 33208 Dinefwr Castle..> | 2025-03-14 00:08 | 146K | |
![[ ]](/icons/layout.gif) | 33470 Coastal Survey..> | 2025-03-14 00:08 | 6.4M | |
![[ ]](/icons/layout.gif) | 33206 Picton Rising ..> | 2025-03-14 00:08 | 1.1M | |
![[ ]](/icons/layout.gif) | 33152 Pembroke Power..> | 2025-03-14 00:08 | 886K | |
![[ ]](/icons/layout.gif) | 33146 Pembroke Power..> | 2025-03-14 00:08 | 1.4M | |
![[ ]](/icons/layout.gif) | 32843 Past Land Use ..> | 2025-03-14 00:08 | 4.1M | |
![[ ]](/icons/layout.gif) | 32842 Trefloyne Golf..> | 2025-03-14 00:08 | 365K | |
![[ ]](/icons/layout.gif) | 32841 - Arch. Report..> | 2025-03-14 00:08 | 522K | |
![[ ]](/icons/layout.gif) | 33207 Cwm Taf Defend..> | 2025-03-14 00:08 | 14M | |
![[ ]](/icons/layout.gif) | 32839 Terraced Garde..> | 2025-03-14 00:08 | 909K | |
![[ ]](/icons/layout.gif) | 32581 Land At Old Oa..> | 2025-03-14 00:08 | 825K | |
![[ ]](/icons/layout.gif) | 32580 Improvement wo..> | 2025-03-14 00:08 | 454K | |
![[ ]](/icons/layout.gif) | 32570 Lawrenny Castl..> | 2025-03-14 00:08 | 1.0M | |
![[ ]](/icons/layout.gif) | 32836 Lime Kilns Gar..> | 2025-03-14 00:08 | 4.9M | |
![[ ]](/icons/layout.gif) | 32490 Extension Of T..> | 2025-03-14 00:08 | 306K | |
![[ ]](/icons/layout.gif) | 32488 Orange Telecom..> | 2025-03-14 00:08 | 372K | |
![[ ]](/icons/layout.gif) | 32486 Castle Gate Ca..> | 2025-03-14 00:08 | 257K | |
![[ ]](/icons/layout.gif) | 32487 Report On The ..> | 2025-03-14 00:08 | 484K | |
![[ ]](/icons/layout.gif) | 32485 Hendre Quarrie..> | 2025-03-14 00:08 | 1.9M | |
![[ ]](/icons/layout.gif) | 32483 Robeston Wathe..> | 2025-03-14 00:08 | 502K | |
![[ ]](/icons/layout.gif) | 32484 North South Qu..> | 2025-03-14 00:08 | 5.5M | |
![[ ]](/icons/layout.gif) | 32482 Llawhaden Hosp..> | 2025-03-14 00:08 | 4.1M | |
![[ ]](/icons/layout.gif) | 32482 Llawhaden Hosi..> | 2025-03-14 00:08 | 2.2M | |
![[ ]](/icons/layout.gif) | 32479 Golf Course at..> | 2025-03-14 00:08 | 963K | |
![[ ]](/icons/layout.gif) | 32477 Hafod Ladies' ..> | 2025-03-14 00:08 | 916K | |
![[ ]](/icons/layout.gif) | 32477 Hafod Ladies' ..> | 2025-03-14 00:08 | 916K | |
![[ ]](/icons/layout.gif) | 32477 Hafod Ladies W..> | 2025-03-14 00:08 | 916K | |
![[ ]](/icons/layout.gif) | 32476 Rustic Alcove ..> | 2025-03-14 00:08 | 3.7M | |
![[ ]](/icons/layout.gif) | 32482 Llawhaden Hosp..> | 2025-03-14 00:08 | 26M | |
![[ ]](/icons/layout.gif) | 32472 Foul Sewer Rep..> | 2025-03-14 00:08 | 354K | |
![[ ]](/icons/layout.gif) | 32470 BBC UHF Relay ..> | 2025-03-14 00:08 | 672K | |
![[ ]](/icons/layout.gif) | 32473 Narberth A Top..> | 2025-03-14 00:08 | 11M | |
![[ ]](/icons/layout.gif) | 32130 Proposed Devel..> | 2025-03-14 00:08 | 927K | |
![[ ]](/icons/layout.gif) | 32119 Tir Dafydd - R..> | 2025-03-14 00:08 | 703K | |
![[ ]](/icons/layout.gif) | 32115 Proposed Exten..> | 2025-03-14 00:08 | 563K | |
![[ ]](/icons/layout.gif) | 32118 Rock Castle We..> | 2025-03-14 00:08 | 1.5M | |
![[ ]](/icons/layout.gif) | 32112 Hafod The Ladi..> | 2025-03-14 00:08 | 1.7M | |
![[ ]](/icons/layout.gif) | 32112 Hafod The Ladi..> | 2025-03-14 00:08 | 1.7M | |
![[ ]](/icons/layout.gif) | 32106 Castlemartin R..> | 2025-03-14 00:08 | 1.6M | |
![[ ]](/icons/layout.gif) | 32087 St Cristiolus'..> | 2025-03-14 00:08 | 4.0M | |
![[ ]](/icons/layout.gif) | 31347 The Llanelli a..> | 2025-03-14 00:08 | 3.6M | |
![[ ]](/icons/layout.gif) | 31034 Dinefwr Castle..> | 2025-03-14 00:08 | 600K | |
![[ ]](/icons/layout.gif) | 31347 Llanelli and L..> | 2025-03-14 00:08 | 1.4M | |
![[ ]](/icons/layout.gif) | 31032 Old Cardigan B..> | 2025-03-14 00:08 | 769K | |
![[ ]](/icons/layout.gif) | 31033 Kidwelly & Pem..> | 2025-03-14 00:08 | 2.8M | |
![[ ]](/icons/layout.gif) | 31029 Restoration Wo..> | 2025-03-14 00:08 | 595K | |
![[ ]](/icons/layout.gif) | 31026 The Orchard Ne..> | 2025-03-14 00:08 | 1.1M | |
![[ ]](/icons/layout.gif) | 31018 Middleton Hall..> | 2025-03-14 00:08 | 2.5M | |
![[ ]](/icons/layout.gif) | 31018 Middleton Hall..> | 2025-03-14 00:08 | 4.8M | |
![[ ]](/icons/layout.gif) | 30960 Proposed Water..> | 2025-03-14 00:08 | 2.0M | |
![[ ]](/icons/layout.gif) | 30946 Proposed Water..> | 2025-03-14 00:08 | 2.6M | |
![[ ]](/icons/layout.gif) | 30944 Proposed Carma..> | 2025-03-14 00:08 | 1.2M | |
![[ ]](/icons/layout.gif) | 30944 A40 Carmarthen..> | 2025-03-14 00:08 | 2.7M | |
![[ ]](/icons/layout.gif) | 30942 Porth y Rhaw E..> | 2025-03-14 00:08 | 2.7M | |
![[ ]](/icons/layout.gif) | 30942 Porth y Rhaw e..> | 2025-03-14 00:08 | 1.6M | |
![[ ]](/icons/layout.gif) | 30942 Porth Y Rhaw C..> | 2025-03-14 00:08 | 5.1M | |
![[ ]](/icons/layout.gif) | 30942 Porth Y Rhaw C..> | 2025-03-14 00:08 | 6.0M | |
![[ ]](/icons/layout.gif) | 30890 Aberglasney Ho..> | 2025-03-14 00:08 | 507K | |
![[ ]](/icons/layout.gif) | 30887 Elephant & Cas..> | 2025-03-14 00:08 | 1.0M | |
![[ ]](/icons/layout.gif) | 30884 Water Mains Re..> | 2025-03-14 00:08 | 700K | |
![[ ]](/icons/layout.gif) | 30883 Dan-Y-Banc, Ca..> | 2025-03-14 00:08 | 1.1M | |
![[ ]](/icons/layout.gif) | 30870 The South East..> | 2025-03-14 00:08 | 3.8M | |
![[ ]](/icons/layout.gif) | 30750 Croesgoch Watc..> | 2025-03-14 00:08 | 609K | |
![[ ]](/icons/layout.gif) | 30751 Cardigan Bay S..> | 2025-03-14 00:08 | 5.5M | |
![[ ]](/icons/layout.gif) | 30707 South East Dyf..> | 2025-03-14 00:08 | 934K | |
![[ ]](/icons/layout.gif) | 30684 Llyn-Y-Pistyll..> | 2025-03-14 00:08 | 691K | |
![[ ]](/icons/layout.gif) | 30683 Proposed Water..> | 2025-03-14 00:08 | 3.3M | |
![[ ]](/icons/layout.gif) | 30676 Kiln Park Holi..> | 2025-03-14 00:08 | 1.9M | |
![[ ]](/icons/layout.gif) | 30538 Parc Cynnog Wi..> | 2025-03-14 00:08 | 613K | |
![[ ]](/icons/layout.gif) | 30673 Water Mains Re..> | 2025-03-14 00:08 | 2.9M | |
![[ ]](/icons/layout.gif) | 30307 Mineral Extrac..> | 2025-03-14 00:08 | 943K | |
![[ ]](/icons/layout.gif) | 30307 Mineral Extrac..> | 2025-03-14 00:08 | 767K | |
![[ ]](/icons/layout.gif) | 30299 Watermain Dive..> | 2025-03-14 00:08 | 609K | |
![[ ]](/icons/layout.gif) | 30167 Proposed Sewag..> | 2025-03-14 00:08 | 496K | |
![[ ]](/icons/layout.gif) | 30154 Extension To S..> | 2025-03-14 00:08 | 582K | |
![[ ]](/icons/layout.gif) | 30154 Extension To S..> | 2025-03-14 00:08 | 582K | |
![[ ]](/icons/layout.gif) | 30152 Pembroke Power..> | 2025-03-14 00:08 | 825K | |
![[ ]](/icons/layout.gif) | 30124 Redberth-Sages..> | 2025-03-14 00:08 | 2.2M | |
![[ ]](/icons/layout.gif) | 30116 Arch INvestiga..> | 2025-03-14 00:08 | 4.8M | |
![[ ]](/icons/layout.gif) | 30171 SE Dyfed Miner..> | 2025-03-14 00:08 | 18M | |
![[ ]](/icons/layout.gif) | 30108 Between Tides,..> | 2025-03-14 00:08 | 4.0M | |
![[ ]](/icons/layout.gif) | 29900 Daren Lead Min..> | 2025-03-14 00:08 | 1.4M | |
![[ ]](/icons/layout.gif) | 29799 Dinefwr Histor..> | 2025-03-14 00:08 | 1.5M | |
![[ ]](/icons/layout.gif) | 29800 Llyn Brianne U..> | 2025-03-14 00:08 | 2.4M | |
![[ ]](/icons/layout.gif) | 29798 Report On The ..> | 2025-03-14 00:08 | 1.5M | |
![[ ]](/icons/layout.gif) | 29799 Dinefwr Histor..> | 2025-03-14 00:08 | 4.4M | |
![[ ]](/icons/layout.gif) | 29590 Pen-Y-Bryn Far..> | 2025-03-14 00:08 | 1.6M | |
![[ ]](/icons/layout.gif) | 29587 Aberbanc To He..> | 2025-03-14 00:08 | 970K | |
![[ ]](/icons/layout.gif) | 29586 Bontgoch Stora..> | 2025-03-14 00:08 | 5.0M | |
![[ ]](/icons/layout.gif) | 29590 Llanelli Sewag..> | 2025-03-14 00:08 | 7.7M | |
![[ ]](/icons/layout.gif) | 29585 Arch. Impact O..> | 2025-03-14 00:08 | 379K | |
![[ ]](/icons/layout.gif) | 29558 Arch. Implicat..> | 2025-03-14 00:08 | 650K | |
![[ ]](/icons/layout.gif) | 29554 Proposed Whitl..> | 2025-03-14 00:08 | 2.0M | |
![[ ]](/icons/layout.gif) | 29558 Arch. Implicat..> | 2025-03-14 00:08 | 2.1M | |
![[ ]](/icons/layout.gif) | 29537_Cawdor_Farm_Wi..> | 2025-03-14 00:08 | 119K | |
![[ ]](/icons/layout.gif) | 29535 Repot On The A..> | 2025-03-14 00:08 | 705K | |
![[ ]](/icons/layout.gif) | 29532 Land At Parc-Y..> | 2025-03-14 00:08 | 403K | |
![[ ]](/icons/layout.gif) | 29531Report on the I..> | 2025-03-14 00:08 | 700K | |
![[ ]](/icons/layout.gif) | 29527 Arch. Implicat..> | 2025-03-14 00:08 | 699K | |
![[ ]](/icons/layout.gif) | 29528 Proposed Foul ..> | 2025-03-14 00:08 | 1.3M | |
![[ ]](/icons/layout.gif) | 29509 Reports On The..> | 2025-03-14 00:08 | 703K | |
![[ ]](/icons/layout.gif) | 29351 Report On The ..> | 2025-03-14 00:09 | 1.4M | |
![[ ]](/icons/layout.gif) | 28279 A40 Fishguard ..> | 2025-03-14 00:09 | 1.8M | |
![[ ]](/icons/layout.gif) | 28337 Report On The ..> | 2025-03-14 00:09 | 4.4M | |
![[ ]](/icons/layout.gif) | 28246 Report On The ..> | 2025-03-14 00:09 | 1.2M | |
![[ ]](/icons/layout.gif) | 28245 Clarach Bay-Fo..> | 2025-03-14 00:09 | 1.0M | |
![[ ]](/icons/layout.gif) | 28244 Report On The ..> | 2025-03-14 00:09 | 627K | |
![[ ]](/icons/layout.gif) | 28243 Report Of The ..> | 2025-03-14 00:09 | 599K | |
![[ ]](/icons/layout.gif) | 28242 Report On The ..> | 2025-03-14 00:09 | 865K | |
![[ ]](/icons/layout.gif) | 28240 Report On The ..> | 2025-03-14 00:09 | 1.2M | |
![[ ]](/icons/layout.gif) | 28219 Arch. Implicat..> | 2025-03-14 00:09 | 1.0M | |
![[ ]](/icons/layout.gif) | 27992 Report On The ..> | 2025-03-14 00:09 | 1.4M | |
![[ ]](/icons/layout.gif) | 27982 The Undergroun..> | 2025-03-14 00:09 | 1.0M | |
![[ ]](/icons/layout.gif) | 27951 Jackson's Lane..> | 2025-03-14 00:09 | 158K | |
![[ ]](/icons/layout.gif) | 28221 Arch Impact Of..> | 2025-03-14 00:09 | 6.6M | |
![[ ]](/icons/layout.gif) | 27950 Trial Excavati..> | 2025-03-14 00:09 | 109K | |
![[ ]](/icons/layout.gif) | 27948 Report on the ..> | 2025-03-14 00:09 | 658K | |
![[ ]](/icons/layout.gif) | 26494.pdf | 2025-03-14 00:09 | 29K | |
![[ ]](/icons/layout.gif) | 27948 New Job Centre..> | 2025-03-14 00:09 | 2.1M | |
![[ ]](/icons/layout.gif) | 25701 Arch. Assessme..> | 2025-03-14 00:09 | 479K | |
![[ ]](/icons/layout.gif) | 26494 Castlemartin R..> | 2025-03-14 00:09 | 4.0M | |
![[ ]](/icons/layout.gif) | 1852 Glanmarlais 569..> | 2025-03-14 00:09 | 305K | |
![[ ]](/icons/layout.gif) | 215 Excavations at C..> | 2025-03-14 00:09 | 5.2M | |
![[ ]](/icons/layout.gif) | 1692 Ty Hen 56446.pdf | 2025-03-14 00:09 | 188K | |
![[ ]](/icons/layout.gif) | 16215 Coed Beili Rhy..> | 2025-03-14 00:09 | 660K | |
![[ ]](/icons/layout.gif) | 16913 Past Land-Use ..> | 2025-03-14 00:09 | 2.5M | |
![[ ]](/icons/layout.gif) | 1484 Pentre Ifran Fa..> | 2025-03-14 00:09 | 95K | |
![[ ]](/icons/layout.gif) | 14799 St Peters Car ..> | 2025-03-14 00:09 | 62K | |
![[ ]](/icons/layout.gif) | 14799 St Peter's Car..> | 2025-03-14 00:09 | 62K | |
![[ ]](/icons/layout.gif) | 14798 Dyfed Coastal ..> | 2025-03-14 00:09 | 2.9M | |
![[ ]](/icons/layout.gif) | 14770 Llandeilo East..> | 2025-03-14 00:09 | 1.6M | |
![[ ]](/icons/layout.gif) | 14750 Rear 57-58 Kin..> | 2025-03-14 00:09 | 87K | |
![[ ]](/icons/layout.gif) | 14749 Llandeilo Nort..> | 2025-03-14 00:09 | 2.0M | |
![[ ]](/icons/layout.gif) | 14800 Survey of Groe..> | 2025-03-14 00:09 | 10M | |
![[ ]](/icons/layout.gif) | 14681 Survey Report ..> | 2025-03-14 00:09 | 496K | |
![[ ]](/icons/layout.gif) | 14393 Analysis of La..> | 2025-03-14 00:09 | 316K | |
![[ ]](/icons/layout.gif) | 14363 Kidwelly Castl..> | 2025-03-14 00:09 | 291K | |
![[ ]](/icons/layout.gif) | 14281_Survey and Exc..> | 2025-03-14 00:09 | 446K | |
![[ ]](/icons/layout.gif) | 13827_OldBridgeHaver..> | 2025-03-14 00:09 | 528K | |
![[ ]](/icons/layout.gif) | 130826 Awel-y-Mor St..> | 2025-03-14 00:09 | 6.4M | |
![[ ]](/icons/layout.gif) | 130823_High Street,F..> | 2025-03-14 00:09 | 4.8M | |
![[ ]](/icons/layout.gif) | 130821_West_Cottage_..> | 2025-03-14 00:09 | 2.1M | |
![[ ]](/icons/layout.gif) | 130803_STACKPOLE MAN..> | 2025-03-14 00:09 | 47K | |
![[ ]](/icons/layout.gif) | 131056_GREENLINK INN..> | 2025-03-14 00:09 | 19M | |
![[ ]](/icons/layout.gif) | 130803Final Plans.pdf | 2025-03-14 00:09 | 2.7M | |
![[ ]](/icons/layout.gif) | 130785_Dolaucothi Pa..> | 2025-03-14 00:09 | 3.9M | |
![[ ]](/icons/layout.gif) | 130798_Lambeeth_BESS..> | 2025-03-14 00:09 | 9.8M | |
![[ ]](/icons/layout.gif) | 130761 Trewern Farm ..> | 2025-03-14 00:09 | 4.3M | |
![[ ]](/icons/layout.gif) | 130760 Milford Haven..> | 2025-03-14 00:09 | 3.9M | |
![[ ]](/icons/layout.gif) | 130758_Land West of ..> | 2025-03-14 00:09 | 3.3M | |
![[ ]](/icons/layout.gif) | 130756 Trebover_Farm..> | 2025-03-14 00:09 | 5.3M | |
![[ ]](/icons/layout.gif) | 130733 Esgair Fraith..> | 2025-03-14 00:09 | 11M | |
![[ ]](/icons/layout.gif) | 130732 Nantycreiau a..> | 2025-03-14 00:09 | 15M | |
![[ ]](/icons/layout.gif) | 130731 Roch Gate Pem..> | 2025-03-14 00:09 | 5.9M | |
![[ ]](/icons/layout.gif) | 130631_TYYDBUILDINGP..> | 2025-03-14 00:09 | 61M | |
![[ ]](/icons/layout.gif) | 130290 Level Fawr, P..> | 2025-03-14 00:09 | 2.7M | |
![[ ]](/icons/layout.gif) | 130288_Langolman_One..> | 2025-03-14 00:09 | 2.4M | |
![[ ]](/icons/layout.gif) | 130183_Ffarmers_Llan..> | 2025-03-14 00:09 | 3.4M | |
![[ ]](/icons/layout.gif) | 130182 Shoreline Man..> | 2025-03-14 00:09 | 2.8M | |
![[ ]](/icons/layout.gif) | 130158_Winter_Sea_Bu..> | 2025-03-14 00:09 | 5.3M | |
![[ ]](/icons/layout.gif) | 130151_Haverfordwest..> | 2025-03-14 00:09 | 9.5M | |
![[ ]](/icons/layout.gif) | 130147_Marloes_Mere_..> | 2025-03-14 00:09 | 2.0M | |
![[ ]](/icons/layout.gif) | 130146_Maes_Y_Crug_R..> | 2025-03-14 00:09 | 2.1M | |
![[ ]](/icons/layout.gif) | 130139 Former County..> | 2025-03-14 00:09 | 8.9M | |
![[ ]](/icons/layout.gif) | 130138_Castle_Back_L..> | 2025-03-14 00:09 | 8.3M | |
![[ ]](/icons/layout.gif) | 130133_Wemyss_Metal_..> | 2025-03-14 00:09 | 5.6M | |
![[ ]](/icons/layout.gif) | 130011 CST Picton Ca..> | 2025-03-14 00:09 | 22M | |
![[ ]](/icons/layout.gif) | 129909_Pole_Relocati..> | 2025-03-14 00:09 | 4.5M | |
![[ ]](/icons/layout.gif) | 129908_Western Quays..> | 2025-03-14 00:09 | 5.3M | |
![[ ]](/icons/layout.gif) | 129854_Union_Hill_Ha..> | 2025-03-14 00:09 | 5.2M | |
![[ ]](/icons/layout.gif) | 129788_Ffynnongain, ..> | 2025-03-14 00:09 | 5.2M | |
![[ ]](/icons/layout.gif) | 129786_Mwche_Farm_Ll..> | 2025-03-14 00:09 | 4.9M | |
![[ ]](/icons/layout.gif) | 129782_Ddol Isaf Cam..> | 2025-03-14 00:09 | 4.4M | |
![[ ]](/icons/layout.gif) | 129781_Marloes Mere ..> | 2025-03-14 00:09 | 4.1M | |
![[ ]](/icons/layout.gif) | 129774_Haverfordwest..> | 2025-03-14 00:09 | 7.6M | |
![[ ]](/icons/layout.gif) | 129767 Nantymwyn Dee..> | 2025-03-14 00:09 | 7.2M | |
![[ ]](/icons/layout.gif) | 129766 Poyston Farm,..> | 2025-03-14 00:09 | 2.5M | |
![[ ]](/icons/layout.gif) | 129737 Shipping Farm..> | 2025-03-14 00:09 | 5.0M | |
![[ ]](/icons/layout.gif) | 129735_Historic_Farm..> | 2025-03-14 00:09 | 788K | |
![[ ]](/icons/layout.gif) | 130601_KIDWELLYCASTL..> | 2025-03-14 00:09 | 256M | |
![[ ]](/icons/layout.gif) | 129731 Feidr Pen y B..> | 2025-03-14 00:09 | 5.4M | |
![[ ]](/icons/layout.gif) | 129722_New_Road_Bege..> | 2025-03-14 00:09 | 3.0M | |
![[ ]](/icons/layout.gif) | 129730 Level Fawr G..> | 2025-03-14 00:09 | 7.9M | |
![[ ]](/icons/layout.gif) | 129719_Pembroke_Dock..> | 2025-03-14 00:09 | 6.6M | |
![[ ]](/icons/layout.gif) | 129717_Fferm Clarke,..> | 2025-03-14 00:09 | 3.8M | |
![[ ]](/icons/layout.gif) | 129716_Haverfordwest..> | 2025-03-14 00:09 | 5.9M | |
![[ ]](/icons/layout.gif) | 129712_Land at Sages..> | 2025-03-14 00:09 | 4.4M | |
![[ ]](/icons/layout.gif) | 129709_PlasGogerddan..> | 2025-03-14 00:09 | 2.8M | |
![[ ]](/icons/layout.gif) | 129710_Dynamic_Dunes..> | 2025-03-14 00:09 | 5.3M | |
![[ ]](/icons/layout.gif) | 129652_3_to_4_Upper_..> | 2025-03-14 00:09 | 5.1M | |
![[ ]](/icons/layout.gif) | 129646_Haverfordwest..> | 2025-03-14 00:09 | 3.7M | |
![[ ]](/icons/layout.gif) | 129481_Castell_Meuri..> | 2025-03-14 00:09 | 4.7M | |
![[ ]](/icons/layout.gif) | 129480_Land_off_St_A..> | 2025-03-14 00:09 | 2.8M | |
![[ ]](/icons/layout.gif) | 129341_UWTSD_Campus_..> | 2025-03-14 00:09 | 5.7M | |
![[ ]](/icons/layout.gif) | 129259 Crug y Bwdran..> | 2025-03-14 00:09 | 2.6M | |
![[ ]](/icons/layout.gif) | 129037 Haverfordwest..> | 2025-03-14 00:09 | 3.4M | |
![[ ]](/icons/layout.gif) | 129653_StPatricksCha..> | 2025-03-14 00:09 | 46M | |
![[ ]](/icons/layout.gif) | 128973 Pen Crug Mely..> | 2025-03-14 00:09 | 4.3M | |
![[ ]](/icons/layout.gif) | 129037 Haverfordwest..> | 2025-03-14 00:09 | 4.3M | |
![[ ]](/icons/layout.gif) | 128838_No_50_Angle_W..> | 2025-03-14 00:09 | 2.0M | |
![[ ]](/icons/layout.gif) | 128848_Banc_Tynpynfa..> | 2025-03-14 00:09 | 6.4M | |
![[ ]](/icons/layout.gif) | 128836_The_Grove_Nar..> | 2025-03-14 00:09 | 4.2M | |
![[ ]](/icons/layout.gif) | 128834 Havan Mine Ce..> | 2025-03-14 00:09 | 7.4M | |
![[ ]](/icons/layout.gif) | 128835 Pantmaenog Fo..> | 2025-03-14 00:09 | 4.2M | |
![[ ]](/icons/layout.gif) | 128833 Parc Pengrug,..> | 2025-03-14 00:09 | 2.9M | |
![[ ]](/icons/layout.gif) | 128830_Western Quays..> | 2025-03-14 00:09 | 4.4M | |
![[ ]](/icons/layout.gif) | 128828_Land_north_of..> | 2025-03-14 00:09 | 1.2M | |
![[ ]](/icons/layout.gif) | 128827_Monkton_Churc..> | 2025-03-14 00:09 | 2.2M | |
![[ ]](/icons/layout.gif) | 128824_South_Quay,_P..> | 2025-03-14 00:09 | 4.3M | |
![[ ]](/icons/layout.gif) | 128799 River Ritec T..> | 2025-03-14 00:09 | 3.9M | |
![[ ]](/icons/layout.gif) | 128720_St_Annes_Lane..> | 2025-03-14 00:09 | 2.2M | |
![[ ]](/icons/layout.gif) | 128668_Plumstone_SRV..> | 2025-03-14 00:10 | 2.4M | |
![[ ]](/icons/layout.gif) | 128289 Clifton Rock ..> | 2025-03-14 00:10 | 3.0M | |
![[ ]](/icons/layout.gif) | 128269_Archaeology_o..> | 2025-03-14 00:10 | 1.1M | |
![[ ]](/icons/layout.gif) | 128615_Pembroke_Cast..> | 2025-03-14 00:10 | 2.7M | |
![[ ]](/icons/layout.gif) | 128247_Rivers_and_ri..> | 2025-03-14 00:10 | 449K | |
![[ ]](/icons/layout.gif) | 128202 Rock Street C..> | 2025-03-14 00:10 | 2.3M | |
![[ ]](/icons/layout.gif) | 128200_Land_north_of..> | 2025-03-14 00:10 | 2.4M | |
![[ ]](/icons/layout.gif) | 128198 Structure 2-5..> | 2025-03-14 00:10 | 4.5M | |
![[ ]](/icons/layout.gif) | 127947_A40_River_Tow..> | 2025-03-14 00:10 | 2.0M | |
![[ ]](/icons/layout.gif) | 127944_Dynamic_Dunes..> | 2025-03-14 00:10 | 4.3M | |
![[ ]](/icons/layout.gif) | 127946 Pendine Outdo..> | 2025-03-14 00:10 | 2.1M | |
![[ ]](/icons/layout.gif) | 127816 Haverfordwest..> | 2025-03-14 00:10 | 8.0M | |
![[ ]](/icons/layout.gif) | 127816 Haverfordwest..> | 2025-03-14 00:10 | 8.0M | |
![[ ]](/icons/layout.gif) | 127555_ Eco_Park_off..> | 2025-03-14 00:10 | 1.8M | |
![[ ]](/icons/layout.gif) | 127553 Land next to ..> | 2025-03-14 00:10 | 1.4M | |
![[ ]](/icons/layout.gif) | 127554_Rhosamman_Coa..> | 2025-03-14 00:10 | 7.2M | |
![[ ]](/icons/layout.gif) | 127333_St Issells Ch..> | 2025-03-14 00:10 | 1.8M | |
![[ ]](/icons/layout.gif) | 127349_Former_Nether..> | 2025-03-14 00:10 | 6.1M | |
![[ ]](/icons/layout.gif) | 127128_Crugmore_Farm..> | 2025-03-14 00:10 | 2.7M | |
![[ ]](/icons/layout.gif) | 126698_Haverfordwest..> | 2025-03-14 00:10 | 4.7M | |
![[ ]](/icons/layout.gif) | 126667_Erebus_Geotec..> | 2025-03-14 00:10 | 2.1M | |
![[ ]](/icons/layout.gif) | 126666_Nun_St_St_Dav..> | 2025-03-14 00:10 | 2.8M | |
![[ ]](/icons/layout.gif) | 126665_Beeches_Sprin..> | 2025-03-14 00:10 | 2.2M | |
![[ ]](/icons/layout.gif) | 126653_Cross_Hands_P..> | 2025-03-14 00:10 | 2.9M | |
![[ ]](/icons/layout.gif) | 126652 Cardigan floo..> | 2025-03-14 00:10 | 6.0M | |
![[ ]](/icons/layout.gif) | 126651_Glasfryn_Rd,_..> | 2025-03-14 00:10 | 3.7M | |
![[ ]](/icons/layout.gif) | 126650 Heol Cennen, ..> | 2025-03-14 00:10 | 1.7M | |
![[ ]](/icons/layout.gif) | 126643_Gwynfe_Chapel..> | 2025-03-14 00:10 | 2.4M | |
![[ ]](/icons/layout.gif) | 126619_Orchard_Park_..> | 2025-03-14 00:10 | 1.6M | |
![[ ]](/icons/layout.gif) | 126618_Maes_Y_Beddol..> | 2025-03-14 00:10 | 2.7M | |
![[ ]](/icons/layout.gif) | 126617_St Non's Well..> | 2025-03-14 00:10 | 2.4M | |
![[ ]](/icons/layout.gif) | 126605_Merryborough_..> | 2025-03-14 00:10 | 3.0M | |
![[ ]](/icons/layout.gif) | 126599_Land_Adj_Tali..> | 2025-03-14 00:10 | 2.3M | |
![[ ]](/icons/layout.gif) | 126598_Ammanford_Geo..> | 2025-03-14 00:10 | 2.5M | |
![[ ]](/icons/layout.gif) | 126606_Lammas_Street..> | 2025-03-14 00:10 | 4.6M | |
![[ ]](/icons/layout.gif) | 126541_Oriel_Myrddin..> | 2025-03-14 00:10 | 3.4M | |
![[ ]](/icons/layout.gif) | 126537_Rhydyfferm, C..> | 2025-03-14 00:10 | 3.7M | |
![[ ]](/icons/layout.gif) | 126375 Tudor Merchan..> | 2025-03-14 00:10 | 392K | |
![[ ]](/icons/layout.gif) | 126375 Tudor Merchan..> | 2025-03-14 00:10 | 424K | |
![[ ]](/icons/layout.gif) | 126542_St_Faith_and_..> | 2025-03-14 00:10 | 4.4M | |
![[ ]](/icons/layout.gif) | 126375 Tudor Merchan..> | 2025-03-14 00:10 | 693K | |
![[ ]](/icons/layout.gif) | 126369_Blaenau_Bronz..> | 2025-03-14 00:10 | 5.7M | |
![[ ]](/icons/layout.gif) | 126367 Former Aberae..> | 2025-03-14 00:10 | 5.2M | |
![[ ]](/icons/layout.gif) | 126366_Llyn y Fan Fa..> | 2025-03-14 00:10 | 4.4M | |
![[ ]](/icons/layout.gif) | 126363_Abbey Consol ..> | 2025-03-14 00:10 | 2.9M | |
![[ ]](/icons/layout.gif) | 126362_Cartref_Brynb..> | 2025-03-14 00:10 | 2.6M | |
![[ ]](/icons/layout.gif) | 126345_St_Florence_W..> | 2025-03-14 00:10 | 2.2M | |
![[ ]](/icons/layout.gif) | 126344_Capel_Sul_Kid..> | 2025-03-14 00:10 | 3.4M | |
![[ ]](/icons/layout.gif) | 126329_Hendy_School_..> | 2025-03-14 00:10 | 4.2M | |
![[ ]](/icons/layout.gif) | 126328_Land_adj_to_T..> | 2025-03-14 00:10 | 3.0M | |
![[ ]](/icons/layout.gif) | 126321_Penglais_Sola..> | 2025-03-14 00:10 | 4.8M | |
![[ ]](/icons/layout.gif) | 126319_Land_east_of_..> | 2025-03-14 00:10 | 8.5M | |
![[ ]](/icons/layout.gif) | 126304 Haverfordwest..> | 2025-03-14 00:10 | 5.0M | |
![[ ]](/icons/layout.gif) | 126318_Haverfordwest..> | 2025-03-14 00:10 | 4.6M | |
![[ ]](/icons/layout.gif) | 126002_Llandovery pl..> | 2025-03-14 00:10 | 3.7M | |
![[ ]](/icons/layout.gif) | 126303_Narberth_Coun..> | 2025-03-14 00:10 | 4.4M | |
![[ ]](/icons/layout.gif) | 125863_Minwear_Cotta..> | 2025-03-14 00:10 | 4.1M | |
![[ ]](/icons/layout.gif) | 125662_Randell_Squar..> | 2025-03-14 00:10 | 2.9M | |
![[ ]](/icons/layout.gif) | 125661_One_Planet_Pe..> | 2025-03-14 00:10 | 2.9M | |
![[ ]](/icons/layout.gif) | 125987_Wemyss_Metal_..> | 2025-03-14 00:10 | 5.4M | |
![[ ]](/icons/layout.gif) | 125660_Pembrey_Dunes..> | 2025-03-14 00:10 | 5.4M | |
![[ ]](/icons/layout.gif) | 125659_Yet_Wen_Geoph..> | 2025-03-14 00:10 | 3.2M | |
![[ ]](/icons/layout.gif) | 125658_Nant_y_Mwyn_M..> | 2025-03-14 00:10 | 7.5M | |
![[ ]](/icons/layout.gif) | 125655_SEARCHING_FOR..> | 2025-03-14 00:10 | 9.6M | |
![[ ]](/icons/layout.gif) | 125653_Climate_Chang..> | 2025-03-14 00:10 | 5.8M | |
![[ ]](/icons/layout.gif) | 125652_Manor Farm Ly..> | 2025-03-14 00:10 | 5.6M | |
![[ ]](/icons/layout.gif) | 125651_Glan y Mor Ho..> | 2025-03-14 00:10 | 2.0M | |
![[ ]](/icons/layout.gif) | 125650_Haverfordwest..> | 2025-03-14 00:10 | 6.9M | |
![[ ]](/icons/layout.gif) | 125648 Land adjacent..> | 2025-03-14 00:10 | 4.9M | |
![[ ]](/icons/layout.gif) | 125649 Maes-mynach, ..> | 2025-03-14 00:10 | 4.6M | |
![[ ]](/icons/layout.gif) | 125647 MOD Merrion C..> | 2025-03-14 00:10 | 1.9M | |
![[ ]](/icons/layout.gif) | 125643 Aberaeron for..> | 2025-03-14 00:10 | 3.0M | |
![[ ]](/icons/layout.gif) | 125646_Sageston_Fiel..> | 2025-03-14 00:10 | 4.4M | |
![[ ]](/icons/layout.gif) | 125640_NANT_Y_DDERWY..> | 2025-03-14 00:10 | 2.0M | |
![[ ]](/icons/layout.gif) | 125638 St Davids Par..> | 2025-03-14 00:10 | 5.1M | |
![[ ]](/icons/layout.gif) | 125604_Mynydd_y_Llan..> | 2025-03-14 00:10 | 4.6M | |
![[ ]](/icons/layout.gif) | 125598 Pencau Lands,..> | 2025-03-14 00:10 | 5.6M | |
![[ ]](/icons/layout.gif) | 125589 Llandovery Pl..> | 2025-03-14 00:10 | 4.8M | |
![[ ]](/icons/layout.gif) | 125566 Maes Yr Haf -..> | 2025-03-14 00:10 | 5.1M | |
![[ ]](/icons/layout.gif) | 125592_Wemyss_DBA_Up..> | 2025-03-14 00:10 | 12M | |
![[ ]](/icons/layout.gif) | 125565_Is_y_Llan_Lla..> | 2025-03-14 00:10 | 3.4M | |
![[ ]](/icons/layout.gif) | 125517 Greenlink Tri..> | 2025-03-14 00:10 | 5.6M | |
![[ ]](/icons/layout.gif) | 125511 Station Road,..> | 2025-03-14 00:10 | 2.7M | |
![[ ]](/icons/layout.gif) | 125512_YMCA_Llanelli..> | 2025-03-14 00:10 | 5.3M | |
![[ ]](/icons/layout.gif) | 125509_Llanwnnen Pri..> | 2025-03-14 00:10 | 7.1M | |
![[ ]](/icons/layout.gif) | 125510_Haverfordwest..> | 2025-03-14 00:10 | 16M | |
![[ ]](/icons/layout.gif) | 121959_Caer_Blaen_Mi..> | 2025-03-14 00:10 | 4.0M | |
![[ ]](/icons/layout.gif) | 125496_Ysgol_Heol_Go..> | 2025-03-14 00:10 | 5.7M | |
![[ ]](/icons/layout.gif) | 121897_St_Brynachs C..> | 2025-03-14 00:10 | 5.8M | |
![[ ]](/icons/layout.gif) | 121958_EAST_DUDWELL_..> | 2025-03-14 00:10 | 4.7M | |
![[ ]](/icons/layout.gif) | 121886_YSPYTTY_SCHOO..> | 2025-03-14 00:10 | 2.9M | |
![[ ]](/icons/layout.gif) | 121884 North Farm, W..> | 2025-03-14 00:10 | 4.2M | |
![[ ]](/icons/layout.gif) | 121882_ONSHORE _MET_..> | 2025-03-14 00:10 | 5.8M | |
![[ ]](/icons/layout.gif) | 121881 Kidwelly cast..> | 2025-03-14 00:10 | 396K | |
![[ ]](/icons/layout.gif) | 121880 Kidwelly_Cast..> | 2025-03-14 00:10 | 275K | |
![[ ]](/icons/layout.gif) | 121878_Manorbier com..> | 2025-03-14 00:10 | 2.4M | |
![[ ]](/icons/layout.gif) | 121883_Pembrey_Burro..> | 2025-03-14 00:10 | 5.5M | |
![[ ]](/icons/layout.gif) | 121871_St Thomas A B..> | 2025-03-14 00:10 | 4.2M | |
![[ ]](/icons/layout.gif) | 121859_St_Clears_Geo..> | 2025-03-14 00:10 | 1.6M | |
![[ ]](/icons/layout.gif) | 121873 South Quay, P..> | 2025-03-14 00:10 | 6.3M | |
![[ ]](/icons/layout.gif) | 121733 Butchers_Arms..> | 2025-03-14 00:10 | 336K | |
![[ ]](/icons/layout.gif) | 121779_TheColdWar.pdf | 2025-03-14 00:10 | 9.3M | |
![[ ]](/icons/layout.gif) | 121729 Tyncoed Llanw..> | 2025-03-14 00:10 | 5.7M | |
![[ ]](/icons/layout.gif) | 121730_Ocky_White_St..> | 2025-03-14 00:10 | 4.7M | |
![[ ]](/icons/layout.gif) | 121726_Historic_Farm..> | 2025-03-14 00:10 | 1.1M | |
![[ ]](/icons/layout.gif) | 121725_Creation_of_P..> | 2025-03-14 00:10 | 4.0M | |
![[ ]](/icons/layout.gif) | 121724_Manorbier GEO..> | 2025-03-14 00:10 | 2.1M | |
![[ ]](/icons/layout.gif) | 121723_South_Quay,_P..> | 2025-03-14 00:10 | 5.6M | |
![[ ]](/icons/layout.gif) | 121718_Nantgaredig G..> | 2025-03-14 00:10 | 2.2M | |
![[ ]](/icons/layout.gif) | 121721_Abbey_Consols..> | 2025-03-14 00:10 | 13M | |
![[ ]](/icons/layout.gif) | 121693_STATION_RD_LE..> | 2025-03-14 00:10 | 3.1M | |
![[ ]](/icons/layout.gif) | 121692_Market_St,_Ll..> | 2025-03-14 00:10 | 4.1M | |
![[ ]](/icons/layout.gif) | 121683_Bronze_Age_Ho..> | 2025-03-14 00:10 | 3.2M | |
![[ ]](/icons/layout.gif) | 121690_SWNYMORLO_WB ..> | 2025-03-14 00:10 | 5.0M | |
![[ ]](/icons/layout.gif) | 121680_Penrhos_Golf_..> | 2025-03-14 00:10 | 1.6M | |
![[ ]](/icons/layout.gif) | 121683_Bronze_Age_Ho..> | 2025-03-14 00:10 | 4.6M | |
![[ ]](/icons/layout.gif) | 121276_Historic_Farm..> | 2025-03-14 00:10 | 1.9M | |
![[ ]](/icons/layout.gif) | 120804_Land East of ..> | 2025-03-14 00:10 | 3.6M | |
![[ ]](/icons/layout.gif) | 120796_Discovering_O..> | 2025-03-14 00:10 | 3.7M | |
![[ ]](/icons/layout.gif) | 120803 Land at Sages..> | 2025-03-14 00:11 | 4.2M | |
![[ ]](/icons/layout.gif) | 120795_DAT_156_Llysy..> | 2025-03-14 00:11 | 2.1M | |
![[ ]](/icons/layout.gif) | 119223_CADW_DAT_154_..> | 2025-03-14 00:11 | 5.1M | |
![[ ]](/icons/layout.gif) | 120753 Haverfordwest..> | 2025-03-14 00:11 | 8.9M | |
![[ ]](/icons/layout.gif) | 119222_42_Parrog_Roa..> | 2025-03-14 00:11 | 3.3M | |
![[ ]](/icons/layout.gif) | 119213_Remote_Sensin..> | 2025-03-14 00:11 | 4.2M | |
![[ ]](/icons/layout.gif) | 118158_Broad_Haven H..> | 2025-03-14 00:11 | 3.6M | |
![[ ]](/icons/layout.gif) | 118129_Spring Garden..> | 2025-03-14 00:11 | 7.9M | |
![[ ]](/icons/layout.gif) | 118158_Broad_Haven H..> | 2025-03-14 00:11 | 8.7M | |
![[ ]](/icons/layout.gif) | 118123_South_Quay_Pe..> | 2025-03-14 00:11 | 8.5M | |
![[ ]](/icons/layout.gif) | 118122_Capel_Isaf_Sc..> | 2025-03-14 00:11 | 8.4M | |
![[ ]](/icons/layout.gif) | 118119_Pembroke_Refi..> | 2025-03-14 00:11 | 5.2M | |
![[ ]](/icons/layout.gif) | 118121_The_ Tywi_Gat..> | 2025-03-14 00:11 | 11M | |
![[ ]](/icons/layout.gif) | 118117-Greenlink_Eva..> | 2025-03-14 00:11 | 5.2M | |
![[ ]](/icons/layout.gif) | 118091_Glasfryn_Road..> | 2025-03-14 00:11 | 1.9M | |
![[ ]](/icons/layout.gif) | 118087_Gilfach-Goch-..> | 2025-03-14 00:11 | 1.4M | |
![[ ]](/icons/layout.gif) | 118089 Excavation at..> | 2025-03-14 00:11 | 4.3M | |
![[ ]](/icons/layout.gif) | 118086_Land-At-Gardd..> | 2025-03-14 00:11 | 2.2M | |
![[ ]](/icons/layout.gif) | 118085 Garn Fawr loo..> | 2025-03-14 00:11 | 7.0M | |
![[ ]](/icons/layout.gif) | 118083_Cwmysgyfarnog..> | 2025-03-14 00:11 | 2.8M | |
![[ ]](/icons/layout.gif) | 118022-Rep_No_2019-2..> | 2025-03-14 00:11 | 1.4M | |
![[ ]](/icons/layout.gif) | 118020_Porth_y_Rhaw_..> | 2025-03-14 00:11 | 11M | |
![[ ]](/icons/layout.gif) | 118020_Porth_y_Rhaw_..> | 2025-03-14 00:11 | 6.7M | |
![[ ]](/icons/layout.gif) | 117989_Grug_y_Mynydd..> | 2025-03-14 00:11 | 6.9M | |
![[ ]](/icons/layout.gif) | 118015_Penally_First..> | 2025-03-14 00:11 | 13M | |
![[ ]](/icons/layout.gif) | 117987_Llyn Y Fan Ca..> | 2025-03-14 00:11 | 7.2M | |
![[ ]](/icons/layout.gif) | 117963_St_Marys_Fish..> | 2025-03-14 00:11 | 5.2M | |
![[ ]](/icons/layout.gif) | 117986_St Dogmaels, ..> | 2025-03-14 00:11 | 1.0M | |
![[ ]](/icons/layout.gif) | 117960_St_Michaels_A..> | 2025-03-14 00:11 | 4.1M | |
![[ ]](/icons/layout.gif) | 117959_Plum Tree Hou..> | 2025-03-14 00:11 | 2.6M | |
![[ ]](/icons/layout.gif) | 117957_Carew_Castle_..> | 2025-03-14 00:11 | 4.1M | |
![[ ]](/icons/layout.gif) | 117507_Llanstadwell ..> | 2025-03-14 00:11 | 2.0M | |
![[ ]](/icons/layout.gif) | 117453_Report_No_201..> | 2025-03-14 00:11 | 18M | |
![[ ]](/icons/layout.gif) | 117452 Blue Street R..> | 2025-03-14 00:11 | 752K | |
![[ ]](/icons/layout.gif) | 117451 CADW Schedule..> | 2025-03-14 00:11 | 2.7M | |
![[ ]](/icons/layout.gif) | 117453_Report_No_201..> | 2025-03-14 00:11 | 18M | |
![[ ]](/icons/layout.gif) | 117056_Capel Erbach.pdf | 2025-03-14 00:11 | 4.0M | |
![[ ]](/icons/layout.gif) | 117055_Land_N_of_Old..> | 2025-03-14 00:11 | 3.9M | |
![[ ]](/icons/layout.gif) | 117004_Carew-Castle-..> | 2025-03-14 00:11 | 1.8M | |
![[ ]](/icons/layout.gif) | 116535_Schlee_2005_H..> | 2025-03-14 00:11 | 4.5M | |
![[ ]](/icons/layout.gif) | 115765_Llangwm_Churc..> | 2025-03-14 00:11 | 1.1M | |
![[ ]](/icons/layout.gif) | 116313_Bowett_Farm_H..> | 2025-03-14 00:11 | 5.7M | |
![[ ]](/icons/layout.gif) | 115651_Glandulais_Fa..> | 2025-03-14 00:11 | 2.9M | |
![[ ]](/icons/layout.gif) | 115694_Land south of..> | 2025-03-14 00:11 | 5.7M | |
![[ ]](/icons/layout.gif) | 115115-Fan Foel BBNP..> | 2025-03-14 00:11 | 5.5M | |
![[ ]](/icons/layout.gif) | 115076_Ammanford_Flo..> | 2025-03-14 00:11 | 5.7M | |
![[ ]](/icons/layout.gif) | 115044 carew cross e..> | 2025-03-14 00:11 | 572K | |
![[ ]](/icons/layout.gif) | 114929_Uplands, Burg..> | 2025-03-14 00:11 | 2.5M | |
![[ ]](/icons/layout.gif) | 114791_Penrhyn_Bach_..> | 2025-03-14 00:11 | 4.4M | |
![[ ]](/icons/layout.gif) | 114215_St_Cadogs_Lla..> | 2025-03-14 00:11 | 3.4M | |
![[ ]](/icons/layout.gif) | 114213 A0027923 Aber..> | 2025-03-14 00:11 | 5.1M | |
![[ ]](/icons/layout.gif) | 114212_Craigwen_risi..> | 2025-03-14 00:11 | 820K | |
![[ ]](/icons/layout.gif) | 115650 Brechfa Fores..> | 2025-03-14 00:11 | 70M | |
![[ ]](/icons/layout.gif) | 114192_St_Ishmael_In..> | 2025-03-14 00:11 | 1.5M | |
![[ ]](/icons/layout.gif) | 114183_Caves.pdf | 2025-03-14 00:11 | 3.0M | |
![[ ]](/icons/layout.gif) | 114182 CADW SAM PCNP..> | 2025-03-14 00:11 | 1.9M | |
![[ ]](/icons/layout.gif) | 114181 Cadw SAM PCNP..> | 2025-03-14 00:11 | 2.9M | |
![[ ]](/icons/layout.gif) | 114025 Carmarthen U..> | 2025-03-14 00:11 | 4.1M | |
![[ ]](/icons/layout.gif) | 113520_Glasfryn_Road..> | 2025-03-14 00:11 | 4.7M | |
![[ ]](/icons/layout.gif) | 113514-NRW_Tree_Fell..> | 2025-03-14 00:11 | 6.6M | |
![[ ]](/icons/layout.gif) | 113211 112-13 Priory..> | 2025-03-14 00:11 | 6.0M | |
![[ ]](/icons/layout.gif) | 113212_Pembroke_Cast..> | 2025-03-14 00:11 | 14M | |
![[ ]](/icons/layout.gif) | 112752 Forestry and ..> | 2025-03-14 00:11 | 2.4M | |
![[ ]](/icons/layout.gif) | 113201_Greenlink_Int..> | 2025-03-14 00:11 | 3.4M | |
![[ ]](/icons/layout.gif) | 112750_Pembrey_Count..> | 2025-03-14 00:11 | 2.1M | |
![[ ]](/icons/layout.gif) | 112736_Moat_House_Ki..> | 2025-03-14 00:11 | 2.7M | |
![[ ]](/icons/layout.gif) | 112712 A0022691 Cwmc..> | 2025-03-14 00:11 | 4.4M | |
![[ ]](/icons/layout.gif) | 112744_Carmarthen_Ar..> | 2025-03-14 00:11 | 9.8M | |
![[ ]](/icons/layout.gif) | 112704 New Shipping ..> | 2025-03-14 00:11 | 3.9M | |
![[ ]](/icons/layout.gif) | 112708_Newcastle_Eml..> | 2025-03-14 00:11 | 5.3M | |
![[ ]](/icons/layout.gif) | 112701_Crosshands_EL..> | 2025-03-14 00:11 | 2.3M | |
![[ ]](/icons/layout.gif) | 112380-NBGW_Walled_G..> | 2025-03-14 00:11 | 1.3M | |
![[ ]](/icons/layout.gif) | 112375 Coed Shon Gla..> | 2025-03-14 00:11 | 9.7M | |
![[ ]](/icons/layout.gif) | 112269 ThreatRelated..> | 2025-03-14 00:11 | 6.2M | |
![[ ]](/icons/layout.gif) | 112372-Carew Castle ..> | 2025-03-14 00:11 | 13M | |
![[ ]](/icons/layout.gif) | 112156 Historic Farm..> | 2025-03-14 00:11 | 2.1M | |
![[ ]](/icons/layout.gif) | 112145-Carew_Castle_..> | 2025-03-14 00:11 | 1.5M | |
![[ ]](/icons/layout.gif) | 112132-112133_Spring..> | 2025-03-14 00:12 | 1.5M | |
![[ ]](/icons/layout.gif) | 112096_Llwyn_Llanfai..> | 2025-03-14 00:12 | 1.0M | |
![[ ]](/icons/layout.gif) | 112144-Bluestone_Sky..> | 2025-03-14 00:12 | 4.9M | |
![[ ]](/icons/layout.gif) | 112095_Cresswell_Cas..> | 2025-03-14 00:12 | 1.3M | |
![[ ]](/icons/layout.gif) | 112089-Heol_Y_Plas-e..> | 2025-03-14 00:12 | 4.1M | |
![[ ]](/icons/layout.gif) | 112090_Cardigan_ICC_..> | 2025-03-14 00:12 | 11M | |
![[ ]](/icons/layout.gif) | 112038_Churchview,_W..> | 2025-03-14 00:12 | 5.3M | |
![[ ]](/icons/layout.gif) | 112036-Roman_Road_Ll..> | 2025-03-14 00:12 | 3.3M | |
![[ ]](/icons/layout.gif) | 111472_Ysgol-y_Caste..> | 2025-03-14 00:12 | 3.7M | |
![[ ]](/icons/layout.gif) | 111392_Woodlands_Beg..> | 2025-03-14 00:12 | 6.3M | |
![[ ]](/icons/layout.gif) | 112035_Pembrey_Count..> | 2025-03-14 00:12 | 11M | |
![[ ]](/icons/layout.gif) | 111366_Zion_Gardens_..> | 2025-03-14 00:12 | 2.9M | |
![[ ]](/icons/layout.gif) | 111391_Land_south-of..> | 2025-03-14 00:12 | 2.5M | |
![[ ]](/icons/layout.gif) | 111238_Carmarthen_Li..> | 2025-03-14 00:12 | 13M | |
![[ ]](/icons/layout.gif) | 111237_Penrhyncoch_E..> | 2025-03-14 00:12 | 10M | |
![[ ]](/icons/layout.gif) | 111224_Chimneys_Link..> | 2025-03-14 00:12 | 11M | |
![[ ]](/icons/layout.gif) | 111220_Five Roads Sc..> | 2025-03-14 00:12 | 4.8M | |
![[ ]](/icons/layout.gif) | 111195_Myrtle Hill, ..> | 2025-03-14 00:12 | 4.2M | |
![[ ]](/icons/layout.gif) | 111216_112149_112734..> | 2025-03-14 00:12 | 15M | |
![[ ]](/icons/layout.gif) | 111174_Carew_Mill_re..> | 2025-03-14 00:12 | 2.8M | |
![[ ]](/icons/layout.gif) | 111150 Jolly Tar, Th..> | 2025-03-14 00:12 | 2.9M | |
![[ ]](/icons/layout.gif) | 111149_Geophys Llano..> | 2025-03-14 00:12 | 4.1M | |
![[ ]](/icons/layout.gif) | 111151_North_Dock_Ll..> | 2025-03-14 00:12 | 8.9M | |
![[ ]](/icons/layout.gif) | 111144_Bronwydd_Llan..> | 2025-03-14 00:12 | 5.0M | |
![[ ]](/icons/layout.gif) | 111143_Stabl Fach,_C..> | 2025-03-14 00:12 | 3.8M | |
![[ ]](/icons/layout.gif) | 111142_Foundry_Point..> | 2025-03-14 00:12 | 5.7M | |
![[ ]](/icons/layout.gif) | 111141_St_Ishmael_In..> | 2025-03-14 00:12 | 12M | |
![[ ]](/icons/layout.gif) | 111138_EVAL_Penystar..> | 2025-03-14 00:12 | 3.3M | |
![[ ]](/icons/layout.gif) | 111124_Bluestone_Sky..> | 2025-03-14 00:12 | 8.8M | |
![[ ]](/icons/layout.gif) | 110742_111139_111140..> | 2025-03-14 00:12 | 16M | |
![[ ]](/icons/layout.gif) | 111125_Chimneys_Link..> | 2025-03-14 00:12 | 33M | |
![[ ]](/icons/layout.gif) | 110740_Heol_y_Plas_L..> | 2025-03-14 00:12 | 5.5M | |
![[ ]](/icons/layout.gif) | 110511_Pont_Newydd_H..> | 2025-03-14 00:12 | 6.8M | |
![[ ]](/icons/layout.gif) | 110505_Nun_Street_St..> | 2025-03-14 00:12 | 9.1M | |
![[ ]](/icons/layout.gif) | 110484_Nant Caerhedy..> | 2025-03-14 00:12 | 6.5M | |
![[ ]](/icons/layout.gif) | 110483&111171_Druids..> | 2025-03-14 00:12 | 3.8M | |
![[ ]](/icons/layout.gif) | 110482_Land_adjacent..> | 2025-03-14 00:12 | 4.1M | |
![[ ]](/icons/layout.gif) | 110475 Rhoscrowther ..> | 2025-03-14 00:12 | 1.9M | |
![[ ]](/icons/layout.gif) | 110474 Church Bank D..> | 2025-03-14 00:12 | 677K | |
![[ ]](/icons/layout.gif) | 110473 St Cybi's Chu..> | 2025-03-14 00:12 | 608K | |
![[ ]](/icons/layout.gif) | 110476_Old_Tenby_Roa..> | 2025-03-14 00:12 | 13M | |
![[ ]](/icons/layout.gif) | 110467__Land N of Cr..> | 2025-03-14 00:12 | 5.2M | |
![[ ]](/icons/layout.gif) | 110468_VERS 4Carmart..> | 2025-03-14 00:12 | 2.8M | |
![[ ]](/icons/layout.gif) | 110465_Spittal_Archa..> | 2025-03-14 00:12 | 9.9M | |
![[ ]](/icons/layout.gif) | 110464_Carnawllon_Fa..> | 2025-03-14 00:12 | 8.5M | |
![[ ]](/icons/layout.gif) | 110454_Ogof_Gofan_Ar..> | 2025-03-14 00:12 | 7.4M | |
![[ ]](/icons/layout.gif) | 110450-NBGW_Falconry..> | 2025-03-14 00:12 | 1.2M | |
![[ ]](/icons/layout.gif) | 110451_Spittal_Cross..> | 2025-03-14 00:12 | 11M | |
![[ ]](/icons/layout.gif) | 110449_Oriel_Myrddin..> | 2025-03-14 00:12 | 2.3M | |
![[ ]](/icons/layout.gif) | 110438_Report_No_201..> | 2025-03-14 00:12 | 2.1M | |
![[ ]](/icons/layout.gif) | 110442_Cliffe_Norton..> | 2025-03-14 00:12 | 7.5M | |
![[ ]](/icons/layout.gif) | 110435-RepNo-2017-20..> | 2025-03-14 00:12 | 3.5M | |
![[ ]](/icons/layout.gif) | 110436_Report_No_201..> | 2025-03-14 00:12 | 3.9M | |
![[ ]](/icons/layout.gif) | 110435 Chimneys_Link..> | 2025-03-14 00:12 | 3.5M | |
![[ ]](/icons/layout.gif) | 110434_EVAL_Land_Nor..> | 2025-03-14 00:12 | 3.9M | |
![[ ]](/icons/layout.gif) | 110432_Jackson's_Lan..> | 2025-03-14 00:12 | 12M | |
![[ ]](/icons/layout.gif) | 110331.pdf | 2025-03-14 00:12 | 5.5M | |
![[ ]](/icons/layout.gif) | 110432 Jacksons Lane..> | 2025-03-14 00:12 | 12M | |
![[ ]](/icons/layout.gif) | 110326_Report_No_201..> | 2025-03-14 00:12 | 9.0M | |
![[ ]](/icons/layout.gif) | 110327_Report_No_201..> | 2025-03-14 00:12 | 18M | |
![[ ]](/icons/layout.gif) | 110325_Crundale_Mill..> | 2025-03-14 00:12 | 6.5M | |
![[ ]](/icons/layout.gif) | 110324_Jolly Tar, Th..> | 2025-03-14 00:12 | 5.1M | |
![[ ]](/icons/layout.gif) | 110321_St_Ishmaels C..> | 2025-03-14 00:12 | 3.6M | |
![[ ]](/icons/layout.gif) | 110319_Sageston_Fiel..> | 2025-03-14 00:12 | 10M | |
![[ ]](/icons/layout.gif) | 110317_Maidenwells r..> | 2025-03-14 00:12 | 5.3M | |
![[ ]](/icons/layout.gif) | 110316_Amroth Castle..> | 2025-03-14 00:12 | 4.0M | |
![[ ]](/icons/layout.gif) | 110315_St_Tybie_Chur..> | 2025-03-14 00:12 | 2.7M | |
![[ ]](/icons/layout.gif) | 110318_Bishops Palac..> | 2025-03-14 00:12 | 40M | |
![[ ]](/icons/layout.gif) | 110314_Wenallt Farm,..> | 2025-03-14 00:12 | 1.1M | |
![[ ]](/icons/layout.gif) | 110311_Plot North of..> | 2025-03-14 00:12 | 7.2M | |
![[ ]](/icons/layout.gif) | 110313_Old Smithy, C..> | 2025-03-14 00:12 | 10M | |
![[ ]](/icons/layout.gif) | 109401_Machynys 2016..> | 2025-03-14 00:12 | 7.8M | |
![[ ]](/icons/layout.gif) | 110310_Land N of Cro..> | 2025-03-14 00:12 | 13M | |
![[ ]](/icons/layout.gif) | 109393_Pembrey_Air_f..> | 2025-03-14 00:12 | 2.5M | |
![[ ]](/icons/layout.gif) | 109396 St Patrick's ..> | 2025-03-14 00:13 | 11M | |
![[ ]](/icons/layout.gif) | 109392_West_Tarr_Far..> | 2025-03-14 00:13 | 9.5M | |
![[ ]](/icons/layout.gif) | 109389_East_Quay_Car..> | 2025-03-14 00:13 | 1.8M | |
![[ ]](/icons/layout.gif) | 109391_Kiln Park, Cr..> | 2025-03-14 00:13 | 5.7M | |
![[ ]](/icons/layout.gif) | 109388_Aberystwyth_I..> | 2025-03-14 00:13 | 4.4M | |
![[ ]](/icons/layout.gif) | 109387_LLanddewi_Vel..> | 2025-03-14 00:13 | 1.5M | |
![[ ]](/icons/layout.gif) | 109383_St_Mary's_Chu..> | 2025-03-14 00:13 | 2.5M | |
![[ ]](/icons/layout.gif) | 109386_Land adjoinin..> | 2025-03-14 00:13 | 8.8M | |
![[ ]](/icons/layout.gif) | 109382_Princes_Gate_..> | 2025-03-14 00:13 | 11M | |
![[ ]](/icons/layout.gif) | 109375_Trefloyne_Man..> | 2025-03-14 00:13 | 6.1M | |
![[ ]](/icons/layout.gif) | 109373 Gothic Arcade..> | 2025-03-14 00:13 | 11M | |
![[ ]](/icons/layout.gif) | 109365_Cryngae_Mawr_..> | 2025-03-14 00:13 | 8.9M | |
![[ ]](/icons/layout.gif) | 109361_Land_at_Maenh..> | 2025-03-14 00:13 | 6.3M | |
![[ ]](/icons/layout.gif) | 109364_Aberystwyth_U..> | 2025-03-14 00:13 | 13M | |
![[ ]](/icons/layout.gif) | 109360_Trewarren_Far..> | 2025-03-14 00:13 | 1.4M | |
![[ ]](/icons/layout.gif) | 109359_Trewarren_Far..> | 2025-03-14 00:13 | 4.0M | |
![[ ]](/icons/layout.gif) | 109358_Pembroke_Cast..> | 2025-03-14 00:13 | 3.6M | |
![[ ]](/icons/layout.gif) | 109354 Coed Y Pia Me..> | 2025-03-14 00:13 | 3.3M | |
![[ ]](/icons/layout.gif) | 109352_CILFOWYR_CHAP..> | 2025-03-14 00:13 | 1.6M | |
![[ ]](/icons/layout.gif) | 109351_Scotsborough_..> | 2025-03-14 00:13 | 3.6M | |
![[ ]](/icons/layout.gif) | 109357_Great_Nash_Ge..> | 2025-03-14 00:13 | 30M | |
![[ ]](/icons/layout.gif) | 109350_St_Nons_Chape..> | 2025-03-14 00:13 | 1.8M | |
![[ ]](/icons/layout.gif) | 109225_Historic_Buil..> | 2025-03-14 00:13 | 1.4M | |
![[ ]](/icons/layout.gif) | 109348_Llanelli_Rail..> | 2025-03-14 00:13 | 9.8M | |
![[ ]](/icons/layout.gif) | 109181_PART_3_Wemyss..> | 2025-03-14 00:13 | 2.4M | |
![[ ]](/icons/layout.gif) | 109181_PART_2_Esgair..> | 2025-03-14 00:13 | 2.2M | |
![[ ]](/icons/layout.gif) | 108992 Globe Hotel, ..> | 2025-03-14 00:13 | 1.4M | |
![[ ]](/icons/layout.gif) | 109181 PART 1 Abbey ..> | 2025-03-14 00:13 | 6.1M | |
![[ ]](/icons/layout.gif) | 108991 3 Clos Ty Gwy..> | 2025-03-14 00:13 | 1.1M | |
![[ ]](/icons/layout.gif) | 108990-Monkton_Churc..> | 2025-03-14 00:13 | 4.9M | |
![[ ]](/icons/layout.gif) | 108935 Wogaston wate..> | 2025-03-14 00:13 | 950K | |
![[ ]](/icons/layout.gif) | 108988 Parc Hinds Ri..> | 2025-03-14 00:13 | 6.7M | |
![[ ]](/icons/layout.gif) | 108884 Woollen Indus..> | 2025-03-14 00:13 | 2.7M | |
![[ ]](/icons/layout.gif) | 108786 Pembroke Cast..> | 2025-03-14 00:13 | 889K | |
![[ ]](/icons/layout.gif) | 108883_NBGW_Archaeol..> | 2025-03-14 00:13 | 20M | |
![[ ]](/icons/layout.gif) | 108785 St Gwynog's C..> | 2025-03-14 00:13 | 2.4M | |
![[ ]](/icons/layout.gif) | 108640 Bank Farm, Ll..> | 2025-03-14 00:13 | 2.2M | |
![[ ]](/icons/layout.gif) | 108639 Cross Inn Far..> | 2025-03-14 00:13 | 1.1M | |
![[ ]](/icons/layout.gif) | 108637 Church lane, ..> | 2025-03-14 00:13 | 8.2M | |
![[ ]](/icons/layout.gif) | 108638 Quinquennial ..> | 2025-03-14 00:13 | 21M | |
![[ ]](/icons/layout.gif) | 108559 Llanllyr 2015..> | 2025-03-14 00:13 | 9.5M | |
![[ ]](/icons/layout.gif) | 108541Cylch Caron Pr..> | 2025-03-14 00:13 | 1.4M | |
![[ ]](/icons/layout.gif) | 108545 St Davids Chu..> | 2025-03-14 00:13 | 2.8M | |
![[ ]](/icons/layout.gif) | 108537 First World W..> | 2025-03-14 00:13 | 3.0M | |
![[ ]](/icons/layout.gif) | 108532 Hendrewen Win..> | 2025-03-14 00:13 | 3.7M | |
![[ ]](/icons/layout.gif) | 108539 St Patrick's ..> | 2025-03-14 00:13 | 2.1M | |
![[ ]](/icons/layout.gif) | 108524_ Nant Caerhed..> | 2025-03-14 00:13 | 2.5M | |
![[ ]](/icons/layout.gif) | 108529 Frongoch Meta..> | 2025-03-14 00:13 | 5.2M | |
![[ ]](/icons/layout.gif) | 108470 Brunant Highw..> | 2025-03-14 00:13 | 4.2M | |
![[ ]](/icons/layout.gif) | 108467 Report No 201..> | 2025-03-14 00:13 | 5.3M | |
![[ ]](/icons/layout.gif) | 1082 Cardigan Castle..> | 2025-03-14 00:13 | 9.0M | |
![[ ]](/icons/layout.gif) | 107931 Turnpike And ..> | 2025-03-14 00:13 | 1.2M | |
![[ ]](/icons/layout.gif) | 107931 Turnpikes Int..> | 2025-03-14 00:13 | 1.4M | |
![[ ]](/icons/layout.gif) | 107908 Drefach Prim..> | 2025-03-14 00:13 | 3.6M | |
![[ ]](/icons/layout.gif) | 107907 Black Lion Ho..> | 2025-03-14 00:13 | 1.6M | |
![[ ]](/icons/layout.gif) | 107905 Heol Llwyn Be..> | 2025-03-14 00:13 | 2.6M | |
![[ ]](/icons/layout.gif) | 107903 Lavender Cott..> | 2025-03-14 00:13 | 903K | |
![[ ]](/icons/layout.gif) | 107702 Brest Cwm Llw..> | 2025-03-14 00:13 | 2.1M | |
![[ ]](/icons/layout.gif) | 107904 Cardigan Tida..> | 2025-03-14 00:13 | 2.9M | |
![[ ]](/icons/layout.gif) | 107551 and 106478 T..> | 2025-03-14 00:13 | 8.6M | |
![[ ]](/icons/layout.gif) | 107550_Templeton_201..> | 2025-03-14 00:13 | 8.8M | |
![[ ]](/icons/layout.gif) | 107549 Land adj to C..> | 2025-03-14 00:13 | 1.6M | |
![[ ]](/icons/layout.gif) | 107540 Maes y Garn S..> | 2025-03-14 00:13 | 1.7M | |
![[ ]](/icons/layout.gif) | 107539 Land south of..> | 2025-03-14 00:13 | 4.1M | |
![[ ]](/icons/layout.gif) | 107538 St Ishmael's ..> | 2025-03-14 00:13 | 1.3M | |
![[ ]](/icons/layout.gif) | 107537 Glyn-yr-Odyn,..> | 2025-03-14 00:13 | 908K | |
![[ ]](/icons/layout.gif) | 107535 Lampeter Univ..> | 2025-03-14 00:13 | 1.1M | |
![[ ]](/icons/layout.gif) | 107536 Grug Y Mynydd..> | 2025-03-14 00:13 | 1.9M | |
![[ ]](/icons/layout.gif) | 107534 Heol Llwyn Be..> | 2025-03-14 00:13 | 1.2M | |
![[ ]](/icons/layout.gif) | 107533 Commodore Hot..> | 2025-03-14 00:13 | 1.5M | |
![[ ]](/icons/layout.gif) | 107531 Felin Wnda wa..> | 2025-03-14 00:13 | 1.9M | |
![[ ]](/icons/layout.gif) | 107532 St Catherine ..> | 2025-03-14 00:13 | 3.4M | |
![[ ]](/icons/layout.gif) | 107527 Tenby Junior ..> | 2025-03-14 00:13 | 2.5M | |
![[ ]](/icons/layout.gif) | 107530 St Ina's Chur..> | 2025-03-14 00:13 | 3.4M | |
![[ ]](/icons/layout.gif) | 107524 Lochmeyler Fa..> | 2025-03-14 00:13 | 3.4M | |
![[ ]](/icons/layout.gif) | 107523 Glyn-Yr-Odyn ..> | 2025-03-14 00:13 | 5.2M | |
![[ ]](/icons/layout.gif) | 107517 St Dogmaels, ..> | 2025-03-14 00:13 | 1.1M | |
![[ ]](/icons/layout.gif) | 107516 Aberystwyth G..> | 2025-03-14 00:13 | 2.6M | |
![[ ]](/icons/layout.gif) | 107514 Foelcwan Farm..> | 2025-03-14 00:13 | 1.1M | |
![[ ]](/icons/layout.gif) | 107513 Delta Lakes W..> | 2025-03-14 00:13 | 2.4M | |
![[ ]](/icons/layout.gif) | 107512 Llanllyr 2014..> | 2025-03-14 00:13 | 4.7M | |
![[ ]](/icons/layout.gif) | 107510 St Michaels C..> | 2025-03-14 00:13 | 619K | |
![[ ]](/icons/layout.gif) | 107511 Llanelli Seas..> | 2025-03-14 00:13 | 7.8M | |
![[ ]](/icons/layout.gif) | 107509 Ynyslas Hulks..> | 2025-03-14 00:13 | 1.4M | |
![[ ]](/icons/layout.gif) | 107509_Ynyslas_2015_..> | 2025-03-14 00:13 | 16M | |
![[ ]](/icons/layout.gif) | 107507 Manorbier Cas..> | 2025-03-14 00:13 | 1.4M | |
![[ ]](/icons/layout.gif) | 107508 Wiston Roman ..> | 2025-03-14 00:13 | 2.7M | |
![[ ]](/icons/layout.gif) | 107363 updated North..> | 2025-03-14 00:13 | 1.2M | |
![[ ]](/icons/layout.gif) | 107364 Gwaunfa, Newp..> | 2025-03-14 00:13 | 5.6M | |
![[ ]](/icons/layout.gif) | 107362 - Solva WWTW ..> | 2025-03-14 00:13 | 6.1M | |
![[ ]](/icons/layout.gif) | 107260 Deer Park Thr..> | 2025-03-14 00:13 | 3.3M | |
![[ ]](/icons/layout.gif) | 107301 Bulford Road ..> | 2025-03-14 00:13 | 2.2M | |
![[ ]](/icons/layout.gif) | 106716 Henllan WWTW ..> | 2025-03-14 00:14 | 2.3M | |
![[ ]](/icons/layout.gif) | 106670 Bryn Doulau F..> | 2025-03-14 00:14 | 4.0M | |
![[ ]](/icons/layout.gif) | 106685 St Patrick's ..> | 2025-03-14 00:14 | 13M | |
![[ ]](/icons/layout.gif) | 106669 Martin Hill E..> | 2025-03-14 00:14 | 2.9M | |
![[ ]](/icons/layout.gif) | 106668 Rose Cottage ..> | 2025-03-14 00:14 | 3.1M | |
![[ ]](/icons/layout.gif) | 106563 Calch Project..> | 2025-03-14 00:14 | 1.7M | |
![[ ]](/icons/layout.gif) | 106535_Parrog Road_N..> | 2025-03-14 00:14 | 3.4M | |
![[ ]](/icons/layout.gif) | 106533_FairlieBookle..> | 2025-03-14 00:14 | 228K | |
![[ ]](/icons/layout.gif) | 106494 Roman Forts S..> | 2025-03-14 00:14 | 840K | |
![[ ]](/icons/layout.gif) | 106493 First World W..> | 2025-03-14 00:14 | 2.2M | |
![[ ]](/icons/layout.gif) | 106480 & 105522 Arfo..> | 2025-03-14 00:14 | 3.2M | |
![[ ]](/icons/layout.gif) | 106479 Land_west_of_..> | 2025-03-14 00:14 | 3.4M | |
![[ ]](/icons/layout.gif) | 106466_15_Castle_Str..> | 2025-03-14 00:14 | 6.5M | |
![[ ]](/icons/layout.gif) | 106465 Kidwelly Chur..> | 2025-03-14 00:14 | 7.3M | |
![[ ]](/icons/layout.gif) | 106464 Medieval and ..> | 2025-03-14 00:14 | 4.3M | |
![[ ]](/icons/layout.gif) | 106463 Haverfordwest..> | 2025-03-14 00:14 | 718K | |
![[ ]](/icons/layout.gif) | 106460 - Llanelli Se..> | 2025-03-14 00:14 | 3.8M | |
![[ ]](/icons/layout.gif) | 106207_North_of_Cled..> | 2025-03-14 00:14 | 5.1M | |
![[ ]](/icons/layout.gif) | 105883 Cwmystwyth Mi..> | 2025-03-14 00:14 | 2.7M | |
![[ ]](/icons/layout.gif) | 106538 Coal mines fi..> | 2025-03-14 00:14 | 115M | |
![[ ]](/icons/layout.gif) | 105880 Barnlake Poin..> | 2025-03-14 00:14 | 968K | |
![[ ]](/icons/layout.gif) | 105881_Henllan Amgoe..> | 2025-03-14 00:14 | 14M | |
![[ ]](/icons/layout.gif) | 105878 St Justinians..> | 2025-03-14 00:14 | 1.5M | |
![[ ]](/icons/layout.gif) | 105879 St. Tybie's C..> | 2025-03-14 00:14 | 1.6M | |
![[ ]](/icons/layout.gif) | 105812 Lower Albion,..> | 2025-03-14 00:14 | 2.4M | |
![[ ]](/icons/layout.gif) | 105815 Wiston Evalua..> | 2025-03-14 00:14 | 1.3M | |
![[ ]](/icons/layout.gif) | 105810 Report No 201..> | 2025-03-14 00:14 | 2.3M | |
![[ ]](/icons/layout.gif) | 105808 St Cynllos Ch..> | 2025-03-14 00:14 | 3.6M | |
![[ ]](/icons/layout.gif) | 105811 CRUGIAU CEMMA..> | 2025-03-14 00:14 | 12M | |
![[ ]](/icons/layout.gif) | 105807 Llanarthney c..> | 2025-03-14 00:14 | 959K | |
![[ ]](/icons/layout.gif) | 105804 Blaenlliedi F..> | 2025-03-14 00:14 | 4.0M | |
![[ ]](/icons/layout.gif) | 105805 Maes Y Crug, ..> | 2025-03-14 00:14 | 2.1M | |
![[ ]](/icons/layout.gif) | 105803 Neuadd Llanon..> | 2025-03-14 00:14 | 9.5M | |
![[ ]](/icons/layout.gif) | 105803 Neuadd Llanon..> | 2025-03-14 00:14 | 9.3M | |
![[ ]](/icons/layout.gif) | 105727 Llain Farm Wi..> | 2025-03-14 00:14 | 4.8M | |
![[ ]](/icons/layout.gif) | 105803 Neuadd Llanon..> | 2025-03-14 00:14 | 15M | |
![[ ]](/icons/layout.gif) | 105724_Llansadwrn_Dw..> | 2025-03-14 00:14 | 3.6M | |
![[ ]](/icons/layout.gif) | 105658 Trebover Farm..> | 2025-03-14 00:14 | 3.0M | |
![[ ]](/icons/layout.gif) | 105656 Goat Street S..> | 2025-03-14 00:14 | 4.4M | |
![[ ]](/icons/layout.gif) | 105623 A0027426 UID3..> | 2025-03-14 00:14 | 666K | |
![[ ]](/icons/layout.gif) | 105638 Park Cottage ..> | 2025-03-14 00:14 | 3.0M | |
![[ ]](/icons/layout.gif) | 105621 A0027772 UID ..> | 2025-03-14 00:14 | 749K | |
![[ ]](/icons/layout.gif) | 105610 A0011091 UID ..> | 2025-03-14 00:14 | 733K | |
![[ ]](/icons/layout.gif) | 105608 A0028431 UID ..> | 2025-03-14 00:14 | 252K | |
![[ ]](/icons/layout.gif) | 105607 A0026780 UID ..> | 2025-03-14 00:14 | 394K | |
![[ ]](/icons/layout.gif) | 105609 A0032193 UID3..> | 2025-03-14 00:14 | 4.0M | |
![[ ]](/icons/layout.gif) | 105606 A0026780 UID ..> | 2025-03-14 00:14 | 403K | |
![[ ]](/icons/layout.gif) | 105604 A0026780 UID3..> | 2025-03-14 00:14 | 215K | |
![[ ]](/icons/layout.gif) | 105603 A0027988 UID ..> | 2025-03-14 00:14 | 1.4M | |
![[ ]](/icons/layout.gif) | 105602 A0027711 UID ..> | 2025-03-14 00:14 | 1.0M | |
![[ ]](/icons/layout.gif) | 105601 A0035981 UID ..> | 2025-03-14 00:14 | 458K | |
![[ ]](/icons/layout.gif) | 105600 A0035981 UID ..> | 2025-03-14 00:14 | 593K | |
![[ ]](/icons/layout.gif) | 105599 A0035981 UID ..> | 2025-03-14 00:14 | 567K | |
![[ ]](/icons/layout.gif) | 105598 A0027711 UID ..> | 2025-03-14 00:14 | 526K | |
![[ ]](/icons/layout.gif) | 105595 A0028400 UID ..> | 2025-03-14 00:14 | 572K | |
![[ ]](/icons/layout.gif) | 105594 A0028402 UID ..> | 2025-03-14 00:14 | 504K | |
![[ ]](/icons/layout.gif) | 105593 A0028402 UID ..> | 2025-03-14 00:14 | 544K | |
![[ ]](/icons/layout.gif) | 105592 A0028402 UID ..> | 2025-03-14 00:14 | 560K | |
![[ ]](/icons/layout.gif) | 105591 A0028402 UID ..> | 2025-03-14 00:14 | 486K | |
![[ ]](/icons/layout.gif) | 105590 A0028402 UID ..> | 2025-03-14 00:14 | 468K | |
![[ ]](/icons/layout.gif) | 105589 A0028402 UID ..> | 2025-03-14 00:14 | 570K | |
![[ ]](/icons/layout.gif) | 105588 A0028402 UID ..> | 2025-03-14 00:14 | 545K | |
![[ ]](/icons/layout.gif) | 105587 Argel, Johnst..> | 2025-03-14 00:14 | 1.7M | |
![[ ]](/icons/layout.gif) | 105583 Conservation ..> | 2025-03-14 00:14 | 2.0M | |
![[ ]](/icons/layout.gif) | 105581 Storm Drainag..> | 2025-03-14 00:14 | 945K | |
![[ ]](/icons/layout.gif) | 105577 A0027728 UID ..> | 2025-03-14 00:14 | 530K | |
![[ ]](/icons/layout.gif) | 105576 A0026389 UID ..> | 2025-03-14 00:14 | 576K | |
![[ ]](/icons/layout.gif) | 105575 A0025288 UID ..> | 2025-03-14 00:14 | 579K | |
![[ ]](/icons/layout.gif) | 105573 A0026726 UID ..> | 2025-03-14 00:14 | 648K | |
![[ ]](/icons/layout.gif) | 105580 St Caradoc's ..> | 2025-03-14 00:14 | 817K | |
![[ ]](/icons/layout.gif) | 105572 A0026355 UID ..> | 2025-03-14 00:14 | 523K | |
![[ ]](/icons/layout.gif) | 105570 A0025592 UID ..> | 2025-03-14 00:14 | 380K | |
![[ ]](/icons/layout.gif) | 105571 A0028414 UID ..> | 2025-03-14 00:14 | 953K | |
![[ ]](/icons/layout.gif) | 105569 A0038415 UID ..> | 2025-03-14 00:14 | 2.0M | |
![[ ]](/icons/layout.gif) | 105557 A0026711 UID ..> | 2025-03-14 00:14 | 498K | |
![[ ]](/icons/layout.gif) | 105556 A0026711 UID ..> | 2025-03-14 00:14 | 546K | |
![[ ]](/icons/layout.gif) | 105555 A0026711 UID ..> | 2025-03-14 00:14 | 585K | |
![[ ]](/icons/layout.gif) | 105554 A0026711 UID ..> | 2025-03-14 00:14 | 641K | |
![[ ]](/icons/layout.gif) | 105553 A0026711 UID ..> | 2025-03-14 00:14 | 728K | |
![[ ]](/icons/layout.gif) | 105558 St Brynach's ..> | 2025-03-14 00:14 | 4.3M | |
![[ ]](/icons/layout.gif) | 105552 A0026648 UID ..> | 2025-03-14 00:14 | 609K | |
![[ ]](/icons/layout.gif) | 105551 A0026451 UID ..> | 2025-03-14 00:14 | 805K | |
![[ ]](/icons/layout.gif) | 105550 A0023376 UID ..> | 2025-03-14 00:14 | 921K | |
![[ ]](/icons/layout.gif) | 105549 A0019873 UID ..> | 2025-03-14 00:14 | 408K | |
![[ ]](/icons/layout.gif) | 105547 A0029530 UID ..> | 2025-03-14 00:14 | 779K | |
![[ ]](/icons/layout.gif) | 105545 A0021003 UID ..> | 2025-03-14 00:14 | 753K | |
![[ ]](/icons/layout.gif) | 105546 A0034636, UID..> | 2025-03-14 00:14 | 1.4M | |
![[ ]](/icons/layout.gif) | 105544 A0021003, UID..> | 2025-03-14 00:14 | 334K | |
![[ ]](/icons/layout.gif) | 105543 A0030211 UID ..> | 2025-03-14 00:14 | 462K | |
![[ ]](/icons/layout.gif) | 105541 A0029530 UID ..> | 2025-03-14 00:14 | 368K | |
![[ ]](/icons/layout.gif) | 105542 A0028520 UID ..> | 2025-03-14 00:14 | 288K | |
![[ ]](/icons/layout.gif) | 105539 A0029173 UID ..> | 2025-03-14 00:14 | 455K | |
![[ ]](/icons/layout.gif) | 105540 A0028622 UID ..> | 2025-03-14 00:14 | 643K | |
![[ ]](/icons/layout.gif) | 105537 A0030021 UID ..> | 2025-03-14 00:14 | 727K | |
![[ ]](/icons/layout.gif) | 105538 A0029173 UID ..> | 2025-03-14 00:14 | 510K | |
![[ ]](/icons/layout.gif) | 105536 A0028698 UID ..> | 2025-03-14 00:14 | 567K | |
![[ ]](/icons/layout.gif) | 105535 A0028557 UID ..> | 2025-03-14 00:14 | 663K | |
![[ ]](/icons/layout.gif) | 105533 A0030021 UID ..> | 2025-03-14 00:14 | 1.1M | |
![[ ]](/icons/layout.gif) | 105532 A0030021 UID ..> | 2025-03-14 00:14 | 1.1M | |
![[ ]](/icons/layout.gif) | 105530 A0028520 UID ..> | 2025-03-14 00:14 | 539K | |
![[ ]](/icons/layout.gif) | 105531 A0031492 UID ..> | 2025-03-14 00:14 | 960K | |
![[ ]](/icons/layout.gif) | 105529 A0029530 UID ..> | 2025-03-14 00:14 | 476K | |
![[ ]](/icons/layout.gif) | 105528 A0028568 UID ..> | 2025-03-14 00:14 | 453K | |
![[ ]](/icons/layout.gif) | 105526 West Rath geo..> | 2025-03-14 00:14 | 5.3M | |
![[ ]](/icons/layout.gif) | 105525 Excavations a..> | 2025-03-14 00:14 | 7.4M | |
![[ ]](/icons/layout.gif) | 105524 Four Wind Tur..> | 2025-03-14 00:14 | 1.4M | |
![[ ]](/icons/layout.gif) | 105523 Heron's Rest,..> | 2025-03-14 00:14 | 912K | |
![[ ]](/icons/layout.gif) | 105523 Herons Rest, ..> | 2025-03-14 00:14 | 912K | |
![[ ]](/icons/layout.gif) | 105463 A0023089 UID..> | 2025-03-14 00:14 | 460K | |
![[ ]](/icons/layout.gif) | 105465 Survey of Pre..> | 2025-03-14 00:14 | 531K | |
![[ ]](/icons/layout.gif) | 105462 A0027987 UID ..> | 2025-03-14 00:14 | 316K | |
![[ ]](/icons/layout.gif) | 105459 A0028396 UID ..> | 2025-03-14 00:14 | 300K | |
![[ ]](/icons/layout.gif) | 105458 A0022712 UID ..> | 2025-03-14 00:14 | 886K | |
![[ ]](/icons/layout.gif) | 105460 A0037456 UID ..> | 2025-03-14 00:14 | 3.2M | |
![[ ]](/icons/layout.gif) | 105453 A0027849 UID ..> | 2025-03-14 00:14 | 375K | |
![[ ]](/icons/layout.gif) | 105457 A0021933 UID ..> | 2025-03-14 00:14 | 1.0M | |
![[ ]](/icons/layout.gif) | 105452 A0027423 UID ..> | 2025-03-14 00:14 | 323K | |
![[ ]](/icons/layout.gif) | 105451 A0026781 311,..> | 2025-03-14 00:14 | 626K | |
![[ ]](/icons/layout.gif) | 105449 A0027900 UID ..> | 2025-03-14 00:14 | 316K | |
![[ ]](/icons/layout.gif) | 105444 A0022055 UID ..> | 2025-03-14 00:14 | 240K | |
![[ ]](/icons/layout.gif) | 105443 A0030682 UID ..> | 2025-03-14 00:14 | 919K | |
![[ ]](/icons/layout.gif) | 105442 A0023363 UID ..> | 2025-03-14 00:14 | 432K | |
![[ ]](/icons/layout.gif) | 105441 A0030255 UID ..> | 2025-03-14 00:14 | 591K | |
![[ ]](/icons/layout.gif) | 105440 A0029559 UID ..> | 2025-03-14 00:14 | 1.1M | |
![[ ]](/icons/layout.gif) | 105439 A0028666 UID ..> | 2025-03-14 00:14 | 940K | |
![[ ]](/icons/layout.gif) | 105438 A0027842 UID3..> | 2025-03-14 00:14 | 699K | |
![[ ]](/icons/layout.gif) | 105436 A0026688 UID ..> | 2025-03-14 00:14 | 436K | |
![[ ]](/icons/layout.gif) | 105437 A0027567 UIDs..> | 2025-03-14 00:14 | 774K | |
![[ ]](/icons/layout.gif) | 105435 A0026710 UID ..> | 2025-03-14 00:14 | 388K | |
![[ ]](/icons/layout.gif) | 105434 A0025576 UID ..> | 2025-03-14 00:14 | 624K | |
![[ ]](/icons/layout.gif) | 105433 A0028568 UID ..> | 2025-03-14 00:14 | 454K | |
![[ ]](/icons/layout.gif) | 105432 A0029016 UID ..> | 2025-03-14 00:14 | 557K | |
![[ ]](/icons/layout.gif) | 105431 A0028666 UID ..> | 2025-03-14 00:14 | 492K | |
![[ ]](/icons/layout.gif) | 105430 A0028969 UID ..> | 2025-03-14 00:14 | 610K | |
![[ ]](/icons/layout.gif) | 105429 A0030682 UID ..> | 2025-03-14 00:14 | 312K | |
![[ ]](/icons/layout.gif) | 105427 A0029537 UID ..> | 2025-03-14 00:14 | 615K | |
![[ ]](/icons/layout.gif) | 105428 A0011091 UID ..> | 2025-03-14 00:14 | 917K | |
![[ ]](/icons/layout.gif) | 105426 A0011091 UID3..> | 2025-03-14 00:14 | 248K | |
![[ ]](/icons/layout.gif) | 105425 A0031495 UID ..> | 2025-03-14 00:14 | 1.9M | |
![[ ]](/icons/layout.gif) | 105424 A0032174 UID ..> | 2025-03-14 00:14 | 1.1M | |
![[ ]](/icons/layout.gif) | 105422 Cadw DAT 124 ..> | 2025-03-14 00:14 | 3.5M | |
![[ ]](/icons/layout.gif) | 105423 Wiston Roman ..> | 2025-03-14 00:14 | 3.8M | |
![[ ]](/icons/layout.gif) | 105421 Caer Wen, Dwr..> | 2025-03-14 00:14 | 1.2M | |
![[ ]](/icons/layout.gif) | 105381 Nolton Mill b..> | 2025-03-14 00:14 | 5.1M | |
![[ ]](/icons/layout.gif) | 105379_ Machynys_Mou..> | 2025-03-14 00:14 | 7.9M | |
![[ ]](/icons/layout.gif) | 105346 Castell Heini..> | 2025-03-14 00:14 | 703K | |
![[ ]](/icons/layout.gif) | 105378 Nevern geophy..> | 2025-03-14 00:14 | 1.8M | |
![[ ]](/icons/layout.gif) | 105344 Military Airc..> | 2025-03-14 00:14 | 758K | |
![[ ]](/icons/layout.gif) | 105345 Penglais Farm..> | 2025-03-14 00:14 | 1.8M | |
![[ ]](/icons/layout.gif) | 104649_Lovelodge_Far..> | 2025-03-14 00:14 | 4.4M | |
![[ ]](/icons/layout.gif) | 103746 Abereiddy coa..> | 2025-03-14 00:14 | 4.5M | |
![[ ]](/icons/layout.gif) | 103695 A Strategic A..> | 2025-03-14 00:14 | 4.2M | |
![[ ]](/icons/layout.gif) | 103745 Water Main Re..> | 2025-03-14 00:14 | 8.5M | |
![[ ]](/icons/layout.gif) | 103633 St Marys Chur..> | 2025-03-14 00:14 | 2.1M | |
![[ ]](/icons/layout.gif) | 103633 St Mary's Chu..> | 2025-03-14 00:14 | 2.1M | |
![[ ]](/icons/layout.gif) | 103632 Airfields Fin..> | 2025-03-14 00:14 | 2.9M | |
![[ ]](/icons/layout.gif) | 103631 First World W..> | 2025-03-14 00:14 | 867K | |
![[ ]](/icons/layout.gif) | 103632 Airfield disp..> | 2025-03-14 00:14 | 7.7M | |
![[ ]](/icons/layout.gif) | 103628 Tremoilet Win..> | 2025-03-14 00:14 | 5.4M | |
![[ ]](/icons/layout.gif) | 103629 CRUGIAU CEMMA..> | 2025-03-14 00:14 | 1.9M | |
![[ ]](/icons/layout.gif) | 103627 Fron Goch Pha..> | 2025-03-14 00:14 | 1.1M | |
![[ ]](/icons/layout.gif) | 103456 131 Priory St..> | 2025-03-14 00:14 | 2.0M | |
![[ ]](/icons/layout.gif) | 102931 Cegin Foch bu..> | 2025-03-14 00:14 | 1.3M | |
![[ ]](/icons/layout.gif) | 103587 Manorbier Tur..> | 2025-03-14 00:14 | 766K | |
![[ ]](/icons/layout.gif) | 102929 Penrhiw-llan ..> | 2025-03-14 00:14 | 1.2M | |
![[ ]](/icons/layout.gif) | 102930 Penrhiw-llan,..> | 2025-03-14 00:14 | 1.8M | |
![[ ]](/icons/layout.gif) | 102928 Park St-Islan..> | 2025-03-14 00:14 | 905K | |
![[ ]](/icons/layout.gif) | 102927 Land at Cwrt ..> | 2025-03-14 00:14 | 945K | |
![[ ]](/icons/layout.gif) | 102875 Medieval and ..> | 2025-03-14 00:14 | 443K | |
![[ ]](/icons/layout.gif) | 102873 Pembroke Cycl..> | 2025-03-14 00:14 | 4.0M | |
![[ ]](/icons/layout.gif) | 102926 Brickyard Lan..> | 2025-03-14 00:14 | 13M | |
![[ ]](/icons/layout.gif) | 102871 Ivy Court, Ll..> | 2025-03-14 00:14 | 11M | |
![[ ]](/icons/layout.gif) | 102871 Ivy Court Lly..> | 2025-03-14 00:14 | 11M | |
![[ ]](/icons/layout.gif) | 102869 Old School St..> | 2025-03-14 00:14 | 10M | |
![[ ]](/icons/layout.gif) | 102868 Llancynfelen ..> | 2025-03-14 00:14 | 6.9M | |
![[ ]](/icons/layout.gif) | 102841 Heritage Mana..> | 2025-03-14 00:14 | 913K | |
![[ ]](/icons/layout.gif) | 102831 Aberystwyth ..> | 2025-03-14 00:14 | 3.0M | |
![[ ]](/icons/layout.gif) | 102821 Penally water..> | 2025-03-14 00:14 | 5.0M | |
![[ ]](/icons/layout.gif) | 102815 Medieval and ..> | 2025-03-14 00:14 | 6.2M | |
![[ ]](/icons/layout.gif) | 102814 Medieval and ..> | 2025-03-14 00:14 | 12M | |
![[ ]](/icons/layout.gif) | 102763 & 102765 Arfo..> | 2025-03-14 00:14 | 2.3M | |
![[ ]](/icons/layout.gif) | 102763 ARFORDIR 2012..> | 2025-03-14 00:14 | 1.0M | |
![[ ]](/icons/layout.gif) | 102667 Pengwern Isaf..> | 2025-03-14 00:14 | 1.5M | |
![[ ]](/icons/layout.gif) | 102666 Fron Goch Geo..> | 2025-03-14 00:14 | 5.9M | |
![[ ]](/icons/layout.gif) | 102665 Mills interim..> | 2025-03-14 00:14 | 5.4M | |
![[ ]](/icons/layout.gif) | 102665 Med and Early..> | 2025-03-14 00:14 | 1.5M | |
![[ ]](/icons/layout.gif) | 102665 Medieval and ..> | 2025-03-14 00:14 | 9.8M | |
![[ ]](/icons/layout.gif) | 102642 Richmond Park..> | 2025-03-14 00:14 | 4.7M | |
![[ ]](/icons/layout.gif) | 102639 Later Medieva..> | 2025-03-14 00:14 | 2.1M | |
![[ ]](/icons/layout.gif) | 102638- Frongoch DBA..> | 2025-03-14 00:14 | 3.3M | |
![[ ]](/icons/layout.gif) | 102643_131_Priory_St..> | 2025-03-14 00:14 | 6.2M | |
![[ ]](/icons/layout.gif) | 102638- Frongoch DBA..> | 2025-03-14 00:14 | 2.4M | |
![[ ]](/icons/layout.gif) | 102637 Llanunwas Nor..> | 2025-03-14 00:14 | 7.0M | |
![[ ]](/icons/layout.gif) | 102598 Priskilly Tyc..> | 2025-03-14 00:15 | 3.7M | |
![[ ]](/icons/layout.gif) | 102633 St Marys Cyng..> | 2025-03-14 00:15 | 2.8M | |
![[ ]](/icons/layout.gif) | 102588 Former Mainte..> | 2025-03-14 00:15 | 3.7M | |
![[ ]](/icons/layout.gif) | 102591 Cylch Caron D..> | 2025-03-14 00:15 | 5.7M | |
![[ ]](/icons/layout.gif) | 102586 Old Mill Mydd..> | 2025-03-14 00:15 | 8.2M | |
![[ ]](/icons/layout.gif) | 102584 Plas Abermeur..> | 2025-03-14 00:15 | 2.9M | |
![[ ]](/icons/layout.gif) | 102583 Newport Rugby..> | 2025-03-14 00:15 | 1.3M | |
![[ ]](/icons/layout.gif) | 102581 Brickyard Lan..> | 2025-03-14 00:15 | 2.1M | |
![[ ]](/icons/layout.gif) | 102580 Penybanc Cast..> | 2025-03-14 00:15 | 11M | |
![[ ]](/icons/layout.gif) | 102579 Stradey Park ..> | 2025-03-14 00:15 | 12M | |
![[ ]](/icons/layout.gif) | 102425 No 20 Angle, ..> | 2025-03-14 00:15 | 6.6M | |
![[ ]](/icons/layout.gif) | 102417 Ammanford Cas..> | 2025-03-14 00:15 | 12M | |
![[ ]](/icons/layout.gif) | 102421,102422,102423..> | 2025-03-14 00:15 | 15M | |
![[ ]](/icons/layout.gif) | 102416 Twentieth Mil..> | 2025-03-14 00:15 | 2.3M | |
![[ ]](/icons/layout.gif) | 102353 Stackpole Cou..> | 2025-03-14 00:15 | 1.6M | |
![[ ]](/icons/layout.gif) | 102354 Land off New ..> | 2025-03-14 00:15 | 5.3M | |
![[ ]](/icons/layout.gif) | 102248 Stackpole Wal..> | 2025-03-14 00:15 | 1.2M | |
![[ ]](/icons/layout.gif) | 102247 Dale Road, Hu..> | 2025-03-14 00:15 | 1.7M | |
![[ ]](/icons/layout.gif) | 102249 Brynheulog Ll..> | 2025-03-14 00:15 | 7.4M | |
![[ ]](/icons/layout.gif) | 102245 St Michaels C..> | 2025-03-14 00:15 | 802K | |
![[ ]](/icons/layout.gif) | 102246 Ty Mawr Farm,..> | 2025-03-14 00:15 | 9.2M | |
![[ ]](/icons/layout.gif) | 102244 Kingsfold Jun..> | 2025-03-14 00:15 | 4.5M | |
![[ ]](/icons/layout.gif) | 102242 Chevron Oil R..> | 2025-03-14 00:15 | 4.7M | |
![[ ]](/icons/layout.gif) | 102241 Monkton Prior..> | 2025-03-14 00:15 | 7.0M | |
![[ ]](/icons/layout.gif) | 102240 Castle Mill, ..> | 2025-03-14 00:15 | 8.7M | |
![[ ]](/icons/layout.gif) | 100749 Dwr Cymru Wat..> | 2025-03-14 00:15 | 1.9M | |
![[ ]](/icons/layout.gif) | 102239 LLANSTADWELL ..> | 2025-03-14 00:15 | 8.3M | |
![[ ]](/icons/layout.gif) | 100748 ST Cynllo_'s ..> | 2025-03-14 00:15 | 2.8M | |
![[ ]](/icons/layout.gif) | 100748 ST Cynllos Ch..> | 2025-03-14 00:15 | 3.0M | |
![[ ]](/icons/layout.gif) | 100747 Jameston Comm..> | 2025-03-14 00:15 | 1.3M | |
![[ ]](/icons/layout.gif) | 100735 Medieval and ..> | 2025-03-14 00:15 | 1.1M | |
![[ ]](/icons/layout.gif) | 100735 Medieval & Ea..> | 2025-03-14 00:15 | 3.8M | |
![[ ]](/icons/layout.gif) | 100746 Excavations a..> | 2025-03-14 00:15 | 12M | |
![[ ]](/icons/layout.gif) | 100722 Land To The R..> | 2025-03-14 00:15 | 4.2M | |
![[ ]](/icons/layout.gif) | 100721 Llanfair Ar Y..> | 2025-03-14 00:15 | 7.9M | |
![[ ]](/icons/layout.gif) | 100720 Strata Florid..> | 2025-03-14 00:15 | 3.8M | |
![[ ]](/icons/layout.gif) | 100689 Scheduling En..> | 2025-03-14 00:15 | 1.9M | |
![[ ]](/icons/layout.gif) | 100723 Roch Castle, ..> | 2025-03-14 00:15 | 47M | |
![[ ]](/icons/layout.gif) | 100635 Lan Building ..> | 2025-03-14 00:15 | 18M | |
![[ ]](/icons/layout.gif) | 100611 A Late Bronze..> | 2025-03-14 00:15 | 420K | |
![[ ]](/icons/layout.gif) | 100612 Arfordir Coas..> | 2025-03-14 00:15 | 15M | |
![[ ]](/icons/layout.gif) | 100609_WestCoastPala..> | 2025-03-14 00:15 | 10M | |
![[ ]](/icons/layout.gif) | 100560 Pantybutler R..> | 2025-03-14 00:15 | 4.4M | |
![[ ]](/icons/layout.gif) | 100559 Maesllan Watc..> | 2025-03-14 00:15 | 2.6M | |
![[ ]](/icons/layout.gif) | 100558 Maes y Ffair,..> | 2025-03-14 00:15 | 1.1M | |
![[ ]](/icons/layout.gif) | 100556 Stackpole Cau..> | 2025-03-14 00:15 | 2.7M | |
![[ ]](/icons/layout.gif) | 100554 Blaen Myherin..> | 2025-03-14 00:15 | 6.5M | |
![[ ]](/icons/layout.gif) | 100549 Capel Iago ge..> | 2025-03-14 00:15 | 2.9M | |
![[ ]](/icons/layout.gif) | 100548 Coedweddus Fa..> | 2025-03-14 00:15 | 3.5M | |
![[ ]](/icons/layout.gif) | 100547 Exploration T..> | 2025-03-14 00:15 | 1.6M | |
![[ ]](/icons/layout.gif) | 100491 Carew Castle ..> | 2025-03-14 00:15 | 1.5M | |
![[ ]](/icons/layout.gif) | 100490 Gelliwernen B..> | 2025-03-14 00:15 | 12M | |
![[ ]](/icons/layout.gif) | 100384 Medieval and ..> | 2025-03-14 00:15 | 3.2M | |
![[ ]](/icons/layout.gif) | 100384 Medieval and ..> | 2025-03-14 00:15 | 191K | |
![[ ]](/icons/layout.gif) | 100551-2 Bedd Arthur..> | 2025-03-14 00:15 | 44M | |
![[ ]](/icons/layout.gif) | 100383 Phase 2A Blue..> | 2025-03-14 00:15 | 1.1M | |
![[ ]](/icons/layout.gif) | 100380 No 49 Angle, ..> | 2025-03-14 00:15 | 2.1M | |
![[ ]](/icons/layout.gif) | 100252 Fan Barrow Ex..> | 2025-03-14 00:15 | 4.2M | |
![[ ]](/icons/layout.gif) | 100379 Llandeilo Ab..> | 2025-03-14 00:15 | 5.8M | |
![[ ]](/icons/layout.gif) | 100251 Upper Newton ..> | 2025-03-14 00:15 | 2.8M | |
![[ ]](/icons/layout.gif) | 100251 Upper Newton ..> | 2025-03-14 00:15 | 2.8M | |
![[ ]](/icons/layout.gif) | 100049 West Angle Ba..> | 2025-03-14 00:15 | 3.0M | |
![[ ]](/icons/layout.gif) | 100250 Machynys Wes..> | 2025-03-14 00:15 | 4.1M | |
![[ ]](/icons/layout.gif) | 100048 Cardigan Cast..> | 2025-03-14 00:15 | 5.0M | |
![[ ]](/icons/layout.gif) | 100047 Hanover Quay,..> | 2025-03-14 00:15 | 6.1M | |
![[ ]](/icons/layout.gif) | 100044 Lower Treginn..> | 2025-03-14 00:15 | 6.8M | |
![[ ]](/icons/layout.gif) | 100046 Possible Pond..> | 2025-03-14 00:15 | 15M | |
![[ ]](/icons/layout.gif) | 100041 Wern Fawr Ex..> | 2025-03-14 00:15 | 8.1M | |
![[ ]](/icons/layout.gif) | 100042,100043 Capely..> | 2025-03-14 00:15 | 17M | |
![[ ]](/icons/layout.gif) | 100039 Medieval and ..> | 2025-03-14 00:15 | 242K | |
![[ ]](/icons/layout.gif) | 100039 Medieval and ..> | 2025-03-14 00:15 | 1.5M | |
![[ ]](/icons/layout.gif) | 100039 Medieval & Po..> | 2025-03-14 00:15 | 511K | |
![[ ]](/icons/layout.gif) | 100040 Tir-y-dail Mo..> | 2025-03-14 00:15 | 8.5M | |
![[ ]](/icons/layout.gif) | 1-4 Castle Square, S..> | 2025-03-14 00:15 | 14M | |
![[ ]](/icons/layout.gif) | 1-4 Castle Square, S..> | 2025-03-14 00:15 | 1.2M | |
![[ ]](/icons/layout.gif) | 100039 Churches and ..> | 2025-03-14 00:15 | 25M | |
|
Apache/2.4.58 (Win64) OpenSSL/3.1.3 PHP/8.2.12 Server at www.walesher1974.org Port 80